vendor buildkit to fix a couple of bugs

Signed-off-by: Tibor Vass <tibor@docker.com>
(cherry picked from commit effa24bf48170f141cd9e1c1fcb5d39aedf1ca74)
Signed-off-by: Tibor Vass <tibor@docker.com>
Upstream-commit: 4c35d811471b80eec10476050b1222b653e6c5d9
Component: engine
This commit is contained in:
Tibor Vass
2018-08-31 01:18:39 +00:00
parent d448ca1e85
commit 90b4f8c14c
116 changed files with 5470 additions and 3762 deletions

View File

@ -1,7 +1,7 @@
# the following lines are in sorted order, FYI
github.com/Azure/go-ansiterm d6e3b3328b783f23731bc4d058875b0371ff8109
github.com/Microsoft/hcsshim v0.6.12
github.com/Microsoft/go-winio v0.4.9
github.com/Microsoft/hcsshim 44c060121b68e8bdc40b411beba551f3b4ee9e55
github.com/Microsoft/go-winio v0.4.10
github.com/docker/libtrust 9cbd2a1374f46905c68a4eb3694a130610adc62a
github.com/go-check/check 4ed411733c5785b40214c70bce814c3a3a689609 https://github.com/cpuguy83/check.git
github.com/golang/gddo 9b12a26f3fbd7397dee4e20939ddca719d840d2a
@ -26,7 +26,7 @@ github.com/imdario/mergo v0.3.6
golang.org/x/sync 1d60e4601c6fd243af51cc01ddf169918a5407ca
# buildkit
github.com/moby/buildkit e1cd06ad6b74e4b747306c4408c451b3b6d87a89
github.com/moby/buildkit 6812dac65e0440bb75affce1fb2175e640edc15d
github.com/tonistiigi/fsutil b19464cd1b6a00773b4f2eb7acf9c30426f9df42
github.com/grpc-ecosystem/grpc-opentracing 8e809c8a86450a29b90dcc9efbf062d0fe6d9746
github.com/opentracing/opentracing-go 1361b9cd60be79c4c3a7fa9841b3c132e40066a7
@ -75,7 +75,7 @@ github.com/pborman/uuid v1.0
google.golang.org/grpc v1.12.0
# This does not need to match RUNC_COMMIT as it is used for helper packages but should be newer or equal
github.com/opencontainers/runc ad0f5255060d36872be04de22f8731f38ef2d7b1
github.com/opencontainers/runc 20aff4f0488c6d4b8df4d85b4f63f1f704c11abd
github.com/opencontainers/runtime-spec d810dbc60d8c5aeeb3d054bd1132fab2121968ce # v1.0.1-43-gd810dbc
github.com/opencontainers/image-spec v1.0.1
github.com/seccomp/libseccomp-golang 32f571b70023028bd57d9288c20efbcb237f3ce0
@ -114,11 +114,11 @@ github.com/googleapis/gax-go v2.0.0
google.golang.org/genproto 694d95ba50e67b2e363f3483057db5d4910c18f9
# containerd
github.com/containerd/containerd v1.2.0-beta.0
github.com/containerd/containerd v1.2.0-beta.2
github.com/containerd/fifo 3d5202aec260678c48179c56f40e6f38a095738c
github.com/containerd/continuity d3c23511c1bf5851696cba83143d9cbcd666869b
github.com/containerd/cgroups 5e610833b72089b37d0e615de9a92dfc043757c2
github.com/containerd/console 4d8a41f4ce5b9bae77c41786ea2458330f43f081
github.com/containerd/console c12b1e7919c14469339a5d38f2f8ed9b64a9de23
github.com/containerd/go-runc edcf3de1f4971445c42d61f20d506b30612aa031
github.com/containerd/typeurl a93fcdb778cd272c6e9b3028b2f42d813e785d40
github.com/containerd/ttrpc 94dde388801693c54f88a6596f713b51a8b30b2d

View File

@ -303,7 +303,7 @@ func FileInfoFromHeader(hdr *tar.Header) (name string, size int64, fileInfo *win
if err != nil {
return "", 0, nil, err
}
fileInfo.FileAttributes = uintptr(attr)
fileInfo.FileAttributes = uint32(attr)
} else {
if hdr.Typeflag == tar.TypeDir {
fileInfo.FileAttributes |= syscall.FILE_ATTRIBUTE_DIRECTORY

View File

@ -20,7 +20,8 @@ const (
// FileBasicInfo contains file access time and file attributes information.
type FileBasicInfo struct {
CreationTime, LastAccessTime, LastWriteTime, ChangeTime syscall.Filetime
FileAttributes uintptr // includes padding
FileAttributes uint32
pad uint32 // padding
}
// GetFileBasicInfo retrieves times and attributes for a file.

View File

@ -1,12 +1,13 @@
# hcsshim
This package supports launching Windows Server containers from Go. It is
primarily used in the [Docker Engine](https://github.com/docker/docker) project,
but it can be freely used by other projects as well.
[![Build status](https://ci.appveyor.com/api/projects/status/nbcw28mnkqml0loa/branch/master?svg=true)](https://ci.appveyor.com/project/WindowsVirtualization/hcsshim/branch/master)
This package contains the Golang interface for using the Windows [Host Compute Service](https://blogs.technet.microsoft.com/virtualization/2017/01/27/introducing-the-host-compute-service-hcs/) (HCS) to launch and manage [Windows Containers](https://docs.microsoft.com/en-us/virtualization/windowscontainers/about/). It also contains other helpers and functions for managing Windows Containers such as the Golang interface for the Host Network Service (HNS).
It is primarily used in the [Moby Project](https://github.com/moby/moby), but it can be freely used by other projects as well.
## Contributing
---------------
This project welcomes contributions and suggestions. Most contributions require you to agree to a
Contributor License Agreement (CLA) declaring that you have the right to, and actually do, grant us
the rights to use your contribution. For details, visit https://cla.microsoft.com.
@ -19,6 +20,11 @@ This project has adopted the [Microsoft Open Source Code of Conduct](https://ope
For more information see the [Code of Conduct FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or
contact [opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional questions or comments.
## Dependencies
This project requires Golang 1.9 or newer to build.
For system requirements to run this project, see the Microsoft docs on [Windows Container requirements](https://docs.microsoft.com/en-us/virtualization/windowscontainers/deploy-containers/system-requirements).
## Reporting Security Issues
@ -29,5 +35,7 @@ email to ensure we received your original message. Further information, includin
[MSRC PGP](https://technet.microsoft.com/en-us/security/dn606155) key, can be found in
the [Security TechCenter](https://technet.microsoft.com/en-us/security/default).
-------------------------------------------
For additional details, see [Report a Computer Security Vulnerability](https://technet.microsoft.com/en-us/security/ff852094.aspx) on Technet
---------------
Copyright (c) 2018 Microsoft Corp. All rights reserved.

View File

@ -1,28 +0,0 @@
package hcsshim
import "github.com/sirupsen/logrus"
// ActivateLayer will find the layer with the given id and mount it's filesystem.
// For a read/write layer, the mounted filesystem will appear as a volume on the
// host, while a read-only layer is generally expected to be a no-op.
// An activated layer must later be deactivated via DeactivateLayer.
func ActivateLayer(info DriverInfo, id string) error {
title := "hcsshim::ActivateLayer "
logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id)
infop, err := convertDriverInfo(info)
if err != nil {
logrus.Error(err)
return err
}
err = activateLayer(&infop, id)
if err != nil {
err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour)
logrus.Error(err)
return err
}
logrus.Debugf(title+" - succeeded id=%s flavour=%d", id, info.Flavour)
return nil
}

View File

@ -1,800 +1,192 @@
package hcsshim
import (
"encoding/json"
"fmt"
"os"
"sync"
"syscall"
"time"
"github.com/sirupsen/logrus"
"github.com/Microsoft/hcsshim/internal/hcs"
"github.com/Microsoft/hcsshim/internal/mergemaps"
"github.com/Microsoft/hcsshim/internal/schema1"
)
var (
defaultTimeout = time.Minute * 4
)
const (
pendingUpdatesQuery = `{ "PropertyTypes" : ["PendingUpdates"]}`
statisticsQuery = `{ "PropertyTypes" : ["Statistics"]}`
processListQuery = `{ "PropertyTypes" : ["ProcessList"]}`
mappedVirtualDiskQuery = `{ "PropertyTypes" : ["MappedVirtualDisk"]}`
)
type container struct {
handleLock sync.RWMutex
handle hcsSystem
id string
callbackNumber uintptr
}
// ContainerProperties holds the properties for a container and the processes running in that container
type ContainerProperties struct {
ID string `json:"Id"`
Name string
SystemType string
Owner string
SiloGUID string `json:"SiloGuid,omitempty"`
RuntimeID string `json:"RuntimeId,omitempty"`
IsRuntimeTemplate bool `json:",omitempty"`
RuntimeImagePath string `json:",omitempty"`
Stopped bool `json:",omitempty"`
ExitType string `json:",omitempty"`
AreUpdatesPending bool `json:",omitempty"`
ObRoot string `json:",omitempty"`
Statistics Statistics `json:",omitempty"`
ProcessList []ProcessListItem `json:",omitempty"`
MappedVirtualDiskControllers map[int]MappedVirtualDiskController `json:",omitempty"`
}
type ContainerProperties = schema1.ContainerProperties
// MemoryStats holds the memory statistics for a container
type MemoryStats struct {
UsageCommitBytes uint64 `json:"MemoryUsageCommitBytes,omitempty"`
UsageCommitPeakBytes uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"`
UsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"`
}
type MemoryStats = schema1.MemoryStats
// ProcessorStats holds the processor statistics for a container
type ProcessorStats struct {
TotalRuntime100ns uint64 `json:",omitempty"`
RuntimeUser100ns uint64 `json:",omitempty"`
RuntimeKernel100ns uint64 `json:",omitempty"`
}
type ProcessorStats = schema1.ProcessorStats
// StorageStats holds the storage statistics for a container
type StorageStats struct {
ReadCountNormalized uint64 `json:",omitempty"`
ReadSizeBytes uint64 `json:",omitempty"`
WriteCountNormalized uint64 `json:",omitempty"`
WriteSizeBytes uint64 `json:",omitempty"`
}
type StorageStats = schema1.StorageStats
// NetworkStats holds the network statistics for a container
type NetworkStats struct {
BytesReceived uint64 `json:",omitempty"`
BytesSent uint64 `json:",omitempty"`
PacketsReceived uint64 `json:",omitempty"`
PacketsSent uint64 `json:",omitempty"`
DroppedPacketsIncoming uint64 `json:",omitempty"`
DroppedPacketsOutgoing uint64 `json:",omitempty"`
EndpointId string `json:",omitempty"`
InstanceId string `json:",omitempty"`
}
type NetworkStats = schema1.NetworkStats
// Statistics is the structure returned by a statistics call on a container
type Statistics struct {
Timestamp time.Time `json:",omitempty"`
ContainerStartTime time.Time `json:",omitempty"`
Uptime100ns uint64 `json:",omitempty"`
Memory MemoryStats `json:",omitempty"`
Processor ProcessorStats `json:",omitempty"`
Storage StorageStats `json:",omitempty"`
Network []NetworkStats `json:",omitempty"`
}
type Statistics = schema1.Statistics
// ProcessList is the structure of an item returned by a ProcessList call on a container
type ProcessListItem struct {
CreateTimestamp time.Time `json:",omitempty"`
ImageName string `json:",omitempty"`
KernelTime100ns uint64 `json:",omitempty"`
MemoryCommitBytes uint64 `json:",omitempty"`
MemoryWorkingSetPrivateBytes uint64 `json:",omitempty"`
MemoryWorkingSetSharedBytes uint64 `json:",omitempty"`
ProcessId uint32 `json:",omitempty"`
UserTime100ns uint64 `json:",omitempty"`
}
type ProcessListItem = schema1.ProcessListItem
// MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container
type MappedVirtualDiskController struct {
MappedVirtualDisks map[int]MappedVirtualDisk `json:",omitempty"`
}
type MappedVirtualDiskController = schema1.MappedVirtualDiskController
// Type of Request Support in ModifySystem
type RequestType string
type RequestType = schema1.RequestType
// Type of Resource Support in ModifySystem
type ResourceType string
type ResourceType = schema1.ResourceType
// RequestType const
const (
Add RequestType = "Add"
Remove RequestType = "Remove"
Network ResourceType = "Network"
Add = schema1.Add
Remove = schema1.Remove
Network = schema1.Network
)
// ResourceModificationRequestResponse is the structure used to send request to the container to modify the system
// Supported resource types are Network and Request Types are Add/Remove
type ResourceModificationRequestResponse struct {
Resource ResourceType `json:"ResourceType"`
Data interface{} `json:"Settings"`
Request RequestType `json:"RequestType,omitempty"`
type ResourceModificationRequestResponse = schema1.ResourceModificationRequestResponse
type container struct {
system *hcs.System
}
// createContainerAdditionalJSON is read from the environment at initialisation
// createComputeSystemAdditionalJSON is read from the environment at initialisation
// time. It allows an environment variable to define additional JSON which
// is merged in the CreateContainer call to HCS.
var createContainerAdditionalJSON string
// is merged in the CreateComputeSystem call to HCS.
var createContainerAdditionalJSON []byte
func init() {
createContainerAdditionalJSON = os.Getenv("HCSSHIM_CREATECONTAINER_ADDITIONALJSON")
createContainerAdditionalJSON = ([]byte)(os.Getenv("HCSSHIM_CREATECONTAINER_ADDITIONALJSON"))
}
// CreateContainer creates a new container with the given configuration but does not start it.
func CreateContainer(id string, c *ContainerConfig) (Container, error) {
return createContainerWithJSON(id, c, "")
}
// CreateContainerWithJSON creates a new container with the given configuration but does not start it.
// It is identical to CreateContainer except that optional additional JSON can be merged before passing to HCS.
func CreateContainerWithJSON(id string, c *ContainerConfig, additionalJSON string) (Container, error) {
return createContainerWithJSON(id, c, additionalJSON)
}
func createContainerWithJSON(id string, c *ContainerConfig, additionalJSON string) (Container, error) {
operation := "CreateContainer"
title := "HCSShim::" + operation
container := &container{
id: id,
fullConfig, err := mergemaps.MergeJSON(c, createContainerAdditionalJSON)
if err != nil {
return nil, fmt.Errorf("failed to merge additional JSON '%s': %s", createContainerAdditionalJSON, err)
}
configurationb, err := json.Marshal(c)
system, err := hcs.CreateComputeSystem(id, fullConfig)
if err != nil {
return nil, err
}
configuration := string(configurationb)
logrus.Debugf(title+" id=%s config=%s", id, configuration)
// Merge any additional JSON. Priority is given to what is passed in explicitly,
// falling back to what's set in the environment.
if additionalJSON == "" && createContainerAdditionalJSON != "" {
additionalJSON = createContainerAdditionalJSON
}
if additionalJSON != "" {
configurationMap := map[string]interface{}{}
if err := json.Unmarshal([]byte(configuration), &configurationMap); err != nil {
return nil, fmt.Errorf("failed to unmarshal %s: %s", configuration, err)
}
additionalMap := map[string]interface{}{}
if err := json.Unmarshal([]byte(additionalJSON), &additionalMap); err != nil {
return nil, fmt.Errorf("failed to unmarshal %s: %s", additionalJSON, err)
}
mergedMap := mergeMaps(additionalMap, configurationMap)
mergedJSON, err := json.Marshal(mergedMap)
if err != nil {
return nil, fmt.Errorf("failed to marshal merged configuration map %+v: %s", mergedMap, err)
}
configuration = string(mergedJSON)
logrus.Debugf(title+" id=%s merged config=%s", id, configuration)
}
var (
resultp *uint16
identity syscall.Handle
)
createError := hcsCreateComputeSystem(id, configuration, identity, &container.handle, &resultp)
if createError == nil || IsPending(createError) {
if err := container.registerCallback(); err != nil {
// Terminate the container if it still exists. We're okay to ignore a failure here.
container.Terminate()
return nil, makeContainerError(container, operation, "", err)
}
}
err = processAsyncHcsResult(createError, resultp, container.callbackNumber, hcsNotificationSystemCreateCompleted, &defaultTimeout)
if err != nil {
if err == ErrTimeout {
// Terminate the container if it still exists. We're okay to ignore a failure here.
container.Terminate()
}
return nil, makeContainerError(container, operation, configuration, err)
}
logrus.Debugf(title+" succeeded id=%s handle=%d", id, container.handle)
return container, nil
}
// mergeMaps recursively merges map `fromMap` into map `ToMap`. Any pre-existing values
// in ToMap are overwritten. Values in fromMap are added to ToMap.
// From http://stackoverflow.com/questions/40491438/merging-two-json-strings-in-golang
func mergeMaps(fromMap, ToMap interface{}) interface{} {
switch fromMap := fromMap.(type) {
case map[string]interface{}:
ToMap, ok := ToMap.(map[string]interface{})
if !ok {
return fromMap
}
for keyToMap, valueToMap := range ToMap {
if valueFromMap, ok := fromMap[keyToMap]; ok {
fromMap[keyToMap] = mergeMaps(valueFromMap, valueToMap)
} else {
fromMap[keyToMap] = valueToMap
}
}
case nil:
// merge(nil, map[string]interface{...}) -> map[string]interface{...}
ToMap, ok := ToMap.(map[string]interface{})
if ok {
return ToMap
}
}
return fromMap
return &container{system}, err
}
// OpenContainer opens an existing container by ID.
func OpenContainer(id string) (Container, error) {
operation := "OpenContainer"
title := "HCSShim::" + operation
logrus.Debugf(title+" id=%s", id)
container := &container{
id: id,
}
var (
handle hcsSystem
resultp *uint16
)
err := hcsOpenComputeSystem(id, &handle, &resultp)
err = processHcsResult(err, resultp)
system, err := hcs.OpenComputeSystem(id)
if err != nil {
return nil, makeContainerError(container, operation, "", err)
return nil, err
}
container.handle = handle
if err := container.registerCallback(); err != nil {
return nil, makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s handle=%d", id, handle)
return container, nil
return &container{system}, err
}
// GetContainers gets a list of the containers on the system that match the query
func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) {
operation := "GetContainers"
title := "HCSShim::" + operation
queryb, err := json.Marshal(q)
if err != nil {
return nil, err
}
query := string(queryb)
logrus.Debugf(title+" query=%s", query)
var (
resultp *uint16
computeSystemsp *uint16
)
err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp)
err = processHcsResult(err, resultp)
if err != nil {
return nil, err
}
if computeSystemsp == nil {
return nil, ErrUnexpectedValue
}
computeSystemsRaw := convertAndFreeCoTaskMemBytes(computeSystemsp)
computeSystems := []ContainerProperties{}
if err := json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil {
return nil, err
}
logrus.Debugf(title + " succeeded")
return computeSystems, nil
return hcs.GetComputeSystems(q)
}
// Start synchronously starts the container.
func (container *container) Start() error {
container.handleLock.RLock()
defer container.handleLock.RUnlock()
operation := "Start"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
if container.handle == 0 {
return makeContainerError(container, operation, "", ErrAlreadyClosed)
}
var resultp *uint16
err := hcsStartComputeSystem(container.handle, "", &resultp)
err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemStartCompleted, &defaultTimeout)
if err != nil {
return makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return nil
return convertSystemError(container.system.Start(), container)
}
// Shutdown requests a container shutdown, if IsPending() on the error returned is true,
// it may not actually be shut down until Wait() succeeds.
// Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds.
func (container *container) Shutdown() error {
container.handleLock.RLock()
defer container.handleLock.RUnlock()
operation := "Shutdown"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
if container.handle == 0 {
return makeContainerError(container, operation, "", ErrAlreadyClosed)
}
var resultp *uint16
err := hcsShutdownComputeSystem(container.handle, "", &resultp)
err = processHcsResult(err, resultp)
if err != nil {
return makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return nil
return convertSystemError(container.system.Shutdown(), container)
}
// Terminate requests a container terminate, if IsPending() on the error returned is true,
// it may not actually be shut down until Wait() succeeds.
// Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds.
func (container *container) Terminate() error {
container.handleLock.RLock()
defer container.handleLock.RUnlock()
operation := "Terminate"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
if container.handle == 0 {
return makeContainerError(container, operation, "", ErrAlreadyClosed)
}
var resultp *uint16
err := hcsTerminateComputeSystem(container.handle, "", &resultp)
err = processHcsResult(err, resultp)
if err != nil {
return makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return nil
return convertSystemError(container.system.Terminate(), container)
}
// Wait synchronously waits for the container to shutdown or terminate.
// Waits synchronously waits for the container to shutdown or terminate.
func (container *container) Wait() error {
operation := "Wait"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
err := waitForNotification(container.callbackNumber, hcsNotificationSystemExited, nil)
if err != nil {
return makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return nil
return convertSystemError(container.system.Wait(), container)
}
// WaitTimeout synchronously waits for the container to terminate or the duration to elapse.
// If the timeout expires, IsTimeout(err) == true
func (container *container) WaitTimeout(timeout time.Duration) error {
operation := "WaitTimeout"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
err := waitForNotification(container.callbackNumber, hcsNotificationSystemExited, &timeout)
if err != nil {
return makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return nil
// WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It
// returns false if timeout occurs.
func (container *container) WaitTimeout(t time.Duration) error {
return convertSystemError(container.system.WaitTimeout(t), container)
}
func (container *container) properties(query string) (*ContainerProperties, error) {
var (
resultp *uint16
propertiesp *uint16
)
err := hcsGetComputeSystemProperties(container.handle, query, &propertiesp, &resultp)
err = processHcsResult(err, resultp)
if err != nil {
return nil, err
}
// Pause pauses the execution of a container.
func (container *container) Pause() error {
return convertSystemError(container.system.Pause(), container)
}
if propertiesp == nil {
return nil, ErrUnexpectedValue
}
propertiesRaw := convertAndFreeCoTaskMemBytes(propertiesp)
properties := &ContainerProperties{}
if err := json.Unmarshal(propertiesRaw, properties); err != nil {
return nil, err
}
return properties, nil
// Resume resumes the execution of a container.
func (container *container) Resume() error {
return convertSystemError(container.system.Resume(), container)
}
// HasPendingUpdates returns true if the container has updates pending to install
func (container *container) HasPendingUpdates() (bool, error) {
container.handleLock.RLock()
defer container.handleLock.RUnlock()
operation := "HasPendingUpdates"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
if container.handle == 0 {
return false, makeContainerError(container, operation, "", ErrAlreadyClosed)
}
properties, err := container.properties(pendingUpdatesQuery)
if err != nil {
return false, makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return properties.AreUpdatesPending, nil
return false, nil
}
// Statistics returns statistics for the container
// Statistics returns statistics for the container. This is a legacy v1 call
func (container *container) Statistics() (Statistics, error) {
container.handleLock.RLock()
defer container.handleLock.RUnlock()
operation := "Statistics"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
if container.handle == 0 {
return Statistics{}, makeContainerError(container, operation, "", ErrAlreadyClosed)
}
properties, err := container.properties(statisticsQuery)
properties, err := container.system.Properties(schema1.PropertyTypeStatistics)
if err != nil {
return Statistics{}, makeContainerError(container, operation, "", err)
return Statistics{}, convertSystemError(err, container)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return properties.Statistics, nil
}
// ProcessList returns an array of ProcessListItems for the container
// ProcessList returns an array of ProcessListItems for the container. This is a legacy v1 call
func (container *container) ProcessList() ([]ProcessListItem, error) {
container.handleLock.RLock()
defer container.handleLock.RUnlock()
operation := "ProcessList"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
if container.handle == 0 {
return nil, makeContainerError(container, operation, "", ErrAlreadyClosed)
}
properties, err := container.properties(processListQuery)
properties, err := container.system.Properties(schema1.PropertyTypeProcessList)
if err != nil {
return nil, makeContainerError(container, operation, "", err)
return nil, convertSystemError(err, container)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return properties.ProcessList, nil
}
// MappedVirtualDisks returns a map of the controllers and the disks mapped
// to a container.
//
// Example of JSON returned by the query.
//{
// "Id":"1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3_svm",
// "SystemType":"Container",
// "RuntimeOsType":"Linux",
// "RuntimeId":"00000000-0000-0000-0000-000000000000",
// "State":"Running",
// "MappedVirtualDiskControllers":{
// "0":{
// "MappedVirtualDisks":{
// "2":{
// "HostPath":"C:\\lcow\\lcow\\scratch\\1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3.vhdx",
// "ContainerPath":"/mnt/gcs/LinuxServiceVM/scratch",
// "Lun":2,
// "CreateInUtilityVM":true
// },
// "3":{
// "HostPath":"C:\\lcow\\lcow\\1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3\\sandbox.vhdx",
// "Lun":3,
// "CreateInUtilityVM":true,
// "AttachOnly":true
// }
// }
// }
// }
//}
// This is a legacy v1 call
func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) {
container.handleLock.RLock()
defer container.handleLock.RUnlock()
operation := "MappedVirtualDiskList"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
if container.handle == 0 {
return nil, makeContainerError(container, operation, "", ErrAlreadyClosed)
}
properties, err := container.properties(mappedVirtualDiskQuery)
properties, err := container.system.Properties(schema1.PropertyTypeMappedVirtualDisk)
if err != nil {
return nil, makeContainerError(container, operation, "", err)
return nil, convertSystemError(err, container)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return properties.MappedVirtualDiskControllers, nil
}
// Pause pauses the execution of the container. This feature is not enabled in TP5.
func (container *container) Pause() error {
container.handleLock.RLock()
defer container.handleLock.RUnlock()
operation := "Pause"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
if container.handle == 0 {
return makeContainerError(container, operation, "", ErrAlreadyClosed)
}
var resultp *uint16
err := hcsPauseComputeSystem(container.handle, "", &resultp)
err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemPauseCompleted, &defaultTimeout)
if err != nil {
return makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return nil
}
// Resume resumes the execution of the container. This feature is not enabled in TP5.
func (container *container) Resume() error {
container.handleLock.RLock()
defer container.handleLock.RUnlock()
operation := "Resume"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
if container.handle == 0 {
return makeContainerError(container, operation, "", ErrAlreadyClosed)
}
var resultp *uint16
err := hcsResumeComputeSystem(container.handle, "", &resultp)
err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemResumeCompleted, &defaultTimeout)
if err != nil {
return makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return nil
}
// CreateProcess launches a new process within the container.
func (container *container) CreateProcess(c *ProcessConfig) (Process, error) {
container.handleLock.RLock()
defer container.handleLock.RUnlock()
operation := "CreateProcess"
title := "HCSShim::Container::" + operation
var (
processInfo hcsProcessInformation
processHandle hcsProcess
resultp *uint16
)
if container.handle == 0 {
return nil, makeContainerError(container, operation, "", ErrAlreadyClosed)
}
// If we are not emulating a console, ignore any console size passed to us
if !c.EmulateConsole {
c.ConsoleSize[0] = 0
c.ConsoleSize[1] = 0
}
configurationb, err := json.Marshal(c)
p, err := container.system.CreateProcess(c)
if err != nil {
return nil, makeContainerError(container, operation, "", err)
return nil, convertSystemError(err, container)
}
configuration := string(configurationb)
logrus.Debugf(title+" id=%s config=%s", container.id, configuration)
err = hcsCreateProcess(container.handle, configuration, &processInfo, &processHandle, &resultp)
err = processHcsResult(err, resultp)
if err != nil {
return nil, makeContainerError(container, operation, configuration, err)
}
process := &process{
handle: processHandle,
processID: int(processInfo.ProcessId),
container: container,
cachedPipes: &cachedPipes{
stdIn: processInfo.StdInput,
stdOut: processInfo.StdOutput,
stdErr: processInfo.StdError,
},
}
if err := process.registerCallback(); err != nil {
return nil, makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s processid=%d", container.id, process.processID)
return process, nil
return &process{p}, nil
}
// OpenProcess gets an interface to an existing process within the container.
func (container *container) OpenProcess(pid int) (Process, error) {
container.handleLock.RLock()
defer container.handleLock.RUnlock()
operation := "OpenProcess"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s, processid=%d", container.id, pid)
var (
processHandle hcsProcess
resultp *uint16
)
if container.handle == 0 {
return nil, makeContainerError(container, operation, "", ErrAlreadyClosed)
}
err := hcsOpenProcess(container.handle, uint32(pid), &processHandle, &resultp)
err = processHcsResult(err, resultp)
p, err := container.system.OpenProcess(pid)
if err != nil {
return nil, makeContainerError(container, operation, "", err)
return nil, convertSystemError(err, container)
}
process := &process{
handle: processHandle,
processID: pid,
container: container,
}
if err := process.registerCallback(); err != nil {
return nil, makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s processid=%s", container.id, process.processID)
return process, nil
return &process{p}, nil
}
// Close cleans up any state associated with the container but does not terminate or wait for it.
func (container *container) Close() error {
container.handleLock.Lock()
defer container.handleLock.Unlock()
operation := "Close"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
// Don't double free this
if container.handle == 0 {
return nil
}
if err := container.unregisterCallback(); err != nil {
return makeContainerError(container, operation, "", err)
}
if err := hcsCloseComputeSystem(container.handle); err != nil {
return makeContainerError(container, operation, "", err)
}
container.handle = 0
logrus.Debugf(title+" succeeded id=%s", container.id)
return nil
return convertSystemError(container.system.Close(), container)
}
func (container *container) registerCallback() error {
context := &notifcationWatcherContext{
channels: newChannels(),
}
callbackMapLock.Lock()
callbackNumber := nextCallback
nextCallback++
callbackMap[callbackNumber] = context
callbackMapLock.Unlock()
var callbackHandle hcsCallback
err := hcsRegisterComputeSystemCallback(container.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
if err != nil {
return err
}
context.handle = callbackHandle
container.callbackNumber = callbackNumber
return nil
}
func (container *container) unregisterCallback() error {
callbackNumber := container.callbackNumber
callbackMapLock.RLock()
context := callbackMap[callbackNumber]
callbackMapLock.RUnlock()
if context == nil {
return nil
}
handle := context.handle
if handle == 0 {
return nil
}
// hcsUnregisterComputeSystemCallback has its own syncronization
// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
err := hcsUnregisterComputeSystemCallback(handle)
if err != nil {
return err
}
closeChannels(context.channels)
callbackMapLock.Lock()
callbackMap[callbackNumber] = nil
callbackMapLock.Unlock()
handle = 0
return nil
}
// Modifies the System by sending a request to HCS
// Modify the System
func (container *container) Modify(config *ResourceModificationRequestResponse) error {
container.handleLock.RLock()
defer container.handleLock.RUnlock()
operation := "Modify"
title := "HCSShim::Container::" + operation
if container.handle == 0 {
return makeContainerError(container, operation, "", ErrAlreadyClosed)
}
requestJSON, err := json.Marshal(config)
if err != nil {
return err
}
requestString := string(requestJSON)
logrus.Debugf(title+" id=%s request=%s", container.id, requestString)
var resultp *uint16
err = hcsModifyComputeSystem(container.handle, requestString, &resultp)
err = processHcsResult(err, resultp)
if err != nil {
return makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return nil
return convertSystemError(container.system.Modify(config), container)
}

View File

@ -1,27 +0,0 @@
package hcsshim
import "github.com/sirupsen/logrus"
// CreateLayer creates a new, empty, read-only layer on the filesystem based on
// the parent layer provided.
func CreateLayer(info DriverInfo, id, parent string) error {
title := "hcsshim::CreateLayer "
logrus.Debugf(title+"Flavour %d ID %s parent %s", info.Flavour, id, parent)
// Convert info to API calling convention
infop, err := convertDriverInfo(info)
if err != nil {
logrus.Error(err)
return err
}
err = createLayer(&infop, id, parent)
if err != nil {
err = makeErrorf(err, title, "id=%s parent=%s flavour=%d", id, parent, info.Flavour)
logrus.Error(err)
return err
}
logrus.Debugf(title+" - succeeded id=%s parent=%s flavour=%d", id, parent, info.Flavour)
return nil
}

View File

@ -1,35 +0,0 @@
package hcsshim
import "github.com/sirupsen/logrus"
// CreateSandboxLayer creates and populates new read-write layer for use by a container.
// This requires both the id of the direct parent layer, as well as the full list
// of paths to all parent layers up to the base (and including the direct parent
// whose id was provided).
func CreateSandboxLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error {
title := "hcsshim::CreateSandboxLayer "
logrus.Debugf(title+"layerId %s parentId %s", layerId, parentId)
// Generate layer descriptors
layers, err := layerPathsToDescriptors(parentLayerPaths)
if err != nil {
return err
}
// Convert info to API calling convention
infop, err := convertDriverInfo(info)
if err != nil {
logrus.Error(err)
return err
}
err = createSandboxLayer(&infop, layerId, parentId, layers)
if err != nil {
err = makeErrorf(err, title, "layerId=%s parentId=%s", layerId, parentId)
logrus.Error(err)
return err
}
logrus.Debugf(title+"- succeeded layerId=%s parentId=%s", layerId, parentId)
return nil
}

View File

@ -1,26 +0,0 @@
package hcsshim
import "github.com/sirupsen/logrus"
// DeactivateLayer will dismount a layer that was mounted via ActivateLayer.
func DeactivateLayer(info DriverInfo, id string) error {
title := "hcsshim::DeactivateLayer "
logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id)
// Convert info to API calling convention
infop, err := convertDriverInfo(info)
if err != nil {
logrus.Error(err)
return err
}
err = deactivateLayer(&infop, id)
if err != nil {
err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour)
logrus.Error(err)
return err
}
logrus.Debugf(title+"succeeded flavour=%d id=%s", info.Flavour, id)
return nil
}

View File

@ -1,27 +0,0 @@
package hcsshim
import "github.com/sirupsen/logrus"
// DestroyLayer will remove the on-disk files representing the layer with the given
// id, including that layer's containing folder, if any.
func DestroyLayer(info DriverInfo, id string) error {
title := "hcsshim::DestroyLayer "
logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id)
// Convert info to API calling convention
infop, err := convertDriverInfo(info)
if err != nil {
logrus.Error(err)
return err
}
err = destroyLayer(&infop, id)
if err != nil {
err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour)
logrus.Error(err)
return err
}
logrus.Debugf(title+"succeeded flavour=%d id=%s", info.Flavour, id)
return nil
}

View File

@ -1,92 +1,83 @@
package hcsshim
import (
"errors"
"fmt"
"syscall"
"github.com/Microsoft/hcsshim/internal/hns"
"github.com/Microsoft/hcsshim/internal/hcs"
"github.com/Microsoft/hcsshim/internal/hcserror"
)
var (
// ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists
ErrComputeSystemDoesNotExist = syscall.Errno(0xc037010e)
// ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists = hcs.exist
ErrComputeSystemDoesNotExist = hcs.ErrComputeSystemDoesNotExist
// ErrElementNotFound is an error encountered when the object being referenced does not exist
ErrElementNotFound = syscall.Errno(0x490)
ErrElementNotFound = hcs.ErrElementNotFound
// ErrElementNotFound is an error encountered when the object being referenced does not exist
ErrNotSupported = syscall.Errno(0x32)
ErrNotSupported = hcs.ErrNotSupported
// ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported
// decimal -2147024883 / hex 0x8007000d
ErrInvalidData = syscall.Errno(0xd)
ErrInvalidData = hcs.ErrInvalidData
// ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed
ErrHandleClose = errors.New("hcsshim: the handle generating this notification has been closed")
ErrHandleClose = hcs.ErrHandleClose
// ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method
ErrAlreadyClosed = errors.New("hcsshim: the handle has already been closed")
ErrAlreadyClosed = hcs.ErrAlreadyClosed
// ErrInvalidNotificationType is an error encountered when an invalid notification type is used
ErrInvalidNotificationType = errors.New("hcsshim: invalid notification type")
ErrInvalidNotificationType = hcs.ErrInvalidNotificationType
// ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation
ErrInvalidProcessState = errors.New("the process is in an invalid state for the attempted operation")
ErrInvalidProcessState = hcs.ErrInvalidProcessState
// ErrTimeout is an error encountered when waiting on a notification times out
ErrTimeout = errors.New("hcsshim: timeout waiting for notification")
ErrTimeout = hcs.ErrTimeout
// ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for
// a different expected notification
ErrUnexpectedContainerExit = errors.New("unexpected container exit")
ErrUnexpectedContainerExit = hcs.ErrUnexpectedContainerExit
// ErrUnexpectedProcessAbort is the error encountered when communication with the compute service
// is lost while waiting for a notification
ErrUnexpectedProcessAbort = errors.New("lost communication with compute service")
ErrUnexpectedProcessAbort = hcs.ErrUnexpectedProcessAbort
// ErrUnexpectedValue is an error encountered when hcs returns an invalid value
ErrUnexpectedValue = errors.New("unexpected value returned from hcs")
ErrUnexpectedValue = hcs.ErrUnexpectedValue
// ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container
ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110)
ErrVmcomputeAlreadyStopped = hcs.ErrVmcomputeAlreadyStopped
// ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously
ErrVmcomputeOperationPending = syscall.Errno(0xC0370103)
ErrVmcomputeOperationPending = hcs.ErrVmcomputeOperationPending
// ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation
ErrVmcomputeOperationInvalidState = syscall.Errno(0xc0370105)
ErrVmcomputeOperationInvalidState = hcs.ErrVmcomputeOperationInvalidState
// ErrProcNotFound is an error encountered when the the process cannot be found
ErrProcNotFound = syscall.Errno(0x7f)
ErrProcNotFound = hcs.ErrProcNotFound
// ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2
// builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3.
ErrVmcomputeOperationAccessIsDenied = syscall.Errno(0x5)
ErrVmcomputeOperationAccessIsDenied = hcs.ErrVmcomputeOperationAccessIsDenied
// ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management
ErrVmcomputeInvalidJSON = syscall.Errno(0xc037010d)
ErrVmcomputeInvalidJSON = hcs.ErrVmcomputeInvalidJSON
// ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message
ErrVmcomputeUnknownMessage = syscall.Errno(0xc037010b)
ErrVmcomputeUnknownMessage = hcs.ErrVmcomputeUnknownMessage
// ErrNotSupported is an error encountered when hcs doesn't support the request
ErrPlatformNotSupported = errors.New("unsupported platform request")
ErrPlatformNotSupported = hcs.ErrPlatformNotSupported
)
type EndpointNotFoundError struct {
EndpointName string
}
func (e EndpointNotFoundError) Error() string {
return fmt.Sprintf("Endpoint %s not found", e.EndpointName)
}
type NetworkNotFoundError struct {
NetworkName string
}
func (e NetworkNotFoundError) Error() string {
return fmt.Sprintf("Network %s not found", e.NetworkName)
}
type EndpointNotFoundError = hns.EndpointNotFoundError
type NetworkNotFoundError = hns.NetworkNotFoundError
// ProcessError is an error encountered in HCS during an operation on a Process object
type ProcessError struct {
@ -94,6 +85,7 @@ type ProcessError struct {
Operation string
ExtraInfo string
Err error
Events []hcs.ErrorEvent
}
// ContainerError is an error encountered in HCS during an operation on a Container object
@ -102,6 +94,7 @@ type ContainerError struct {
Operation string
ExtraInfo string
Err error
Events []hcs.ErrorEvent
}
func (e *ContainerError) Error() string {
@ -113,7 +106,7 @@ func (e *ContainerError) Error() string {
return "unexpected nil container for error: " + e.Err.Error()
}
s := "container " + e.Container.id
s := "container " + e.Container.system.ID()
if e.Operation != "" {
s += " encountered an error during " + e.Operation
@ -123,11 +116,15 @@ func (e *ContainerError) Error() string {
case nil:
break
case syscall.Errno:
s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, win32FromError(e.Err))
s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err))
default:
s += fmt.Sprintf(": %s", e.Err.Error())
}
for _, ev := range e.Events {
s += "\n" + ev.String()
}
if e.ExtraInfo != "" {
s += " extra info: " + e.ExtraInfo
}
@ -153,12 +150,7 @@ func (e *ProcessError) Error() string {
return "Unexpected nil process for error: " + e.Err.Error()
}
s := fmt.Sprintf("process %d", e.Process.processID)
if e.Process.container != nil {
s += " in container " + e.Process.container.id
}
s := fmt.Sprintf("process %d in container %s", e.Process.p.Pid(), e.Process.p.SystemID())
if e.Operation != "" {
s += " encountered an error during " + e.Operation
}
@ -167,11 +159,15 @@ func (e *ProcessError) Error() string {
case nil:
break
case syscall.Errno:
s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, win32FromError(e.Err))
s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err))
default:
s += fmt.Sprintf(": %s", e.Err.Error())
}
for _, ev := range e.Events {
s += "\n" + ev.String()
}
return s
}
@ -189,37 +185,31 @@ func makeProcessError(process *process, operation string, extraInfo string, err
// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
func IsNotExist(err error) bool {
err = getInnerError(err)
if _, ok := err.(EndpointNotFoundError); ok {
return true
}
if _, ok := err.(NetworkNotFoundError); ok {
return true
}
return err == ErrComputeSystemDoesNotExist ||
err == ErrElementNotFound ||
err == ErrProcNotFound
return hcs.IsNotExist(getInnerError(err))
}
// IsAlreadyClosed checks if an error is caused by the Container or Process having been
// already closed by a call to the Close() method.
func IsAlreadyClosed(err error) bool {
err = getInnerError(err)
return err == ErrAlreadyClosed
return hcs.IsAlreadyClosed(getInnerError(err))
}
// IsPending returns a boolean indicating whether the error is that
// the requested operation is being completed in the background.
func IsPending(err error) bool {
err = getInnerError(err)
return err == ErrVmcomputeOperationPending
return hcs.IsPending(getInnerError(err))
}
// IsTimeout returns a boolean indicating whether the error is caused by
// a timeout waiting for the operation to complete.
func IsTimeout(err error) bool {
err = getInnerError(err)
return err == ErrTimeout
return hcs.IsTimeout(getInnerError(err))
}
// IsAlreadyStopped returns a boolean indicating whether the error is caused by
@ -228,10 +218,7 @@ func IsTimeout(err error) bool {
// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
func IsAlreadyStopped(err error) bool {
err = getInnerError(err)
return err == ErrVmcomputeAlreadyStopped ||
err == ErrElementNotFound ||
err == ErrProcNotFound
return hcs.IsAlreadyStopped(getInnerError(err))
}
// IsNotSupported returns a boolean indicating whether the error is caused by
@ -240,12 +227,7 @@ func IsAlreadyStopped(err error) bool {
// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage
// is thrown from the Platform
func IsNotSupported(err error) bool {
err = getInnerError(err)
// If Platform doesn't recognize or support the request sent, below errors are seen
return err == ErrVmcomputeInvalidJSON ||
err == ErrInvalidData ||
err == ErrNotSupported ||
err == ErrVmcomputeUnknownMessage
return hcs.IsNotSupported(getInnerError(err))
}
func getInnerError(err error) error {
@ -259,3 +241,17 @@ func getInnerError(err error) error {
}
return err
}
func convertSystemError(err error, c *container) error {
if serr, ok := err.(*hcs.SystemError); ok {
return &ContainerError{Container: c, Operation: serr.Op, ExtraInfo: serr.Extra, Err: serr.Err, Events: serr.Events}
}
return err
}
func convertProcessError(err error, p *process) error {
if perr, ok := err.(*hcs.ProcessError); ok {
return &ProcessError{Process: p, Operation: perr.Op, Err: perr.Err, Events: perr.Events}
}
return err
}

View File

@ -1,26 +0,0 @@
package hcsshim
import "github.com/sirupsen/logrus"
// ExpandSandboxSize expands the size of a layer to at least size bytes.
func ExpandSandboxSize(info DriverInfo, layerId string, size uint64) error {
title := "hcsshim::ExpandSandboxSize "
logrus.Debugf(title+"layerId=%s size=%d", layerId, size)
// Convert info to API calling convention
infop, err := convertDriverInfo(info)
if err != nil {
logrus.Error(err)
return err
}
err = expandSandboxSize(&infop, layerId, size)
if err != nil {
err = makeErrorf(err, title, "layerId=%s size=%d", layerId, size)
logrus.Error(err)
return err
}
logrus.Debugf(title+"- succeeded layerId=%s size=%d", layerId, size)
return nil
}

View File

@ -1,19 +0,0 @@
package hcsshim
import (
"crypto/sha1"
"fmt"
)
type GUID [16]byte
func NewGUID(source string) *GUID {
h := sha1.Sum([]byte(source))
var g GUID
copy(g[0:], h[0:16])
return &g
}
func (g *GUID) ToString() string {
return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:])
}

View File

@ -4,80 +4,20 @@
package hcsshim
import (
"fmt"
"syscall"
"unsafe"
"github.com/sirupsen/logrus"
"github.com/Microsoft/hcsshim/internal/hcserror"
)
//go:generate go run mksyscall_windows.go -output zhcsshim.go hcsshim.go safeopen.go
//go:generate go run mksyscall_windows.go -output zsyscall_windows.go hcsshim.go
//sys coTaskMemFree(buffer unsafe.Pointer) = ole32.CoTaskMemFree
//sys SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) = iphlpapi.SetCurrentThreadCompartmentId
//sys activateLayer(info *driverInfo, id string) (hr error) = vmcompute.ActivateLayer?
//sys copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CopyLayer?
//sys createLayer(info *driverInfo, id string, parent string) (hr error) = vmcompute.CreateLayer?
//sys createSandboxLayer(info *driverInfo, id string, parent string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CreateSandboxLayer?
//sys expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) = vmcompute.ExpandSandboxSize?
//sys deactivateLayer(info *driverInfo, id string) (hr error) = vmcompute.DeactivateLayer?
//sys destroyLayer(info *driverInfo, id string) (hr error) = vmcompute.DestroyLayer?
//sys exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ExportLayer?
//sys getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) = vmcompute.GetLayerMountPath?
//sys getBaseImages(buffer **uint16) (hr error) = vmcompute.GetBaseImages?
//sys importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ImportLayer?
//sys layerExists(info *driverInfo, id string, exists *uint32) (hr error) = vmcompute.LayerExists?
//sys nameToGuid(name string, guid *GUID) (hr error) = vmcompute.NameToGuid?
//sys prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.PrepareLayer?
//sys unprepareLayer(info *driverInfo, id string) (hr error) = vmcompute.UnprepareLayer?
//sys processBaseImage(path string) (hr error) = vmcompute.ProcessBaseImage?
//sys processUtilityImage(path string) (hr error) = vmcompute.ProcessUtilityImage?
//sys importLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ImportLayerBegin?
//sys importLayerNext(context uintptr, fileName string, fileInfo *winio.FileBasicInfo) (hr error) = vmcompute.ImportLayerNext?
//sys importLayerWrite(context uintptr, buffer []byte) (hr error) = vmcompute.ImportLayerWrite?
//sys importLayerEnd(context uintptr) (hr error) = vmcompute.ImportLayerEnd?
//sys exportLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ExportLayerBegin?
//sys exportLayerNext(context uintptr, fileName **uint16, fileInfo *winio.FileBasicInfo, fileSize *int64, deleted *uint32) (hr error) = vmcompute.ExportLayerNext?
//sys exportLayerRead(context uintptr, buffer []byte, bytesRead *uint32) (hr error) = vmcompute.ExportLayerRead?
//sys exportLayerEnd(context uintptr) (hr error) = vmcompute.ExportLayerEnd?
//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems?
//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem?
//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem?
//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem?
//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem?
//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem?
//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem?
//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem?
//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem?
//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties?
//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem?
//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback?
//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback?
//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess?
//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess?
//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess?
//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo?
//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties?
//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess?
//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties?
//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback?
//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback?
//sys hcsModifyServiceSettings(settings string, result **uint16) (hr error) = vmcompute.HcsModifyServiceSettings?
//sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall?
const (
// Specific user-visible exit codes
WaitErrExecFailed = 32767
ERROR_GEN_FAILURE = syscall.Errno(31)
ERROR_GEN_FAILURE = hcserror.ERROR_GEN_FAILURE
ERROR_SHUTDOWN_IN_PROGRESS = syscall.Errno(1115)
WSAEINVAL = syscall.Errno(10022)
@ -85,82 +25,4 @@ const (
TimeoutInfinite = 0xFFFFFFFF
)
type HcsError struct {
title string
rest string
Err error
}
type hcsSystem syscall.Handle
type hcsProcess syscall.Handle
type hcsCallback syscall.Handle
type hcsProcessInformation struct {
ProcessId uint32
Reserved uint32
StdInput syscall.Handle
StdOutput syscall.Handle
StdError syscall.Handle
}
func makeError(err error, title, rest string) error {
// Pass through DLL errors directly since they do not originate from HCS.
if _, ok := err.(*syscall.DLLError); ok {
return err
}
return &HcsError{title, rest, err}
}
func makeErrorf(err error, title, format string, a ...interface{}) error {
return makeError(err, title, fmt.Sprintf(format, a...))
}
func win32FromError(err error) uint32 {
if herr, ok := err.(*HcsError); ok {
return win32FromError(herr.Err)
}
if code, ok := err.(syscall.Errno); ok {
return uint32(code)
}
return uint32(ERROR_GEN_FAILURE)
}
func win32FromHresult(hr uintptr) uintptr {
if hr&0x1fff0000 == 0x00070000 {
return hr & 0xffff
}
return hr
}
func (e *HcsError) Error() string {
s := e.title
if len(s) > 0 && s[len(s)-1] != ' ' {
s += " "
}
s += fmt.Sprintf("failed in Win32: %s (0x%x)", e.Err, win32FromError(e.Err))
if e.rest != "" {
if e.rest[0] != ' ' {
s += " "
}
s += e.rest
}
return s
}
func convertAndFreeCoTaskMemString(buffer *uint16) string {
str := syscall.UTF16ToString((*[1 << 30]uint16)(unsafe.Pointer(buffer))[:])
coTaskMemFree(unsafe.Pointer(buffer))
return str
}
func convertAndFreeCoTaskMemBytes(buffer *uint16) []byte {
return []byte(convertAndFreeCoTaskMemString(buffer))
}
func processHcsResult(err error, resultp *uint16) error {
if resultp != nil {
result := convertAndFreeCoTaskMemString(resultp)
logrus.Debugf("Result: %s", result)
}
return err
}
type HcsError = hcserror.HcsError

View File

@ -1,29 +1,11 @@
package hcsshim
import (
"encoding/json"
"net"
"github.com/sirupsen/logrus"
"github.com/Microsoft/hcsshim/internal/hns"
)
// HNSEndpoint represents a network endpoint in HNS
type HNSEndpoint struct {
Id string `json:"ID,omitempty"`
Name string `json:",omitempty"`
VirtualNetwork string `json:",omitempty"`
VirtualNetworkName string `json:",omitempty"`
Policies []json.RawMessage `json:",omitempty"`
MacAddress string `json:",omitempty"`
IPAddress net.IP `json:",omitempty"`
DNSSuffix string `json:",omitempty"`
DNSServerList string `json:",omitempty"`
GatewayAddress string `json:",omitempty"`
EnableInternalDNS bool `json:",omitempty"`
DisableICC bool `json:",omitempty"`
PrefixLength uint8 `json:",omitempty"`
IsRemoteEndpoint bool `json:",omitempty"`
}
type HNSEndpoint = hns.HNSEndpoint
//SystemType represents the type of the system on which actions are done
type SystemType string
@ -37,39 +19,19 @@ const (
// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system
// Supported resource types are Network and Request Types are Add/Remove
type EndpointAttachDetachRequest struct {
ContainerID string `json:"ContainerId,omitempty"`
SystemType SystemType `json:"SystemType"`
CompartmentID uint16 `json:"CompartmentId,omitempty"`
VirtualNICName string `json:"VirtualNicName,omitempty"`
}
type EndpointAttachDetachRequest = hns.EndpointAttachDetachRequest
// EndpointResquestResponse is object to get the endpoint request response
type EndpointResquestResponse struct {
Success bool
Error string
}
type EndpointResquestResponse = hns.EndpointResquestResponse
// HNSEndpointRequest makes a HNS call to modify/query a network endpoint
func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) {
endpoint := &HNSEndpoint{}
err := hnsCall(method, "/endpoints/"+path, request, &endpoint)
if err != nil {
return nil, err
}
return endpoint, nil
return hns.HNSEndpointRequest(method, path, request)
}
// HNSListEndpointRequest makes a HNS call to query the list of available endpoints
func HNSListEndpointRequest() ([]HNSEndpoint, error) {
var endpoint []HNSEndpoint
err := hnsCall("GET", "/endpoints/", "", &endpoint)
if err != nil {
return nil, err
}
return endpoint, nil
return hns.HNSListEndpointRequest()
}
// HotAttachEndpoint makes a HCS Call to attach the endpoint to the container
@ -120,204 +82,10 @@ func modifyNetworkEndpoint(containerID string, endpointID string, request Reques
// GetHNSEndpointByID get the Endpoint by ID
func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) {
return HNSEndpointRequest("GET", endpointID, "")
return hns.GetHNSEndpointByID(endpointID)
}
// GetHNSEndpointByName gets the endpoint filtered by Name
func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {
hnsResponse, err := HNSListEndpointRequest()
if err != nil {
return nil, err
}
for _, hnsEndpoint := range hnsResponse {
if hnsEndpoint.Name == endpointName {
return &hnsEndpoint, nil
}
}
return nil, EndpointNotFoundError{EndpointName: endpointName}
}
// Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods
func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) {
operation := "Create"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
jsonString, err := json.Marshal(endpoint)
if err != nil {
return nil, err
}
return HNSEndpointRequest("POST", "", string(jsonString))
}
// Delete Endpoint by sending EndpointRequest to HNS
func (endpoint *HNSEndpoint) Delete() (*HNSEndpoint, error) {
operation := "Delete"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
return HNSEndpointRequest("DELETE", endpoint.Id, "")
}
// Update Endpoint
func (endpoint *HNSEndpoint) Update() (*HNSEndpoint, error) {
operation := "Update"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
jsonString, err := json.Marshal(endpoint)
if err != nil {
return nil, err
}
err = hnsCall("POST", "/endpoints/"+endpoint.Id, string(jsonString), &endpoint)
return endpoint, err
}
// ContainerHotAttach attaches an endpoint to a running container
func (endpoint *HNSEndpoint) ContainerHotAttach(containerID string) error {
operation := "ContainerHotAttach"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s, containerId=%s", endpoint.Id, containerID)
return modifyNetworkEndpoint(containerID, endpoint.Id, Add)
}
// ContainerHotDetach detaches an endpoint from a running container
func (endpoint *HNSEndpoint) ContainerHotDetach(containerID string) error {
operation := "ContainerHotDetach"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s, containerId=%s", endpoint.Id, containerID)
return modifyNetworkEndpoint(containerID, endpoint.Id, Remove)
}
// ApplyACLPolicy applies a set of ACL Policies on the Endpoint
func (endpoint *HNSEndpoint) ApplyACLPolicy(policies ...*ACLPolicy) error {
operation := "ApplyACLPolicy"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
for _, policy := range policies {
if policy == nil {
continue
}
jsonString, err := json.Marshal(policy)
if err != nil {
return err
}
endpoint.Policies = append(endpoint.Policies, jsonString)
}
_, err := endpoint.Update()
return err
}
// ContainerAttach attaches an endpoint to container
func (endpoint *HNSEndpoint) ContainerAttach(containerID string, compartmentID uint16) error {
operation := "ContainerAttach"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
ContainerID: containerID,
CompartmentID: compartmentID,
SystemType: ContainerType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
}
// ContainerDetach detaches an endpoint from container
func (endpoint *HNSEndpoint) ContainerDetach(containerID string) error {
operation := "ContainerDetach"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
ContainerID: containerID,
SystemType: ContainerType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
}
// HostAttach attaches a nic on the host
func (endpoint *HNSEndpoint) HostAttach(compartmentID uint16) error {
operation := "HostAttach"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
CompartmentID: compartmentID,
SystemType: HostType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
}
// HostDetach detaches a nic on the host
func (endpoint *HNSEndpoint) HostDetach() error {
operation := "HostDetach"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
SystemType: HostType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
}
// VirtualMachineNICAttach attaches a endpoint to a virtual machine
func (endpoint *HNSEndpoint) VirtualMachineNICAttach(virtualMachineNICName string) error {
operation := "VirtualMachineNicAttach"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
VirtualNICName: virtualMachineNICName,
SystemType: VirtualMachineType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
}
// VirtualMachineNICDetach detaches a endpoint from a virtual machine
func (endpoint *HNSEndpoint) VirtualMachineNICDetach() error {
operation := "VirtualMachineNicDetach"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
SystemType: VirtualMachineType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
return hns.GetHNSEndpointByName(endpointName)
}

View File

@ -0,0 +1,16 @@
package hcsshim
import (
"github.com/Microsoft/hcsshim/internal/hns"
)
type HNSGlobals = hns.HNSGlobals
type HNSVersion = hns.HNSVersion
var (
HNSVersion1803 = hns.HNSVersion1803
)
func GetHNSGlobals() (*HNSGlobals, error) {
return hns.GetHNSGlobals()
}

View File

@ -1,141 +1,36 @@
package hcsshim
import (
"encoding/json"
"net"
"github.com/sirupsen/logrus"
"github.com/Microsoft/hcsshim/internal/hns"
)
// Subnet is assoicated with a network and represents a list
// of subnets available to the network
type Subnet struct {
AddressPrefix string `json:",omitempty"`
GatewayAddress string `json:",omitempty"`
Policies []json.RawMessage `json:",omitempty"`
}
type Subnet = hns.Subnet
// MacPool is assoicated with a network and represents a list
// of macaddresses available to the network
type MacPool struct {
StartMacAddress string `json:",omitempty"`
EndMacAddress string `json:",omitempty"`
}
type MacPool = hns.MacPool
// HNSNetwork represents a network in HNS
type HNSNetwork struct {
Id string `json:"ID,omitempty"`
Name string `json:",omitempty"`
Type string `json:",omitempty"`
NetworkAdapterName string `json:",omitempty"`
SourceMac string `json:",omitempty"`
Policies []json.RawMessage `json:",omitempty"`
MacPools []MacPool `json:",omitempty"`
Subnets []Subnet `json:",omitempty"`
DNSSuffix string `json:",omitempty"`
DNSServerList string `json:",omitempty"`
DNSServerCompartment uint32 `json:",omitempty"`
ManagementIP string `json:",omitempty"`
AutomaticDNS bool `json:",omitempty"`
}
type hnsNetworkResponse struct {
Success bool
Error string
Output HNSNetwork
}
type hnsResponse struct {
Success bool
Error string
Output json.RawMessage
}
type HNSNetwork = hns.HNSNetwork
// HNSNetworkRequest makes a call into HNS to update/query a single network
func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) {
var network HNSNetwork
err := hnsCall(method, "/networks/"+path, request, &network)
if err != nil {
return nil, err
}
return &network, nil
return hns.HNSNetworkRequest(method, path, request)
}
// HNSListNetworkRequest makes a HNS call to query the list of available networks
func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) {
var network []HNSNetwork
err := hnsCall(method, "/networks/"+path, request, &network)
if err != nil {
return nil, err
}
return network, nil
return hns.HNSListNetworkRequest(method, path, request)
}
// GetHNSNetworkByID
func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) {
return HNSNetworkRequest("GET", networkID, "")
return hns.GetHNSNetworkByID(networkID)
}
// GetHNSNetworkName filtered by Name
func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) {
hsnnetworks, err := HNSListNetworkRequest("GET", "", "")
if err != nil {
return nil, err
}
for _, hnsnetwork := range hsnnetworks {
if hnsnetwork.Name == networkName {
return &hnsnetwork, nil
}
}
return nil, NetworkNotFoundError{NetworkName: networkName}
}
// Create Network by sending NetworkRequest to HNS.
func (network *HNSNetwork) Create() (*HNSNetwork, error) {
operation := "Create"
title := "HCSShim::HNSNetwork::" + operation
logrus.Debugf(title+" id=%s", network.Id)
jsonString, err := json.Marshal(network)
if err != nil {
return nil, err
}
return HNSNetworkRequest("POST", "", string(jsonString))
}
// Delete Network by sending NetworkRequest to HNS
func (network *HNSNetwork) Delete() (*HNSNetwork, error) {
operation := "Delete"
title := "HCSShim::HNSNetwork::" + operation
logrus.Debugf(title+" id=%s", network.Id)
return HNSNetworkRequest("DELETE", network.Id, "")
}
// Creates an endpoint on the Network.
func (network *HNSNetwork) NewEndpoint(ipAddress net.IP, macAddress net.HardwareAddr) *HNSEndpoint {
return &HNSEndpoint{
VirtualNetwork: network.Id,
IPAddress: ipAddress,
MacAddress: string(macAddress),
}
}
func (network *HNSNetwork) CreateEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
operation := "CreateEndpoint"
title := "HCSShim::HNSNetwork::" + operation
logrus.Debugf(title+" id=%s, endpointId=%s", network.Id, endpoint.Id)
endpoint.VirtualNetwork = network.Id
return endpoint.Create()
}
func (network *HNSNetwork) CreateRemoteEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
operation := "CreateRemoteEndpoint"
title := "HCSShim::HNSNetwork::" + operation
logrus.Debugf(title+" id=%s", network.Id)
endpoint.IsRemoteEndpoint = true
return network.CreateEndpoint(endpoint)
return hns.GetHNSNetworkByName(networkName)
}

View File

@ -1,94 +1,57 @@
package hcsshim
import (
"github.com/Microsoft/hcsshim/internal/hns"
)
// Type of Request Support in ModifySystem
type PolicyType string
type PolicyType = hns.PolicyType
// RequestType const
const (
Nat PolicyType = "NAT"
ACL PolicyType = "ACL"
PA PolicyType = "PA"
VLAN PolicyType = "VLAN"
VSID PolicyType = "VSID"
VNet PolicyType = "VNET"
L2Driver PolicyType = "L2Driver"
Isolation PolicyType = "Isolation"
QOS PolicyType = "QOS"
OutboundNat PolicyType = "OutBoundNAT"
ExternalLoadBalancer PolicyType = "ELB"
Route PolicyType = "ROUTE"
Nat = hns.Nat
ACL = hns.ACL
PA = hns.PA
VLAN = hns.VLAN
VSID = hns.VSID
VNet = hns.VNet
L2Driver = hns.L2Driver
Isolation = hns.Isolation
QOS = hns.QOS
OutboundNat = hns.OutboundNat
ExternalLoadBalancer = hns.ExternalLoadBalancer
Route = hns.Route
)
type NatPolicy struct {
Type PolicyType `json:"Type"`
Protocol string
InternalPort uint16
ExternalPort uint16
}
type NatPolicy = hns.NatPolicy
type QosPolicy struct {
Type PolicyType `json:"Type"`
MaximumOutgoingBandwidthInBytes uint64
}
type QosPolicy = hns.QosPolicy
type IsolationPolicy struct {
Type PolicyType `json:"Type"`
VLAN uint
VSID uint
InDefaultIsolation bool
}
type IsolationPolicy = hns.IsolationPolicy
type VlanPolicy struct {
Type PolicyType `json:"Type"`
VLAN uint
}
type VlanPolicy = hns.VlanPolicy
type VsidPolicy struct {
Type PolicyType `json:"Type"`
VSID uint
}
type VsidPolicy = hns.VsidPolicy
type PaPolicy struct {
Type PolicyType `json:"Type"`
PA string `json:"PA"`
}
type PaPolicy = hns.PaPolicy
type OutboundNatPolicy struct {
Policy
VIP string `json:"VIP,omitempty"`
Exceptions []string `json:"ExceptionList,omitempty"`
}
type OutboundNatPolicy = hns.OutboundNatPolicy
type ActionType string
type DirectionType string
type RuleType string
type ActionType = hns.ActionType
type DirectionType = hns.DirectionType
type RuleType = hns.RuleType
const (
Allow ActionType = "Allow"
Block ActionType = "Block"
Allow = hns.Allow
Block = hns.Block
In DirectionType = "In"
Out DirectionType = "Out"
In = hns.In
Out = hns.Out
Host RuleType = "Host"
Switch RuleType = "Switch"
Host = hns.Host
Switch = hns.Switch
)
type ACLPolicy struct {
Type PolicyType `json:"Type"`
Protocol uint16
InternalPort uint16
Action ActionType
Direction DirectionType
LocalAddresses string
RemoteAddresses string
LocalPort uint16
RemotePort uint16
RuleType RuleType `json:"RuleType,omitempty"`
Priority uint16
ServiceName string
}
type ACLPolicy = hns.ACLPolicy
type Policy struct {
Type PolicyType `json:"Type"`
}
type Policy = hns.Policy

View File

@ -1,200 +1,47 @@
package hcsshim
import (
"encoding/json"
"github.com/sirupsen/logrus"
"github.com/Microsoft/hcsshim/internal/hns"
)
// RoutePolicy is a structure defining schema for Route based Policy
type RoutePolicy struct {
Policy
DestinationPrefix string `json:"DestinationPrefix,omitempty"`
NextHop string `json:"NextHop,omitempty"`
EncapEnabled bool `json:"NeedEncap,omitempty"`
}
type RoutePolicy = hns.RoutePolicy
// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy
type ELBPolicy struct {
LBPolicy
SourceVIP string `json:"SourceVIP,omitempty"`
VIPs []string `json:"VIPs,omitempty"`
ILB bool `json:"ILB,omitempty"`
}
type ELBPolicy = hns.ELBPolicy
// LBPolicy is a structure defining schema for LoadBalancing based Policy
type LBPolicy struct {
Policy
Protocol uint16 `json:"Protocol,omitempty"`
InternalPort uint16
ExternalPort uint16
}
type LBPolicy = hns.LBPolicy
// PolicyList is a structure defining schema for Policy list request
type PolicyList struct {
ID string `json:"ID,omitempty"`
EndpointReferences []string `json:"References,omitempty"`
Policies []json.RawMessage `json:"Policies,omitempty"`
}
type PolicyList = hns.PolicyList
// HNSPolicyListRequest makes a call into HNS to update/query a single network
func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) {
var policy PolicyList
err := hnsCall(method, "/policylists/"+path, request, &policy)
if err != nil {
return nil, err
}
return &policy, nil
return hns.HNSPolicyListRequest(method, path, request)
}
// HNSListPolicyListRequest gets all the policy list
func HNSListPolicyListRequest() ([]PolicyList, error) {
var plist []PolicyList
err := hnsCall("GET", "/policylists/", "", &plist)
if err != nil {
return nil, err
}
return plist, nil
return hns.HNSListPolicyListRequest()
}
// PolicyListRequest makes a HNS call to modify/query a network policy list
func PolicyListRequest(method, path, request string) (*PolicyList, error) {
policylist := &PolicyList{}
err := hnsCall(method, "/policylists/"+path, request, &policylist)
if err != nil {
return nil, err
}
return policylist, nil
return hns.PolicyListRequest(method, path, request)
}
// GetPolicyListByID get the policy list by ID
func GetPolicyListByID(policyListID string) (*PolicyList, error) {
return PolicyListRequest("GET", policyListID, "")
}
// Create PolicyList by sending PolicyListRequest to HNS.
func (policylist *PolicyList) Create() (*PolicyList, error) {
operation := "Create"
title := "HCSShim::PolicyList::" + operation
logrus.Debugf(title+" id=%s", policylist.ID)
jsonString, err := json.Marshal(policylist)
if err != nil {
return nil, err
}
return PolicyListRequest("POST", "", string(jsonString))
}
// Delete deletes PolicyList
func (policylist *PolicyList) Delete() (*PolicyList, error) {
operation := "Delete"
title := "HCSShim::PolicyList::" + operation
logrus.Debugf(title+" id=%s", policylist.ID)
return PolicyListRequest("DELETE", policylist.ID, "")
}
// AddEndpoint add an endpoint to a Policy List
func (policylist *PolicyList) AddEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
operation := "AddEndpoint"
title := "HCSShim::PolicyList::" + operation
logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
_, err := policylist.Delete()
if err != nil {
return nil, err
}
// Add Endpoint to the Existing List
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
return policylist.Create()
}
// RemoveEndpoint removes an endpoint from the Policy List
func (policylist *PolicyList) RemoveEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
operation := "RemoveEndpoint"
title := "HCSShim::PolicyList::" + operation
logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
_, err := policylist.Delete()
if err != nil {
return nil, err
}
elementToRemove := "/endpoints/" + endpoint.Id
var references []string
for _, endpointReference := range policylist.EndpointReferences {
if endpointReference == elementToRemove {
continue
}
references = append(references, endpointReference)
}
policylist.EndpointReferences = references
return policylist.Create()
return hns.GetPolicyListByID(policyListID)
}
// AddLoadBalancer policy list for the specified endpoints
func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) {
operation := "AddLoadBalancer"
title := "HCSShim::PolicyList::" + operation
logrus.Debugf(title+" endpointId=%v, isILB=%v, sourceVIP=%s, vip=%s, protocol=%v, internalPort=%v, externalPort=%v", endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort)
policylist := &PolicyList{}
elbPolicy := &ELBPolicy{
SourceVIP: sourceVIP,
ILB: isILB,
}
if len(vip) > 0 {
elbPolicy.VIPs = []string{vip}
}
elbPolicy.Type = ExternalLoadBalancer
elbPolicy.Protocol = protocol
elbPolicy.InternalPort = internalPort
elbPolicy.ExternalPort = externalPort
for _, endpoint := range endpoints {
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
}
jsonString, err := json.Marshal(elbPolicy)
if err != nil {
return nil, err
}
policylist.Policies = append(policylist.Policies, jsonString)
return policylist.Create()
return hns.AddLoadBalancer(endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort)
}
// AddRoute adds route policy list for the specified endpoints
func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) {
operation := "AddRoute"
title := "HCSShim::PolicyList::" + operation
logrus.Debugf(title+" destinationPrefix:%s", destinationPrefix)
policylist := &PolicyList{}
rPolicy := &RoutePolicy{
DestinationPrefix: destinationPrefix,
NextHop: nextHop,
EncapEnabled: encapEnabled,
}
rPolicy.Type = Route
for _, endpoint := range endpoints {
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
}
jsonString, err := json.Marshal(rPolicy)
if err != nil {
return nil, err
}
policylist.Policies = append(policylist.Policies, jsonString)
return policylist.Create()
return hns.AddRoute(endpoints, destinationPrefix, nextHop, encapEnabled)
}

View File

@ -0,0 +1,13 @@
package hcsshim
import (
"github.com/Microsoft/hcsshim/internal/hns"
)
type HNSSupportedFeatures = hns.HNSSupportedFeatures
type HNSAclFeatures = hns.HNSAclFeatures
func GetHNSSupportedFeatures() HNSSupportedFeatures {
return hns.GetHNSSupportedFeatures()
}

View File

@ -1,117 +1,27 @@
package hcsshim
import (
"encoding/json"
"io"
"time"
"github.com/Microsoft/hcsshim/internal/schema1"
)
// ProcessConfig is used as both the input of Container.CreateProcess
// and to convert the parameters to JSON for passing onto the HCS
type ProcessConfig struct {
ApplicationName string `json:",omitempty"`
CommandLine string `json:",omitempty"`
CommandArgs []string `json:",omitempty"` // Used by Linux Containers on Windows
User string `json:",omitempty"`
WorkingDirectory string `json:",omitempty"`
Environment map[string]string `json:",omitempty"`
EmulateConsole bool `json:",omitempty"`
CreateStdInPipe bool `json:",omitempty"`
CreateStdOutPipe bool `json:",omitempty"`
CreateStdErrPipe bool `json:",omitempty"`
ConsoleSize [2]uint `json:",omitempty"`
CreateInUtilityVm bool `json:",omitempty"` // Used by Linux Containers on Windows
OCISpecification *json.RawMessage `json:",omitempty"` // Used by Linux Containers on Windows
}
type ProcessConfig = schema1.ProcessConfig
type Layer struct {
ID string
Path string
}
type MappedDir struct {
HostPath string
ContainerPath string
ReadOnly bool
BandwidthMaximum uint64
IOPSMaximum uint64
CreateInUtilityVM bool
// LinuxMetadata - Support added in 1803/RS4+.
LinuxMetadata bool `json:",omitempty"`
}
type MappedPipe struct {
HostPath string
ContainerPipeName string
}
type HvRuntime struct {
ImagePath string `json:",omitempty"`
SkipTemplate bool `json:",omitempty"`
LinuxInitrdFile string `json:",omitempty"` // File under ImagePath on host containing an initrd image for starting a Linux utility VM
LinuxKernelFile string `json:",omitempty"` // File under ImagePath on host containing a kernel for starting a Linux utility VM
LinuxBootParameters string `json:",omitempty"` // Additional boot parameters for starting a Linux Utility VM in initrd mode
BootSource string `json:",omitempty"` // "Vhd" for Linux Utility VM booting from VHD
WritableBootSource bool `json:",omitempty"` // Linux Utility VM booting from VHD
}
type MappedVirtualDisk struct {
HostPath string `json:",omitempty"` // Path to VHD on the host
ContainerPath string // Platform-specific mount point path in the container
CreateInUtilityVM bool `json:",omitempty"`
ReadOnly bool `json:",omitempty"`
Cache string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing"
AttachOnly bool `json:",omitempty:`
}
// AssignedDevice represents a device that has been directly assigned to a container
//
// NOTE: Support added in RS5
type AssignedDevice struct {
// InterfaceClassGUID of the device to assign to container.
InterfaceClassGUID string `json:"InterfaceClassGuid,omitempty"`
}
type Layer = schema1.Layer
type MappedDir = schema1.MappedDir
type MappedPipe = schema1.MappedPipe
type HvRuntime = schema1.HvRuntime
type MappedVirtualDisk = schema1.MappedVirtualDisk
// ContainerConfig is used as both the input of CreateContainer
// and to convert the parameters to JSON for passing onto the HCS
type ContainerConfig struct {
SystemType string // HCS requires this to be hard-coded to "Container"
Name string // Name of the container. We use the docker ID.
Owner string `json:",omitempty"` // The management platform that created this container
VolumePath string `json:",omitempty"` // Windows volume path for scratch space. Used by Windows Server Containers only. Format \\?\\Volume{GUID}
IgnoreFlushesDuringBoot bool `json:",omitempty"` // Optimization hint for container startup in Windows
LayerFolderPath string `json:",omitempty"` // Where the layer folders are located. Used by Windows Server Containers only. Format %root%\windowsfilter\containerID
Layers []Layer // List of storage layers. Required for Windows Server and Hyper-V Containers. Format ID=GUID;Path=%root%\windowsfilter\layerID
Credentials string `json:",omitempty"` // Credentials information
ProcessorCount uint32 `json:",omitempty"` // Number of processors to assign to the container.
ProcessorWeight uint64 `json:",omitempty"` // CPU shares (relative weight to other containers with cpu shares). Range is from 1 to 10000. A value of 0 results in default shares.
ProcessorMaximum int64 `json:",omitempty"` // Specifies the portion of processor cycles that this container can use as a percentage times 100. Range is from 1 to 10000. A value of 0 results in no limit.
StorageIOPSMaximum uint64 `json:",omitempty"` // Maximum Storage IOPS
StorageBandwidthMaximum uint64 `json:",omitempty"` // Maximum Storage Bandwidth in bytes per second
StorageSandboxSize uint64 `json:",omitempty"` // Size in bytes that the container system drive should be expanded to if smaller
MemoryMaximumInMB int64 `json:",omitempty"` // Maximum memory available to the container in Megabytes
HostName string `json:",omitempty"` // Hostname
MappedDirectories []MappedDir `json:",omitempty"` // List of mapped directories (volumes/mounts)
MappedPipes []MappedPipe `json:",omitempty"` // List of mapped Windows named pipes
HvPartition bool // True if it a Hyper-V Container
NetworkSharedContainerName string `json:",omitempty"` // Name (ID) of the container that we will share the network stack with.
EndpointList []string `json:",omitempty"` // List of networking endpoints to be attached to container
HvRuntime *HvRuntime `json:",omitempty"` // Hyper-V container settings. Used by Hyper-V containers only. Format ImagePath=%root%\BaseLayerID\UtilityVM
Servicing bool `json:",omitempty"` // True if this container is for servicing
AllowUnqualifiedDNSQuery bool `json:",omitempty"` // True to allow unqualified DNS name resolution
DNSSearchList string `json:",omitempty"` // Comma seperated list of DNS suffixes to use for name resolution
ContainerType string `json:",omitempty"` // "Linux" for Linux containers on Windows. Omitted otherwise.
TerminateOnLastHandleClosed bool `json:",omitempty"` // Should HCS terminate the container once all handles have been closed
MappedVirtualDisks []MappedVirtualDisk `json:",omitempty"` // Array of virtual disks to mount at start
AssignedDevices []AssignedDevice `json:",omitempty"` // Array of devices to assign. NOTE: Support added in RS5
}
type ContainerConfig = schema1.ContainerConfig
type ComputeSystemQuery struct {
IDs []string `json:"Ids,omitempty"`
Types []string `json:",omitempty"`
Names []string `json:",omitempty"`
Owners []string `json:",omitempty"`
}
type ComputeSystemQuery = schema1.ComputeSystemQuery
// Container represents a created (but not necessarily running) container.
type Container interface {

View File

@ -0,0 +1,22 @@
package guid
import (
"crypto/rand"
"fmt"
"io"
)
type GUID [16]byte
func New() GUID {
g := GUID{}
_, err := io.ReadFull(rand.Reader, g[:])
if err != nil {
panic(err)
}
return g
}
func (g GUID) String() string {
return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:])
}

View File

@ -1,8 +1,10 @@
package hcsshim
package hcs
import (
"sync"
"syscall"
"github.com/Microsoft/hcsshim/internal/interop"
)
var (
@ -62,7 +64,7 @@ func closeChannels(channels notificationChannels) {
func notificationWatcher(notificationType hcsNotification, callbackNumber uintptr, notificationStatus uintptr, notificationData *uint16) uintptr {
var result error
if int32(notificationStatus) < 0 {
result = syscall.Errno(win32FromHresult(notificationStatus))
result = interop.Win32FromHresult(notificationStatus)
}
callbackMapLock.RLock()

View File

@ -0,0 +1,279 @@
package hcs
import (
"encoding/json"
"errors"
"fmt"
"syscall"
"github.com/Microsoft/hcsshim/internal/interop"
"github.com/sirupsen/logrus"
)
var (
// ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists
ErrComputeSystemDoesNotExist = syscall.Errno(0xc037010e)
// ErrElementNotFound is an error encountered when the object being referenced does not exist
ErrElementNotFound = syscall.Errno(0x490)
// ErrElementNotFound is an error encountered when the object being referenced does not exist
ErrNotSupported = syscall.Errno(0x32)
// ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported
// decimal -2147024883 / hex 0x8007000d
ErrInvalidData = syscall.Errno(0xd)
// ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed
ErrHandleClose = errors.New("hcsshim: the handle generating this notification has been closed")
// ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method
ErrAlreadyClosed = errors.New("hcsshim: the handle has already been closed")
// ErrInvalidNotificationType is an error encountered when an invalid notification type is used
ErrInvalidNotificationType = errors.New("hcsshim: invalid notification type")
// ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation
ErrInvalidProcessState = errors.New("the process is in an invalid state for the attempted operation")
// ErrTimeout is an error encountered when waiting on a notification times out
ErrTimeout = errors.New("hcsshim: timeout waiting for notification")
// ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for
// a different expected notification
ErrUnexpectedContainerExit = errors.New("unexpected container exit")
// ErrUnexpectedProcessAbort is the error encountered when communication with the compute service
// is lost while waiting for a notification
ErrUnexpectedProcessAbort = errors.New("lost communication with compute service")
// ErrUnexpectedValue is an error encountered when hcs returns an invalid value
ErrUnexpectedValue = errors.New("unexpected value returned from hcs")
// ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container
ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110)
// ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously
ErrVmcomputeOperationPending = syscall.Errno(0xC0370103)
// ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation
ErrVmcomputeOperationInvalidState = syscall.Errno(0xc0370105)
// ErrProcNotFound is an error encountered when the the process cannot be found
ErrProcNotFound = syscall.Errno(0x7f)
// ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2
// builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3.
ErrVmcomputeOperationAccessIsDenied = syscall.Errno(0x5)
// ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management
ErrVmcomputeInvalidJSON = syscall.Errno(0xc037010d)
// ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message
ErrVmcomputeUnknownMessage = syscall.Errno(0xc037010b)
// ErrNotSupported is an error encountered when hcs doesn't support the request
ErrPlatformNotSupported = errors.New("unsupported platform request")
)
type ErrorEvent struct {
Message string `json:"Message,omitempty"` // Fully formated error message
StackTrace string `json:"StackTrace,omitempty"` // Stack trace in string form
Provider string `json:"Provider,omitempty"`
EventID uint16 `json:"EventId,omitempty"`
Flags uint32 `json:"Flags,omitempty"`
Source string `json:"Source,omitempty"`
//Data []EventData `json:"Data,omitempty"` // Omit this as HCS doesn't encode this well. It's more confusing to include. It is however logged in debug mode (see processHcsResult function)
}
type hcsResult struct {
Error int32
ErrorMessage string
ErrorEvents []ErrorEvent `json:"ErrorEvents,omitempty"`
}
func (ev *ErrorEvent) String() string {
evs := "[Event Detail: " + ev.Message
if ev.StackTrace != "" {
evs += " Stack Trace: " + ev.StackTrace
}
if ev.Provider != "" {
evs += " Provider: " + ev.Provider
}
if ev.EventID != 0 {
evs = fmt.Sprintf("%s EventID: %d", evs, ev.EventID)
}
if ev.Flags != 0 {
evs = fmt.Sprintf("%s flags: %d", evs, ev.Flags)
}
if ev.Source != "" {
evs += " Source: " + ev.Source
}
evs += "]"
return evs
}
func processHcsResult(resultp *uint16) []ErrorEvent {
if resultp != nil {
resultj := interop.ConvertAndFreeCoTaskMemString(resultp)
logrus.Debugf("Result: %s", resultj)
result := &hcsResult{}
if err := json.Unmarshal([]byte(resultj), result); err != nil {
logrus.Warnf("Could not unmarshal HCS result %s: %s", resultj, err)
return nil
}
return result.ErrorEvents
}
return nil
}
type HcsError struct {
Op string
Err error
Events []ErrorEvent
}
func (e *HcsError) Error() string {
s := e.Op + ": " + e.Err.Error()
for _, ev := range e.Events {
s += "\n" + ev.String()
}
return s
}
// ProcessError is an error encountered in HCS during an operation on a Process object
type ProcessError struct {
SystemID string
Pid int
Op string
Err error
Events []ErrorEvent
}
// SystemError is an error encountered in HCS during an operation on a Container object
type SystemError struct {
ID string
Op string
Err error
Extra string
Events []ErrorEvent
}
func (e *SystemError) Error() string {
s := e.Op + " " + e.ID + ": " + e.Err.Error()
for _, ev := range e.Events {
s += "\n" + ev.String()
}
if e.Extra != "" {
s += "\n(extra info: " + e.Extra + ")"
}
return s
}
func makeSystemError(system *System, op string, extra string, err error, events []ErrorEvent) error {
// Don't double wrap errors
if _, ok := err.(*SystemError); ok {
return err
}
return &SystemError{
ID: system.ID(),
Op: op,
Extra: extra,
Err: err,
Events: events,
}
}
func (e *ProcessError) Error() string {
s := fmt.Sprintf("%s %s:%d: %s", e.Op, e.SystemID, e.Pid, e.Err.Error())
for _, ev := range e.Events {
s += "\n" + ev.String()
}
return s
}
func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error {
// Don't double wrap errors
if _, ok := err.(*ProcessError); ok {
return err
}
return &ProcessError{
Pid: process.Pid(),
SystemID: process.SystemID(),
Op: op,
Err: err,
Events: events,
}
}
// IsNotExist checks if an error is caused by the Container or Process not existing.
// Note: Currently, ErrElementNotFound can mean that a Process has either
// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
func IsNotExist(err error) bool {
err = getInnerError(err)
return err == ErrComputeSystemDoesNotExist ||
err == ErrElementNotFound ||
err == ErrProcNotFound
}
// IsAlreadyClosed checks if an error is caused by the Container or Process having been
// already closed by a call to the Close() method.
func IsAlreadyClosed(err error) bool {
err = getInnerError(err)
return err == ErrAlreadyClosed
}
// IsPending returns a boolean indicating whether the error is that
// the requested operation is being completed in the background.
func IsPending(err error) bool {
err = getInnerError(err)
return err == ErrVmcomputeOperationPending
}
// IsTimeout returns a boolean indicating whether the error is caused by
// a timeout waiting for the operation to complete.
func IsTimeout(err error) bool {
err = getInnerError(err)
return err == ErrTimeout
}
// IsAlreadyStopped returns a boolean indicating whether the error is caused by
// a Container or Process being already stopped.
// Note: Currently, ErrElementNotFound can mean that a Process has either
// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
func IsAlreadyStopped(err error) bool {
err = getInnerError(err)
return err == ErrVmcomputeAlreadyStopped ||
err == ErrElementNotFound ||
err == ErrProcNotFound
}
// IsNotSupported returns a boolean indicating whether the error is caused by
// unsupported platform requests
// Note: Currently Unsupported platform requests can be mean either
// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage
// is thrown from the Platform
func IsNotSupported(err error) bool {
err = getInnerError(err)
// If Platform doesn't recognize or support the request sent, below errors are seen
return err == ErrVmcomputeInvalidJSON ||
err == ErrInvalidData ||
err == ErrNotSupported ||
err == ErrVmcomputeUnknownMessage
}
func getInnerError(err error) error {
switch pe := err.(type) {
case nil:
return nil
case *HcsError:
err = pe.Err
case *SystemError:
err = pe.Err
case *ProcessError:
err = pe.Err
}
return err
}

View File

@ -0,0 +1,47 @@
// Shim for the Host Compute Service (HCS) to manage Windows Server
// containers and Hyper-V containers.
package hcs
import (
"syscall"
)
//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hcs.go
//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems?
//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem?
//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem?
//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem?
//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem?
//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem?
//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem?
//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem?
//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem?
//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties?
//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem?
//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback?
//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback?
//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess?
//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess?
//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess?
//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo?
//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties?
//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess?
//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties?
//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback?
//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback?
type hcsSystem syscall.Handle
type hcsProcess syscall.Handle
type hcsCallback syscall.Handle
type hcsProcessInformation struct {
ProcessId uint32
Reserved uint32
StdInput syscall.Handle
StdOutput syscall.Handle
StdError syscall.Handle
}

View File

@ -0,0 +1,386 @@
package hcs
import (
"encoding/json"
"io"
"sync"
"syscall"
"time"
"github.com/Microsoft/hcsshim/internal/interop"
"github.com/sirupsen/logrus"
)
// ContainerError is an error encountered in HCS
type Process struct {
handleLock sync.RWMutex
handle hcsProcess
processID int
system *System
cachedPipes *cachedPipes
callbackNumber uintptr
}
type cachedPipes struct {
stdIn syscall.Handle
stdOut syscall.Handle
stdErr syscall.Handle
}
type processModifyRequest struct {
Operation string
ConsoleSize *consoleSize `json:",omitempty"`
CloseHandle *closeHandle `json:",omitempty"`
}
type consoleSize struct {
Height uint16
Width uint16
}
type closeHandle struct {
Handle string
}
type ProcessStatus struct {
ProcessID uint32
Exited bool
ExitCode uint32
LastWaitResult int32
}
const (
stdIn string = "StdIn"
stdOut string = "StdOut"
stdErr string = "StdErr"
)
const (
modifyConsoleSize string = "ConsoleSize"
modifyCloseHandle string = "CloseHandle"
)
// Pid returns the process ID of the process within the container.
func (process *Process) Pid() int {
return process.processID
}
// SystemID returns the ID of the process's compute system.
func (process *Process) SystemID() string {
return process.system.ID()
}
// Kill signals the process to terminate but does not wait for it to finish terminating.
func (process *Process) Kill() error {
process.handleLock.RLock()
defer process.handleLock.RUnlock()
operation := "Kill"
title := "hcsshim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
if process.handle == 0 {
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
}
var resultp *uint16
err := hcsTerminateProcess(process.handle, &resultp)
events := processHcsResult(resultp)
if err != nil {
return makeProcessError(process, operation, err, events)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return nil
}
// Wait waits for the process to exit.
func (process *Process) Wait() error {
operation := "Wait"
title := "hcsshim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
err := waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil)
if err != nil {
return makeProcessError(process, operation, err, nil)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return nil
}
// WaitTimeout waits for the process to exit or the duration to elapse. It returns
// false if timeout occurs.
func (process *Process) WaitTimeout(timeout time.Duration) error {
operation := "WaitTimeout"
title := "hcsshim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
err := waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout)
if err != nil {
return makeProcessError(process, operation, err, nil)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return nil
}
// ResizeConsole resizes the console of the process.
func (process *Process) ResizeConsole(width, height uint16) error {
process.handleLock.RLock()
defer process.handleLock.RUnlock()
operation := "ResizeConsole"
title := "hcsshim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
if process.handle == 0 {
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
}
modifyRequest := processModifyRequest{
Operation: modifyConsoleSize,
ConsoleSize: &consoleSize{
Height: height,
Width: width,
},
}
modifyRequestb, err := json.Marshal(modifyRequest)
if err != nil {
return err
}
modifyRequestStr := string(modifyRequestb)
var resultp *uint16
err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
events := processHcsResult(resultp)
if err != nil {
return makeProcessError(process, operation, err, events)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return nil
}
func (process *Process) Properties() (*ProcessStatus, error) {
process.handleLock.RLock()
defer process.handleLock.RUnlock()
operation := "Properties"
title := "hcsshim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
if process.handle == 0 {
return nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
}
var (
resultp *uint16
propertiesp *uint16
)
err := hcsGetProcessProperties(process.handle, &propertiesp, &resultp)
events := processHcsResult(resultp)
if err != nil {
return nil, makeProcessError(process, operation, err, events)
}
if propertiesp == nil {
return nil, ErrUnexpectedValue
}
propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
properties := &ProcessStatus{}
if err := json.Unmarshal(propertiesRaw, properties); err != nil {
return nil, makeProcessError(process, operation, err, nil)
}
logrus.Debugf(title+" succeeded processid=%d, properties=%s", process.processID, propertiesRaw)
return properties, nil
}
// ExitCode returns the exit code of the process. The process must have
// already terminated.
func (process *Process) ExitCode() (int, error) {
operation := "ExitCode"
properties, err := process.Properties()
if err != nil {
return 0, makeProcessError(process, operation, err, nil)
}
if properties.Exited == false {
return 0, makeProcessError(process, operation, ErrInvalidProcessState, nil)
}
if properties.LastWaitResult != 0 {
return 0, makeProcessError(process, operation, syscall.Errno(properties.LastWaitResult), nil)
}
return int(properties.ExitCode), nil
}
// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing
// these pipes does not close the underlying pipes; it should be possible to
// call this multiple times to get multiple interfaces.
func (process *Process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) {
process.handleLock.RLock()
defer process.handleLock.RUnlock()
operation := "Stdio"
title := "hcsshim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
if process.handle == 0 {
return nil, nil, nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
}
var stdIn, stdOut, stdErr syscall.Handle
if process.cachedPipes == nil {
var (
processInfo hcsProcessInformation
resultp *uint16
)
err := hcsGetProcessInfo(process.handle, &processInfo, &resultp)
events := processHcsResult(resultp)
if err != nil {
return nil, nil, nil, makeProcessError(process, operation, err, events)
}
stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError
} else {
// Use cached pipes
stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr
// Invalidate the cache
process.cachedPipes = nil
}
pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr})
if err != nil {
return nil, nil, nil, makeProcessError(process, operation, err, nil)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return pipes[0], pipes[1], pipes[2], nil
}
// CloseStdin closes the write side of the stdin pipe so that the process is
// notified on the read side that there is no more data in stdin.
func (process *Process) CloseStdin() error {
process.handleLock.RLock()
defer process.handleLock.RUnlock()
operation := "CloseStdin"
title := "hcsshim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
if process.handle == 0 {
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
}
modifyRequest := processModifyRequest{
Operation: modifyCloseHandle,
CloseHandle: &closeHandle{
Handle: stdIn,
},
}
modifyRequestb, err := json.Marshal(modifyRequest)
if err != nil {
return err
}
modifyRequestStr := string(modifyRequestb)
var resultp *uint16
err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
events := processHcsResult(resultp)
if err != nil {
return makeProcessError(process, operation, err, events)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return nil
}
// Close cleans up any state associated with the process but does not kill
// or wait on it.
func (process *Process) Close() error {
process.handleLock.Lock()
defer process.handleLock.Unlock()
operation := "Close"
title := "hcsshim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
// Don't double free this
if process.handle == 0 {
return nil
}
if err := process.unregisterCallback(); err != nil {
return makeProcessError(process, operation, err, nil)
}
if err := hcsCloseProcess(process.handle); err != nil {
return makeProcessError(process, operation, err, nil)
}
process.handle = 0
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return nil
}
func (process *Process) registerCallback() error {
context := &notifcationWatcherContext{
channels: newChannels(),
}
callbackMapLock.Lock()
callbackNumber := nextCallback
nextCallback++
callbackMap[callbackNumber] = context
callbackMapLock.Unlock()
var callbackHandle hcsCallback
err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
if err != nil {
return err
}
context.handle = callbackHandle
process.callbackNumber = callbackNumber
return nil
}
func (process *Process) unregisterCallback() error {
callbackNumber := process.callbackNumber
callbackMapLock.RLock()
context := callbackMap[callbackNumber]
callbackMapLock.RUnlock()
if context == nil {
return nil
}
handle := context.handle
if handle == 0 {
return nil
}
// hcsUnregisterProcessCallback has its own syncronization
// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
err := hcsUnregisterProcessCallback(handle)
if err != nil {
return err
}
closeChannels(context.channels)
callbackMapLock.Lock()
callbackMap[callbackNumber] = nil
callbackMapLock.Unlock()
handle = 0
return nil
}

View File

@ -0,0 +1,547 @@
package hcs
import (
"encoding/json"
"os"
"strconv"
"sync"
"syscall"
"time"
"github.com/Microsoft/hcsshim/internal/interop"
"github.com/Microsoft/hcsshim/internal/schema1"
"github.com/Microsoft/hcsshim/internal/timeout"
"github.com/sirupsen/logrus"
)
// currentContainerStarts is used to limit the number of concurrent container
// starts.
var currentContainerStarts containerStarts
type containerStarts struct {
maxParallel int
inProgress int
sync.Mutex
}
func init() {
mpsS := os.Getenv("HCSSHIM_MAX_PARALLEL_START")
if len(mpsS) > 0 {
mpsI, err := strconv.Atoi(mpsS)
if err != nil || mpsI < 0 {
return
}
currentContainerStarts.maxParallel = mpsI
}
}
type System struct {
handleLock sync.RWMutex
handle hcsSystem
id string
callbackNumber uintptr
}
// CreateComputeSystem creates a new compute system with the given configuration but does not start it.
func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (*System, error) {
operation := "CreateComputeSystem"
title := "hcsshim::" + operation
computeSystem := &System{
id: id,
}
hcsDocumentB, err := json.Marshal(hcsDocumentInterface)
if err != nil {
return nil, err
}
hcsDocument := string(hcsDocumentB)
logrus.Debugf(title+" ID=%s config=%s", id, hcsDocument)
var (
resultp *uint16
identity syscall.Handle
)
createError := hcsCreateComputeSystem(id, hcsDocument, identity, &computeSystem.handle, &resultp)
if createError == nil || IsPending(createError) {
if err := computeSystem.registerCallback(); err != nil {
// Terminate the compute system if it still exists. We're okay to
// ignore a failure here.
computeSystem.Terminate()
return nil, makeSystemError(computeSystem, operation, "", err, nil)
}
}
events, err := processAsyncHcsResult(createError, resultp, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.Duration)
if err != nil {
if err == ErrTimeout {
// Terminate the compute system if it still exists. We're okay to
// ignore a failure here.
computeSystem.Terminate()
}
return nil, makeSystemError(computeSystem, operation, hcsDocument, err, events)
}
logrus.Debugf(title+" succeeded id=%s handle=%d", id, computeSystem.handle)
return computeSystem, nil
}
// OpenComputeSystem opens an existing compute system by ID.
func OpenComputeSystem(id string) (*System, error) {
operation := "OpenComputeSystem"
title := "hcsshim::" + operation
logrus.Debugf(title+" ID=%s", id)
computeSystem := &System{
id: id,
}
var (
handle hcsSystem
resultp *uint16
)
err := hcsOpenComputeSystem(id, &handle, &resultp)
events := processHcsResult(resultp)
if err != nil {
return nil, makeSystemError(computeSystem, operation, "", err, events)
}
computeSystem.handle = handle
if err := computeSystem.registerCallback(); err != nil {
return nil, makeSystemError(computeSystem, operation, "", err, nil)
}
logrus.Debugf(title+" succeeded id=%s handle=%d", id, handle)
return computeSystem, nil
}
// GetComputeSystems gets a list of the compute systems on the system that match the query
func GetComputeSystems(q schema1.ComputeSystemQuery) ([]schema1.ContainerProperties, error) {
operation := "GetComputeSystems"
title := "hcsshim::" + operation
queryb, err := json.Marshal(q)
if err != nil {
return nil, err
}
query := string(queryb)
logrus.Debugf(title+" query=%s", query)
var (
resultp *uint16
computeSystemsp *uint16
)
err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp)
events := processHcsResult(resultp)
if err != nil {
return nil, &HcsError{Op: operation, Err: err, Events: events}
}
if computeSystemsp == nil {
return nil, ErrUnexpectedValue
}
computeSystemsRaw := interop.ConvertAndFreeCoTaskMemBytes(computeSystemsp)
computeSystems := []schema1.ContainerProperties{}
if err := json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil {
return nil, err
}
logrus.Debugf(title + " succeeded")
return computeSystems, nil
}
// Start synchronously starts the computeSystem.
func (computeSystem *System) Start() error {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
title := "hcsshim::ComputeSystem::Start ID=" + computeSystem.ID()
logrus.Debugf(title)
if computeSystem.handle == 0 {
return makeSystemError(computeSystem, "Start", "", ErrAlreadyClosed, nil)
}
// This is a very simple backoff-retry loop to limit the number
// of parallel container starts if environment variable
// HCSSHIM_MAX_PARALLEL_START is set to a positive integer.
// It should generally only be used as a workaround to various
// platform issues that exist between RS1 and RS4 as of Aug 2018
if currentContainerStarts.maxParallel > 0 {
for {
currentContainerStarts.Lock()
if currentContainerStarts.inProgress < currentContainerStarts.maxParallel {
currentContainerStarts.inProgress++
currentContainerStarts.Unlock()
break
}
if currentContainerStarts.inProgress == currentContainerStarts.maxParallel {
currentContainerStarts.Unlock()
time.Sleep(100 * time.Millisecond)
}
}
// Make sure we decrement the count when we are done.
defer func() {
currentContainerStarts.Lock()
currentContainerStarts.inProgress--
currentContainerStarts.Unlock()
}()
}
var resultp *uint16
err := hcsStartComputeSystem(computeSystem.handle, "", &resultp)
events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.Duration)
if err != nil {
return makeSystemError(computeSystem, "Start", "", err, events)
}
logrus.Debugf(title + " succeeded")
return nil
}
// ID returns the compute system's identifier.
func (computeSystem *System) ID() string {
return computeSystem.id
}
// Shutdown requests a compute system shutdown, if IsPending() on the error returned is true,
// it may not actually be shut down until Wait() succeeds.
func (computeSystem *System) Shutdown() error {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
title := "hcsshim::ComputeSystem::Shutdown"
logrus.Debugf(title)
if computeSystem.handle == 0 {
return makeSystemError(computeSystem, "Shutdown", "", ErrAlreadyClosed, nil)
}
var resultp *uint16
err := hcsShutdownComputeSystem(computeSystem.handle, "", &resultp)
events := processHcsResult(resultp)
if err != nil {
return makeSystemError(computeSystem, "Shutdown", "", err, events)
}
logrus.Debugf(title + " succeeded")
return nil
}
// Terminate requests a compute system terminate, if IsPending() on the error returned is true,
// it may not actually be shut down until Wait() succeeds.
func (computeSystem *System) Terminate() error {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
title := "hcsshim::ComputeSystem::Terminate ID=" + computeSystem.ID()
logrus.Debugf(title)
if computeSystem.handle == 0 {
return makeSystemError(computeSystem, "Terminate", "", ErrAlreadyClosed, nil)
}
var resultp *uint16
err := hcsTerminateComputeSystem(computeSystem.handle, "", &resultp)
events := processHcsResult(resultp)
if err != nil {
return makeSystemError(computeSystem, "Terminate", "", err, events)
}
logrus.Debugf(title + " succeeded")
return nil
}
// Wait synchronously waits for the compute system to shutdown or terminate.
func (computeSystem *System) Wait() error {
title := "hcsshim::ComputeSystem::Wait ID=" + computeSystem.ID()
logrus.Debugf(title)
err := waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil)
if err != nil {
return makeSystemError(computeSystem, "Wait", "", err, nil)
}
logrus.Debugf(title + " succeeded")
return nil
}
// WaitTimeout synchronously waits for the compute system to terminate or the duration to elapse.
// If the timeout expires, IsTimeout(err) == true
func (computeSystem *System) WaitTimeout(timeout time.Duration) error {
title := "hcsshim::ComputeSystem::WaitTimeout ID=" + computeSystem.ID()
logrus.Debugf(title)
err := waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, &timeout)
if err != nil {
return makeSystemError(computeSystem, "WaitTimeout", "", err, nil)
}
logrus.Debugf(title + " succeeded")
return nil
}
func (computeSystem *System) Properties(types ...schema1.PropertyType) (*schema1.ContainerProperties, error) {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
queryj, err := json.Marshal(schema1.PropertyQuery{types})
if err != nil {
return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
}
var resultp, propertiesp *uint16
err = hcsGetComputeSystemProperties(computeSystem.handle, string(queryj), &propertiesp, &resultp)
events := processHcsResult(resultp)
if err != nil {
return nil, makeSystemError(computeSystem, "Properties", "", err, events)
}
if propertiesp == nil {
return nil, ErrUnexpectedValue
}
propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
properties := &schema1.ContainerProperties{}
if err := json.Unmarshal(propertiesRaw, properties); err != nil {
return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
}
return properties, nil
}
// Pause pauses the execution of the computeSystem. This feature is not enabled in TP5.
func (computeSystem *System) Pause() error {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
title := "hcsshim::ComputeSystem::Pause ID=" + computeSystem.ID()
logrus.Debugf(title)
if computeSystem.handle == 0 {
return makeSystemError(computeSystem, "Pause", "", ErrAlreadyClosed, nil)
}
var resultp *uint16
err := hcsPauseComputeSystem(computeSystem.handle, "", &resultp)
events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.Duration)
if err != nil {
return makeSystemError(computeSystem, "Pause", "", err, events)
}
logrus.Debugf(title + " succeeded")
return nil
}
// Resume resumes the execution of the computeSystem. This feature is not enabled in TP5.
func (computeSystem *System) Resume() error {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
title := "hcsshim::ComputeSystem::Resume ID=" + computeSystem.ID()
logrus.Debugf(title)
if computeSystem.handle == 0 {
return makeSystemError(computeSystem, "Resume", "", ErrAlreadyClosed, nil)
}
var resultp *uint16
err := hcsResumeComputeSystem(computeSystem.handle, "", &resultp)
events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.Duration)
if err != nil {
return makeSystemError(computeSystem, "Resume", "", err, events)
}
logrus.Debugf(title + " succeeded")
return nil
}
// CreateProcess launches a new process within the computeSystem.
func (computeSystem *System) CreateProcess(c interface{}) (*Process, error) {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
title := "hcsshim::ComputeSystem::CreateProcess ID=" + computeSystem.ID()
var (
processInfo hcsProcessInformation
processHandle hcsProcess
resultp *uint16
)
if computeSystem.handle == 0 {
return nil, makeSystemError(computeSystem, "CreateProcess", "", ErrAlreadyClosed, nil)
}
configurationb, err := json.Marshal(c)
if err != nil {
return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
}
configuration := string(configurationb)
logrus.Debugf(title+" config=%s", configuration)
err = hcsCreateProcess(computeSystem.handle, configuration, &processInfo, &processHandle, &resultp)
events := processHcsResult(resultp)
if err != nil {
return nil, makeSystemError(computeSystem, "CreateProcess", configuration, err, events)
}
process := &Process{
handle: processHandle,
processID: int(processInfo.ProcessId),
system: computeSystem,
cachedPipes: &cachedPipes{
stdIn: processInfo.StdInput,
stdOut: processInfo.StdOutput,
stdErr: processInfo.StdError,
},
}
if err := process.registerCallback(); err != nil {
return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return process, nil
}
// OpenProcess gets an interface to an existing process within the computeSystem.
func (computeSystem *System) OpenProcess(pid int) (*Process, error) {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
title := "hcsshim::ComputeSystem::OpenProcess ID=" + computeSystem.ID()
logrus.Debugf(title+" processid=%d", pid)
var (
processHandle hcsProcess
resultp *uint16
)
if computeSystem.handle == 0 {
return nil, makeSystemError(computeSystem, "OpenProcess", "", ErrAlreadyClosed, nil)
}
err := hcsOpenProcess(computeSystem.handle, uint32(pid), &processHandle, &resultp)
events := processHcsResult(resultp)
if err != nil {
return nil, makeSystemError(computeSystem, "OpenProcess", "", err, events)
}
process := &Process{
handle: processHandle,
processID: pid,
system: computeSystem,
}
if err := process.registerCallback(); err != nil {
return nil, makeSystemError(computeSystem, "OpenProcess", "", err, nil)
}
logrus.Debugf(title+" succeeded processid=%s", process.processID)
return process, nil
}
// Close cleans up any state associated with the compute system but does not terminate or wait for it.
func (computeSystem *System) Close() error {
computeSystem.handleLock.Lock()
defer computeSystem.handleLock.Unlock()
title := "hcsshim::ComputeSystem::Close ID=" + computeSystem.ID()
logrus.Debugf(title)
// Don't double free this
if computeSystem.handle == 0 {
return nil
}
if err := computeSystem.unregisterCallback(); err != nil {
return makeSystemError(computeSystem, "Close", "", err, nil)
}
if err := hcsCloseComputeSystem(computeSystem.handle); err != nil {
return makeSystemError(computeSystem, "Close", "", err, nil)
}
computeSystem.handle = 0
logrus.Debugf(title + " succeeded")
return nil
}
func (computeSystem *System) registerCallback() error {
context := &notifcationWatcherContext{
channels: newChannels(),
}
callbackMapLock.Lock()
callbackNumber := nextCallback
nextCallback++
callbackMap[callbackNumber] = context
callbackMapLock.Unlock()
var callbackHandle hcsCallback
err := hcsRegisterComputeSystemCallback(computeSystem.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
if err != nil {
return err
}
context.handle = callbackHandle
computeSystem.callbackNumber = callbackNumber
return nil
}
func (computeSystem *System) unregisterCallback() error {
callbackNumber := computeSystem.callbackNumber
callbackMapLock.RLock()
context := callbackMap[callbackNumber]
callbackMapLock.RUnlock()
if context == nil {
return nil
}
handle := context.handle
if handle == 0 {
return nil
}
// hcsUnregisterComputeSystemCallback has its own syncronization
// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
err := hcsUnregisterComputeSystemCallback(handle)
if err != nil {
return err
}
closeChannels(context.channels)
callbackMapLock.Lock()
callbackMap[callbackNumber] = nil
callbackMapLock.Unlock()
handle = 0
return nil
}
// Modifies the System by sending a request to HCS
func (computeSystem *System) Modify(config interface{}) error {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
title := "hcsshim::Modify ID=" + computeSystem.id
if computeSystem.handle == 0 {
return makeSystemError(computeSystem, "Modify", "", ErrAlreadyClosed, nil)
}
requestJSON, err := json.Marshal(config)
if err != nil {
return err
}
requestString := string(requestJSON)
logrus.Debugf(title + " " + requestString)
var resultp *uint16
err = hcsModifyComputeSystem(computeSystem.handle, requestString, &resultp)
events := processHcsResult(resultp)
if err != nil {
return makeSystemError(computeSystem, "Modify", requestString, err, events)
}
logrus.Debugf(title + " succeeded ")
return nil
}

View File

@ -1,4 +1,4 @@
package hcsshim
package hcs
import (
"time"
@ -6,13 +6,13 @@ import (
"github.com/sirupsen/logrus"
)
func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error {
err = processHcsResult(err, resultp)
func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) {
events := processHcsResult(resultp)
if IsPending(err) {
return waitForNotification(callbackNumber, expectedNotification, timeout)
return nil, waitForNotification(callbackNumber, expectedNotification, timeout)
}
return err
return events, err
}
func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error {

View File

@ -0,0 +1,441 @@
// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT
package hcs
import (
"syscall"
"unsafe"
"github.com/Microsoft/hcsshim/internal/interop"
"golang.org/x/sys/windows"
)
var _ unsafe.Pointer
// Do the interface allocations only once for common
// Errno values.
const (
errnoERROR_IO_PENDING = 997
)
var (
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
)
// errnoErr returns common boxed Errno values, to prevent
// allocations at runtime.
func errnoErr(e syscall.Errno) error {
switch e {
case 0:
return nil
case errnoERROR_IO_PENDING:
return errERROR_IO_PENDING
}
// TODO: add more here, after collecting data on the common
// error values see on Windows. (perhaps when running
// all.bat?)
return e
}
var (
modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
procHcsEnumerateComputeSystems = modvmcompute.NewProc("HcsEnumerateComputeSystems")
procHcsCreateComputeSystem = modvmcompute.NewProc("HcsCreateComputeSystem")
procHcsOpenComputeSystem = modvmcompute.NewProc("HcsOpenComputeSystem")
procHcsCloseComputeSystem = modvmcompute.NewProc("HcsCloseComputeSystem")
procHcsStartComputeSystem = modvmcompute.NewProc("HcsStartComputeSystem")
procHcsShutdownComputeSystem = modvmcompute.NewProc("HcsShutdownComputeSystem")
procHcsTerminateComputeSystem = modvmcompute.NewProc("HcsTerminateComputeSystem")
procHcsPauseComputeSystem = modvmcompute.NewProc("HcsPauseComputeSystem")
procHcsResumeComputeSystem = modvmcompute.NewProc("HcsResumeComputeSystem")
procHcsGetComputeSystemProperties = modvmcompute.NewProc("HcsGetComputeSystemProperties")
procHcsModifyComputeSystem = modvmcompute.NewProc("HcsModifyComputeSystem")
procHcsRegisterComputeSystemCallback = modvmcompute.NewProc("HcsRegisterComputeSystemCallback")
procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback")
procHcsCreateProcess = modvmcompute.NewProc("HcsCreateProcess")
procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess")
procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess")
procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess")
procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo")
procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties")
procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess")
procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties")
procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback")
procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback")
)
func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(query)
if hr != nil {
return
}
return _hcsEnumerateComputeSystems(_p0, computeSystems, result)
}
func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) {
if hr = procHcsEnumerateComputeSystems.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
var _p1 *uint16
_p1, hr = syscall.UTF16PtrFromString(configuration)
if hr != nil {
return
}
return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result)
}
func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
if hr = procHcsCreateComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _hcsOpenComputeSystem(_p0, computeSystem, result)
}
func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) {
if hr = procHcsOpenComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) {
if hr = procHcsCloseComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(options)
if hr != nil {
return
}
return _hcsStartComputeSystem(computeSystem, _p0, result)
}
func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
if hr = procHcsStartComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(options)
if hr != nil {
return
}
return _hcsShutdownComputeSystem(computeSystem, _p0, result)
}
func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
if hr = procHcsShutdownComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(options)
if hr != nil {
return
}
return _hcsTerminateComputeSystem(computeSystem, _p0, result)
}
func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
if hr = procHcsTerminateComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(options)
if hr != nil {
return
}
return _hcsPauseComputeSystem(computeSystem, _p0, result)
}
func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
if hr = procHcsPauseComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(options)
if hr != nil {
return
}
return _hcsResumeComputeSystem(computeSystem, _p0, result)
}
func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
if hr = procHcsResumeComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
if hr != nil {
return
}
return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result)
}
func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
if hr = procHcsGetComputeSystemProperties.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(configuration)
if hr != nil {
return
}
return _hcsModifyComputeSystem(computeSystem, _p0, result)
}
func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) {
if hr = procHcsModifyComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) {
if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(processParameters)
if hr != nil {
return
}
return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result)
}
func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
if hr = procHcsCreateProcess.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) {
if hr = procHcsOpenProcess.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsCloseProcess(process hcsProcess) (hr error) {
if hr = procHcsCloseProcess.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) {
if hr = procHcsTerminateProcess.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) {
if hr = procHcsGetProcessInfo.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) {
if hr = procHcsGetProcessProperties.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(settings)
if hr != nil {
return
}
return _hcsModifyProcess(process, _p0, result)
}
func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) {
if hr = procHcsModifyProcess.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
if hr != nil {
return
}
return _hcsGetServiceProperties(_p0, properties, result)
}
func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
if hr = procHcsGetServiceProperties.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
if hr = procHcsRegisterProcessCallback.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) {
if hr = procHcsUnregisterProcessCallback.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}

View File

@ -0,0 +1,51 @@
package hcserror
import (
"fmt"
"syscall"
)
const ERROR_GEN_FAILURE = syscall.Errno(31)
type HcsError struct {
title string
rest string
Err error
}
func (e *HcsError) Error() string {
s := e.title
if len(s) > 0 && s[len(s)-1] != ' ' {
s += " "
}
s += fmt.Sprintf("failed in Win32: %s (0x%x)", e.Err, Win32FromError(e.Err))
if e.rest != "" {
if e.rest[0] != ' ' {
s += " "
}
s += e.rest
}
return s
}
func New(err error, title, rest string) error {
// Pass through DLL errors directly since they do not originate from HCS.
if _, ok := err.(*syscall.DLLError); ok {
return err
}
return &HcsError{title, rest, err}
}
func Errorf(err error, title, format string, a ...interface{}) error {
return New(err, title, fmt.Sprintf(format, a...))
}
func Win32FromError(err error) uint32 {
if herr, ok := err.(*HcsError); ok {
return Win32FromError(herr.Err)
}
if code, ok := err.(syscall.Errno); ok {
return uint32(code)
}
return uint32(ERROR_GEN_FAILURE)
}

View File

@ -0,0 +1,23 @@
package hns
import "fmt"
//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hns.go
//sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall?
type EndpointNotFoundError struct {
EndpointName string
}
func (e EndpointNotFoundError) Error() string {
return fmt.Sprintf("Endpoint %s not found", e.EndpointName)
}
type NetworkNotFoundError struct {
NetworkName string
}
func (e NetworkNotFoundError) Error() string {
return fmt.Sprintf("Network %s not found", e.NetworkName)
}

View File

@ -0,0 +1,260 @@
package hns
import (
"encoding/json"
"net"
"github.com/sirupsen/logrus"
)
// HNSEndpoint represents a network endpoint in HNS
type HNSEndpoint struct {
Id string `json:"ID,omitempty"`
Name string `json:",omitempty"`
VirtualNetwork string `json:",omitempty"`
VirtualNetworkName string `json:",omitempty"`
Policies []json.RawMessage `json:",omitempty"`
MacAddress string `json:",omitempty"`
IPAddress net.IP `json:",omitempty"`
DNSSuffix string `json:",omitempty"`
DNSServerList string `json:",omitempty"`
GatewayAddress string `json:",omitempty"`
EnableInternalDNS bool `json:",omitempty"`
DisableICC bool `json:",omitempty"`
PrefixLength uint8 `json:",omitempty"`
IsRemoteEndpoint bool `json:",omitempty"`
Namespace *Namespace `json:",omitempty"`
}
//SystemType represents the type of the system on which actions are done
type SystemType string
// SystemType const
const (
ContainerType SystemType = "Container"
VirtualMachineType SystemType = "VirtualMachine"
HostType SystemType = "Host"
)
// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system
// Supported resource types are Network and Request Types are Add/Remove
type EndpointAttachDetachRequest struct {
ContainerID string `json:"ContainerId,omitempty"`
SystemType SystemType `json:"SystemType"`
CompartmentID uint16 `json:"CompartmentId,omitempty"`
VirtualNICName string `json:"VirtualNicName,omitempty"`
}
// EndpointResquestResponse is object to get the endpoint request response
type EndpointResquestResponse struct {
Success bool
Error string
}
// HNSEndpointRequest makes a HNS call to modify/query a network endpoint
func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) {
endpoint := &HNSEndpoint{}
err := hnsCall(method, "/endpoints/"+path, request, &endpoint)
if err != nil {
return nil, err
}
return endpoint, nil
}
// HNSListEndpointRequest makes a HNS call to query the list of available endpoints
func HNSListEndpointRequest() ([]HNSEndpoint, error) {
var endpoint []HNSEndpoint
err := hnsCall("GET", "/endpoints/", "", &endpoint)
if err != nil {
return nil, err
}
return endpoint, nil
}
// GetHNSEndpointByID get the Endpoint by ID
func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) {
return HNSEndpointRequest("GET", endpointID, "")
}
// GetHNSEndpointByName gets the endpoint filtered by Name
func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {
hnsResponse, err := HNSListEndpointRequest()
if err != nil {
return nil, err
}
for _, hnsEndpoint := range hnsResponse {
if hnsEndpoint.Name == endpointName {
return &hnsEndpoint, nil
}
}
return nil, EndpointNotFoundError{EndpointName: endpointName}
}
// Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods
func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) {
operation := "Create"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
jsonString, err := json.Marshal(endpoint)
if err != nil {
return nil, err
}
return HNSEndpointRequest("POST", "", string(jsonString))
}
// Delete Endpoint by sending EndpointRequest to HNS
func (endpoint *HNSEndpoint) Delete() (*HNSEndpoint, error) {
operation := "Delete"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
return HNSEndpointRequest("DELETE", endpoint.Id, "")
}
// Update Endpoint
func (endpoint *HNSEndpoint) Update() (*HNSEndpoint, error) {
operation := "Update"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
jsonString, err := json.Marshal(endpoint)
if err != nil {
return nil, err
}
err = hnsCall("POST", "/endpoints/"+endpoint.Id, string(jsonString), &endpoint)
return endpoint, err
}
// ApplyACLPolicy applies a set of ACL Policies on the Endpoint
func (endpoint *HNSEndpoint) ApplyACLPolicy(policies ...*ACLPolicy) error {
operation := "ApplyACLPolicy"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
for _, policy := range policies {
if policy == nil {
continue
}
jsonString, err := json.Marshal(policy)
if err != nil {
return err
}
endpoint.Policies = append(endpoint.Policies, jsonString)
}
_, err := endpoint.Update()
return err
}
// ContainerAttach attaches an endpoint to container
func (endpoint *HNSEndpoint) ContainerAttach(containerID string, compartmentID uint16) error {
operation := "ContainerAttach"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
ContainerID: containerID,
CompartmentID: compartmentID,
SystemType: ContainerType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
}
// ContainerDetach detaches an endpoint from container
func (endpoint *HNSEndpoint) ContainerDetach(containerID string) error {
operation := "ContainerDetach"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
ContainerID: containerID,
SystemType: ContainerType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
}
// HostAttach attaches a nic on the host
func (endpoint *HNSEndpoint) HostAttach(compartmentID uint16) error {
operation := "HostAttach"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
CompartmentID: compartmentID,
SystemType: HostType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
}
// HostDetach detaches a nic on the host
func (endpoint *HNSEndpoint) HostDetach() error {
operation := "HostDetach"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
SystemType: HostType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
}
// VirtualMachineNICAttach attaches a endpoint to a virtual machine
func (endpoint *HNSEndpoint) VirtualMachineNICAttach(virtualMachineNICName string) error {
operation := "VirtualMachineNicAttach"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
VirtualNICName: virtualMachineNICName,
SystemType: VirtualMachineType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
}
// VirtualMachineNICDetach detaches a endpoint from a virtual machine
func (endpoint *HNSEndpoint) VirtualMachineNICDetach() error {
operation := "VirtualMachineNicDetach"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
SystemType: VirtualMachineType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
}

View File

@ -1,9 +1,11 @@
package hcsshim
package hns
import (
"encoding/json"
"fmt"
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/Microsoft/hcsshim/internal/interop"
"github.com/sirupsen/logrus"
)
@ -13,9 +15,9 @@ func hnsCall(method, path, request string, returnResponse interface{}) error {
err := _hnsCall(method, path, request, &responseBuffer)
if err != nil {
return makeError(err, "hnsCall ", "")
return hcserror.New(err, "hnsCall ", "")
}
response := convertAndFreeCoTaskMemString(responseBuffer)
response := interop.ConvertAndFreeCoTaskMemString(responseBuffer)
hnsresponse := &hnsResponse{}
if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil {

View File

@ -0,0 +1,28 @@
package hns
type HNSGlobals struct {
Version HNSVersion `json:"Version"`
}
type HNSVersion struct {
Major int `json:"Major"`
Minor int `json:"Minor"`
}
var (
HNSVersion1803 = HNSVersion{Major: 7, Minor: 2}
)
func GetHNSGlobals() (*HNSGlobals, error) {
var version HNSVersion
err := hnsCall("GET", "/globals/version", "", &version)
if err != nil {
return nil, err
}
globals := &HNSGlobals{
Version: version,
}
return globals, nil
}

View File

@ -0,0 +1,141 @@
package hns
import (
"encoding/json"
"net"
"github.com/sirupsen/logrus"
)
// Subnet is assoicated with a network and represents a list
// of subnets available to the network
type Subnet struct {
AddressPrefix string `json:",omitempty"`
GatewayAddress string `json:",omitempty"`
Policies []json.RawMessage `json:",omitempty"`
}
// MacPool is assoicated with a network and represents a list
// of macaddresses available to the network
type MacPool struct {
StartMacAddress string `json:",omitempty"`
EndMacAddress string `json:",omitempty"`
}
// HNSNetwork represents a network in HNS
type HNSNetwork struct {
Id string `json:"ID,omitempty"`
Name string `json:",omitempty"`
Type string `json:",omitempty"`
NetworkAdapterName string `json:",omitempty"`
SourceMac string `json:",omitempty"`
Policies []json.RawMessage `json:",omitempty"`
MacPools []MacPool `json:",omitempty"`
Subnets []Subnet `json:",omitempty"`
DNSSuffix string `json:",omitempty"`
DNSServerList string `json:",omitempty"`
DNSServerCompartment uint32 `json:",omitempty"`
ManagementIP string `json:",omitempty"`
AutomaticDNS bool `json:",omitempty"`
}
type hnsNetworkResponse struct {
Success bool
Error string
Output HNSNetwork
}
type hnsResponse struct {
Success bool
Error string
Output json.RawMessage
}
// HNSNetworkRequest makes a call into HNS to update/query a single network
func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) {
var network HNSNetwork
err := hnsCall(method, "/networks/"+path, request, &network)
if err != nil {
return nil, err
}
return &network, nil
}
// HNSListNetworkRequest makes a HNS call to query the list of available networks
func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) {
var network []HNSNetwork
err := hnsCall(method, "/networks/"+path, request, &network)
if err != nil {
return nil, err
}
return network, nil
}
// GetHNSNetworkByID
func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) {
return HNSNetworkRequest("GET", networkID, "")
}
// GetHNSNetworkName filtered by Name
func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) {
hsnnetworks, err := HNSListNetworkRequest("GET", "", "")
if err != nil {
return nil, err
}
for _, hnsnetwork := range hsnnetworks {
if hnsnetwork.Name == networkName {
return &hnsnetwork, nil
}
}
return nil, NetworkNotFoundError{NetworkName: networkName}
}
// Create Network by sending NetworkRequest to HNS.
func (network *HNSNetwork) Create() (*HNSNetwork, error) {
operation := "Create"
title := "hcsshim::HNSNetwork::" + operation
logrus.Debugf(title+" id=%s", network.Id)
jsonString, err := json.Marshal(network)
if err != nil {
return nil, err
}
return HNSNetworkRequest("POST", "", string(jsonString))
}
// Delete Network by sending NetworkRequest to HNS
func (network *HNSNetwork) Delete() (*HNSNetwork, error) {
operation := "Delete"
title := "hcsshim::HNSNetwork::" + operation
logrus.Debugf(title+" id=%s", network.Id)
return HNSNetworkRequest("DELETE", network.Id, "")
}
// Creates an endpoint on the Network.
func (network *HNSNetwork) NewEndpoint(ipAddress net.IP, macAddress net.HardwareAddr) *HNSEndpoint {
return &HNSEndpoint{
VirtualNetwork: network.Id,
IPAddress: ipAddress,
MacAddress: string(macAddress),
}
}
func (network *HNSNetwork) CreateEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
operation := "CreateEndpoint"
title := "hcsshim::HNSNetwork::" + operation
logrus.Debugf(title+" id=%s, endpointId=%s", network.Id, endpoint.Id)
endpoint.VirtualNetwork = network.Id
return endpoint.Create()
}
func (network *HNSNetwork) CreateRemoteEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
operation := "CreateRemoteEndpoint"
title := "hcsshim::HNSNetwork::" + operation
logrus.Debugf(title+" id=%s", network.Id)
endpoint.IsRemoteEndpoint = true
return network.CreateEndpoint(endpoint)
}

View File

@ -0,0 +1,98 @@
package hns
// Type of Request Support in ModifySystem
type PolicyType string
// RequestType const
const (
Nat PolicyType = "NAT"
ACL PolicyType = "ACL"
PA PolicyType = "PA"
VLAN PolicyType = "VLAN"
VSID PolicyType = "VSID"
VNet PolicyType = "VNET"
L2Driver PolicyType = "L2Driver"
Isolation PolicyType = "Isolation"
QOS PolicyType = "QOS"
OutboundNat PolicyType = "OutBoundNAT"
ExternalLoadBalancer PolicyType = "ELB"
Route PolicyType = "ROUTE"
)
type NatPolicy struct {
Type PolicyType `json:"Type"`
Protocol string
InternalPort uint16
ExternalPort uint16
}
type QosPolicy struct {
Type PolicyType `json:"Type"`
MaximumOutgoingBandwidthInBytes uint64
}
type IsolationPolicy struct {
Type PolicyType `json:"Type"`
VLAN uint
VSID uint
InDefaultIsolation bool
}
type VlanPolicy struct {
Type PolicyType `json:"Type"`
VLAN uint
}
type VsidPolicy struct {
Type PolicyType `json:"Type"`
VSID uint
}
type PaPolicy struct {
Type PolicyType `json:"Type"`
PA string `json:"PA"`
}
type OutboundNatPolicy struct {
Policy
VIP string `json:"VIP,omitempty"`
Exceptions []string `json:"ExceptionList,omitempty"`
}
type ActionType string
type DirectionType string
type RuleType string
const (
Allow ActionType = "Allow"
Block ActionType = "Block"
In DirectionType = "In"
Out DirectionType = "Out"
Host RuleType = "Host"
Switch RuleType = "Switch"
)
type ACLPolicy struct {
Type PolicyType `json:"Type"`
Id string `json:"Id,omitempty"`
Protocol uint16
Protocols string `json:"Protocols,omitempty"`
InternalPort uint16
Action ActionType
Direction DirectionType
LocalAddresses string
RemoteAddresses string
LocalPorts string `json:"LocalPorts,omitempty"`
LocalPort uint16
RemotePorts string `json:"RemotePorts,omitempty"`
RemotePort uint16
RuleType RuleType `json:"RuleType,omitempty"`
Priority uint16
ServiceName string
}
type Policy struct {
Type PolicyType `json:"Type"`
}

View File

@ -0,0 +1,200 @@
package hns
import (
"encoding/json"
"github.com/sirupsen/logrus"
)
// RoutePolicy is a structure defining schema for Route based Policy
type RoutePolicy struct {
Policy
DestinationPrefix string `json:"DestinationPrefix,omitempty"`
NextHop string `json:"NextHop,omitempty"`
EncapEnabled bool `json:"NeedEncap,omitempty"`
}
// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy
type ELBPolicy struct {
LBPolicy
SourceVIP string `json:"SourceVIP,omitempty"`
VIPs []string `json:"VIPs,omitempty"`
ILB bool `json:"ILB,omitempty"`
}
// LBPolicy is a structure defining schema for LoadBalancing based Policy
type LBPolicy struct {
Policy
Protocol uint16 `json:"Protocol,omitempty"`
InternalPort uint16
ExternalPort uint16
}
// PolicyList is a structure defining schema for Policy list request
type PolicyList struct {
ID string `json:"ID,omitempty"`
EndpointReferences []string `json:"References,omitempty"`
Policies []json.RawMessage `json:"Policies,omitempty"`
}
// HNSPolicyListRequest makes a call into HNS to update/query a single network
func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) {
var policy PolicyList
err := hnsCall(method, "/policylists/"+path, request, &policy)
if err != nil {
return nil, err
}
return &policy, nil
}
// HNSListPolicyListRequest gets all the policy list
func HNSListPolicyListRequest() ([]PolicyList, error) {
var plist []PolicyList
err := hnsCall("GET", "/policylists/", "", &plist)
if err != nil {
return nil, err
}
return plist, nil
}
// PolicyListRequest makes a HNS call to modify/query a network policy list
func PolicyListRequest(method, path, request string) (*PolicyList, error) {
policylist := &PolicyList{}
err := hnsCall(method, "/policylists/"+path, request, &policylist)
if err != nil {
return nil, err
}
return policylist, nil
}
// GetPolicyListByID get the policy list by ID
func GetPolicyListByID(policyListID string) (*PolicyList, error) {
return PolicyListRequest("GET", policyListID, "")
}
// Create PolicyList by sending PolicyListRequest to HNS.
func (policylist *PolicyList) Create() (*PolicyList, error) {
operation := "Create"
title := "hcsshim::PolicyList::" + operation
logrus.Debugf(title+" id=%s", policylist.ID)
jsonString, err := json.Marshal(policylist)
if err != nil {
return nil, err
}
return PolicyListRequest("POST", "", string(jsonString))
}
// Delete deletes PolicyList
func (policylist *PolicyList) Delete() (*PolicyList, error) {
operation := "Delete"
title := "hcsshim::PolicyList::" + operation
logrus.Debugf(title+" id=%s", policylist.ID)
return PolicyListRequest("DELETE", policylist.ID, "")
}
// AddEndpoint add an endpoint to a Policy List
func (policylist *PolicyList) AddEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
operation := "AddEndpoint"
title := "hcsshim::PolicyList::" + operation
logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
_, err := policylist.Delete()
if err != nil {
return nil, err
}
// Add Endpoint to the Existing List
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
return policylist.Create()
}
// RemoveEndpoint removes an endpoint from the Policy List
func (policylist *PolicyList) RemoveEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
operation := "RemoveEndpoint"
title := "hcsshim::PolicyList::" + operation
logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
_, err := policylist.Delete()
if err != nil {
return nil, err
}
elementToRemove := "/endpoints/" + endpoint.Id
var references []string
for _, endpointReference := range policylist.EndpointReferences {
if endpointReference == elementToRemove {
continue
}
references = append(references, endpointReference)
}
policylist.EndpointReferences = references
return policylist.Create()
}
// AddLoadBalancer policy list for the specified endpoints
func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) {
operation := "AddLoadBalancer"
title := "hcsshim::PolicyList::" + operation
logrus.Debugf(title+" endpointId=%v, isILB=%v, sourceVIP=%s, vip=%s, protocol=%v, internalPort=%v, externalPort=%v", endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort)
policylist := &PolicyList{}
elbPolicy := &ELBPolicy{
SourceVIP: sourceVIP,
ILB: isILB,
}
if len(vip) > 0 {
elbPolicy.VIPs = []string{vip}
}
elbPolicy.Type = ExternalLoadBalancer
elbPolicy.Protocol = protocol
elbPolicy.InternalPort = internalPort
elbPolicy.ExternalPort = externalPort
for _, endpoint := range endpoints {
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
}
jsonString, err := json.Marshal(elbPolicy)
if err != nil {
return nil, err
}
policylist.Policies = append(policylist.Policies, jsonString)
return policylist.Create()
}
// AddRoute adds route policy list for the specified endpoints
func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) {
operation := "AddRoute"
title := "hcsshim::PolicyList::" + operation
logrus.Debugf(title+" destinationPrefix:%s", destinationPrefix)
policylist := &PolicyList{}
rPolicy := &RoutePolicy{
DestinationPrefix: destinationPrefix,
NextHop: nextHop,
EncapEnabled: encapEnabled,
}
rPolicy.Type = Route
for _, endpoint := range endpoints {
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
}
jsonString, err := json.Marshal(rPolicy)
if err != nil {
return nil, err
}
policylist.Policies = append(policylist.Policies, jsonString)
return policylist.Create()
}

View File

@ -0,0 +1,49 @@
package hns
import (
"github.com/sirupsen/logrus"
)
type HNSSupportedFeatures struct {
Acl HNSAclFeatures `json:"ACL"`
}
type HNSAclFeatures struct {
AclAddressLists bool `json:"AclAddressLists"`
AclNoHostRulePriority bool `json:"AclHostRulePriority"`
AclPortRanges bool `json:"AclPortRanges"`
AclRuleId bool `json:"AclRuleId"`
}
func GetHNSSupportedFeatures() HNSSupportedFeatures {
var hnsFeatures HNSSupportedFeatures
globals, err := GetHNSGlobals()
if err != nil {
// Expected on pre-1803 builds, all features will be false/unsupported
logrus.Debugf("Unable to obtain HNS globals: %s", err)
return hnsFeatures
}
hnsFeatures.Acl = HNSAclFeatures{
AclAddressLists: isHNSFeatureSupported(globals.Version, HNSVersion1803),
AclNoHostRulePriority: isHNSFeatureSupported(globals.Version, HNSVersion1803),
AclPortRanges: isHNSFeatureSupported(globals.Version, HNSVersion1803),
AclRuleId: isHNSFeatureSupported(globals.Version, HNSVersion1803),
}
return hnsFeatures
}
func isHNSFeatureSupported(currentVersion HNSVersion, minVersionSupported HNSVersion) bool {
if currentVersion.Major < minVersionSupported.Major {
return false
}
if currentVersion.Major > minVersionSupported.Major {
return true
}
if currentVersion.Minor < minVersionSupported.Minor {
return false
}
return true
}

View File

@ -0,0 +1,110 @@
package hns
import (
"encoding/json"
"fmt"
"os"
"path"
"strings"
)
type namespaceRequest struct {
IsDefault bool `json:",omitempty"`
}
type namespaceEndpointRequest struct {
ID string `json:"Id"`
}
type NamespaceResource struct {
Type string
Data json.RawMessage
}
type namespaceResourceRequest struct {
Type string
Data interface{}
}
type Namespace struct {
ID string
IsDefault bool `json:",omitempty"`
ResourceList []NamespaceResource `json:",omitempty"`
}
func issueNamespaceRequest(id *string, method, subpath string, request interface{}) (*Namespace, error) {
var err error
hnspath := "/namespaces/"
if id != nil {
hnspath = path.Join(hnspath, *id)
}
if subpath != "" {
hnspath = path.Join(hnspath, subpath)
}
var reqJSON []byte
if request != nil {
if reqJSON, err = json.Marshal(request); err != nil {
return nil, err
}
}
var ns Namespace
err = hnsCall(method, hnspath, string(reqJSON), &ns)
if err != nil {
if strings.Contains(err.Error(), "Element not found.") {
return nil, os.ErrNotExist
}
return nil, fmt.Errorf("%s %s: %s", method, hnspath, err)
}
return &ns, err
}
func CreateNamespace() (string, error) {
req := namespaceRequest{}
ns, err := issueNamespaceRequest(nil, "POST", "", &req)
if err != nil {
return "", err
}
return ns.ID, nil
}
func RemoveNamespace(id string) error {
_, err := issueNamespaceRequest(&id, "DELETE", "", nil)
return err
}
func GetNamespaceEndpoints(id string) ([]string, error) {
ns, err := issueNamespaceRequest(&id, "GET", "", nil)
if err != nil {
return nil, err
}
var endpoints []string
for _, rsrc := range ns.ResourceList {
if rsrc.Type == "Endpoint" {
var endpoint namespaceEndpointRequest
err = json.Unmarshal(rsrc.Data, &endpoint)
if err != nil {
return nil, fmt.Errorf("unmarshal endpoint: %s", err)
}
endpoints = append(endpoints, endpoint.ID)
}
}
return endpoints, nil
}
func AddNamespaceEndpoint(id string, endpointID string) error {
resource := namespaceResourceRequest{
Type: "Endpoint",
Data: namespaceEndpointRequest{endpointID},
}
_, err := issueNamespaceRequest(&id, "POST", "addresource", &resource)
return err
}
func RemoveNamespaceEndpoint(id string, endpointID string) error {
resource := namespaceResourceRequest{
Type: "Endpoint",
Data: namespaceEndpointRequest{endpointID},
}
_, err := issueNamespaceRequest(&id, "POST", "removeresource", &resource)
return err
}

View File

@ -0,0 +1,74 @@
// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT
package hns
import (
"syscall"
"unsafe"
"github.com/Microsoft/hcsshim/internal/interop"
"golang.org/x/sys/windows"
)
var _ unsafe.Pointer
// Do the interface allocations only once for common
// Errno values.
const (
errnoERROR_IO_PENDING = 997
)
var (
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
)
// errnoErr returns common boxed Errno values, to prevent
// allocations at runtime.
func errnoErr(e syscall.Errno) error {
switch e {
case 0:
return nil
case errnoERROR_IO_PENDING:
return errERROR_IO_PENDING
}
// TODO: add more here, after collecting data on the common
// error values see on Windows. (perhaps when running
// all.bat?)
return e
}
var (
modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
procHNSCall = modvmcompute.NewProc("HNSCall")
)
func _hnsCall(method string, path string, object string, response **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(method)
if hr != nil {
return
}
var _p1 *uint16
_p1, hr = syscall.UTF16PtrFromString(path)
if hr != nil {
return
}
var _p2 *uint16
_p2, hr = syscall.UTF16PtrFromString(object)
if hr != nil {
return
}
return __hnsCall(_p0, _p1, _p2, response)
}
func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) (hr error) {
if hr = procHNSCall.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHNSCall.Addr(), 4, uintptr(unsafe.Pointer(method)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(object)), uintptr(unsafe.Pointer(response)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}

View File

@ -0,0 +1,27 @@
package interop
import (
"syscall"
"unsafe"
)
//go:generate go run $GOROOT/src/syscall/mksyscall_windows.go -output zsyscall_windows.go interop.go
//sys coTaskMemFree(buffer unsafe.Pointer) = ole32.CoTaskMemFree
func ConvertAndFreeCoTaskMemString(buffer *uint16) string {
str := syscall.UTF16ToString((*[1 << 29]uint16)(unsafe.Pointer(buffer))[:])
coTaskMemFree(unsafe.Pointer(buffer))
return str
}
func ConvertAndFreeCoTaskMemBytes(buffer *uint16) []byte {
return []byte(ConvertAndFreeCoTaskMemString(buffer))
}
func Win32FromHresult(hr uintptr) syscall.Errno {
if hr&0x1fff0000 == 0x00070000 {
return syscall.Errno(hr & 0xffff)
}
return syscall.Errno(hr)
}

View File

@ -0,0 +1,48 @@
// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT
package interop
import (
"syscall"
"unsafe"
"golang.org/x/sys/windows"
)
var _ unsafe.Pointer
// Do the interface allocations only once for common
// Errno values.
const (
errnoERROR_IO_PENDING = 997
)
var (
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
)
// errnoErr returns common boxed Errno values, to prevent
// allocations at runtime.
func errnoErr(e syscall.Errno) error {
switch e {
case 0:
return nil
case errnoERROR_IO_PENDING:
return errERROR_IO_PENDING
}
// TODO: add more here, after collecting data on the common
// error values see on Windows. (perhaps when running
// all.bat?)
return e
}
var (
modole32 = windows.NewLazySystemDLL("ole32.dll")
procCoTaskMemFree = modole32.NewProc("CoTaskMemFree")
)
func coTaskMemFree(buffer unsafe.Pointer) {
syscall.Syscall(procCoTaskMemFree.Addr(), 1, uintptr(buffer), 0, 0)
return
}

View File

@ -0,0 +1,24 @@
package longpath
import (
"path/filepath"
"strings"
)
// LongAbs makes a path absolute and returns it in NT long path form.
func LongAbs(path string) (string, error) {
if strings.HasPrefix(path, `\\?\`) || strings.HasPrefix(path, `\\.\`) {
return path, nil
}
if !filepath.IsAbs(path) {
absPath, err := filepath.Abs(path)
if err != nil {
return "", err
}
path = absPath
}
if strings.HasPrefix(path, `\\`) {
return `\\?\UNC\` + path[2:], nil
}
return `\\?\` + path, nil
}

View File

@ -0,0 +1,52 @@
package mergemaps
import "encoding/json"
// Merge recursively merges map `fromMap` into map `ToMap`. Any pre-existing values
// in ToMap are overwritten. Values in fromMap are added to ToMap.
// From http://stackoverflow.com/questions/40491438/merging-two-json-strings-in-golang
func Merge(fromMap, ToMap interface{}) interface{} {
switch fromMap := fromMap.(type) {
case map[string]interface{}:
ToMap, ok := ToMap.(map[string]interface{})
if !ok {
return fromMap
}
for keyToMap, valueToMap := range ToMap {
if valueFromMap, ok := fromMap[keyToMap]; ok {
fromMap[keyToMap] = Merge(valueFromMap, valueToMap)
} else {
fromMap[keyToMap] = valueToMap
}
}
case nil:
// merge(nil, map[string]interface{...}) -> map[string]interface{...}
ToMap, ok := ToMap.(map[string]interface{})
if ok {
return ToMap
}
}
return fromMap
}
// MergeJSON merges the contents of a JSON string into an object representation,
// returning a new object suitable for translating to JSON.
func MergeJSON(object interface{}, additionalJSON []byte) (interface{}, error) {
if len(additionalJSON) == 0 {
return object, nil
}
objectJSON, err := json.Marshal(object)
if err != nil {
return nil, err
}
var objectMap, newMap map[string]interface{}
err = json.Unmarshal(objectJSON, &objectMap)
if err != nil {
return nil, err
}
err = json.Unmarshal(additionalJSON, &newMap)
if err != nil {
return nil, err
}
return Merge(newMap, objectMap), nil
}

View File

@ -1,4 +1,4 @@
package hcsshim
package safefile
import (
"errors"
@ -10,9 +10,13 @@ import (
"unicode/utf16"
"unsafe"
"github.com/Microsoft/hcsshim/internal/longpath"
winio "github.com/Microsoft/go-winio"
)
//go:generate go run $GOROOT\src\syscall\mksyscall_windows.go -output zsyscall_windows.go safeopen.go
//sys ntCreateFile(handle *uintptr, accessMask uint32, oa *objectAttributes, iosb *ioStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) = ntdll.NtCreateFile
//sys ntSetInformationFile(handle uintptr, iosb *ioStatusBlock, information uintptr, length uint32, class uint32) (status uint32) = ntdll.NtSetInformationFile
//sys rtlNtStatusToDosError(status uint32) (winerr error) = ntdll.RtlNtStatusToDosErrorNoTeb
@ -53,28 +57,28 @@ const (
_FileLinkInformation = 11
_FileDispositionInformationEx = 64
_FILE_READ_ATTRIBUTES = 0x0080
_FILE_WRITE_ATTRIBUTES = 0x0100
_DELETE = 0x10000
FILE_READ_ATTRIBUTES = 0x0080
FILE_WRITE_ATTRIBUTES = 0x0100
DELETE = 0x10000
_FILE_OPEN = 1
_FILE_CREATE = 2
FILE_OPEN = 1
FILE_CREATE = 2
_FILE_DIRECTORY_FILE = 0x00000001
_FILE_SYNCHRONOUS_IO_NONALERT = 0x00000020
_FILE_DELETE_ON_CLOSE = 0x00001000
_FILE_OPEN_FOR_BACKUP_INTENT = 0x00004000
_FILE_OPEN_REPARSE_POINT = 0x00200000
FILE_DIRECTORY_FILE = 0x00000001
FILE_SYNCHRONOUS_IO_NONALERT = 0x00000020
FILE_DELETE_ON_CLOSE = 0x00001000
FILE_OPEN_FOR_BACKUP_INTENT = 0x00004000
FILE_OPEN_REPARSE_POINT = 0x00200000
_FILE_DISPOSITION_DELETE = 0x00000001
FILE_DISPOSITION_DELETE = 0x00000001
_OBJ_DONT_REPARSE = 0x1000
_STATUS_REPARSE_POINT_ENCOUNTERED = 0xC000050B
)
func openRoot(path string) (*os.File, error) {
longpath, err := makeLongAbsPath(path)
func OpenRoot(path string) (*os.File, error) {
longpath, err := longpath.LongAbs(path)
if err != nil {
return nil, err
}
@ -141,7 +145,7 @@ func openRelativeInternal(path string, root *os.File, accessMask uint32, shareFl
0,
shareFlags,
createDisposition,
_FILE_OPEN_FOR_BACKUP_INTENT|_FILE_SYNCHRONOUS_IO_NONALERT|flags,
FILE_OPEN_FOR_BACKUP_INTENT|FILE_SYNCHRONOUS_IO_NONALERT|flags,
nil,
0,
)
@ -149,7 +153,7 @@ func openRelativeInternal(path string, root *os.File, accessMask uint32, shareFl
return nil, rtlNtStatusToDosError(status)
}
fullPath, err := makeLongAbsPath(filepath.Join(root.Name(), path))
fullPath, err := longpath.LongAbs(filepath.Join(root.Name(), path))
if err != nil {
syscall.Close(syscall.Handle(h))
return nil, err
@ -158,9 +162,9 @@ func openRelativeInternal(path string, root *os.File, accessMask uint32, shareFl
return os.NewFile(h, fullPath), nil
}
// openRelative opens a relative path from the given root, failing if
// OpenRelative opens a relative path from the given root, failing if
// any of the intermediate path components are reparse points.
func openRelative(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) {
func OpenRelative(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) {
f, err := openRelativeInternal(path, root, accessMask, shareFlags, createDisposition, flags)
if err != nil {
err = &os.PathError{Op: "open", Path: filepath.Join(root.Name(), path), Err: err}
@ -168,17 +172,17 @@ func openRelative(path string, root *os.File, accessMask uint32, shareFlags uint
return f, err
}
// linkRelative creates a hard link from oldname to newname (relative to oldroot
// LinkRelative creates a hard link from oldname to newname (relative to oldroot
// and newroot), failing if any of the intermediate path components are reparse
// points.
func linkRelative(oldname string, oldroot *os.File, newname string, newroot *os.File) error {
func LinkRelative(oldname string, oldroot *os.File, newname string, newroot *os.File) error {
// Open the old file.
oldf, err := openRelativeInternal(
oldname,
oldroot,
syscall.FILE_WRITE_ATTRIBUTES,
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
_FILE_OPEN,
FILE_OPEN,
0,
)
if err != nil {
@ -195,8 +199,8 @@ func linkRelative(oldname string, oldroot *os.File, newname string, newroot *os.
newroot,
syscall.GENERIC_READ,
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
_FILE_OPEN,
_FILE_DIRECTORY_FILE)
FILE_OPEN,
FILE_DIRECTORY_FILE)
if err != nil {
return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: err}
}
@ -248,7 +252,7 @@ func linkRelative(oldname string, oldroot *os.File, newname string, newroot *os.
// deleteOnClose marks a file to be deleted when the handle is closed.
func deleteOnClose(f *os.File) error {
disposition := fileDispositionInformationEx{Flags: _FILE_DISPOSITION_DELETE}
disposition := fileDispositionInformationEx{Flags: FILE_DISPOSITION_DELETE}
var iosb ioStatusBlock
status := ntSetInformationFile(
f.Fd(),
@ -281,16 +285,16 @@ func clearReadOnly(f *os.File) error {
return winio.SetFileBasicInfo(f, &sbi)
}
// removeRelative removes a file or directory relative to a root, failing if any
// RemoveRelative removes a file or directory relative to a root, failing if any
// intermediate path components are reparse points.
func removeRelative(path string, root *os.File) error {
func RemoveRelative(path string, root *os.File) error {
f, err := openRelativeInternal(
path,
root,
_FILE_READ_ATTRIBUTES|_FILE_WRITE_ATTRIBUTES|_DELETE,
FILE_READ_ATTRIBUTES|FILE_WRITE_ATTRIBUTES|DELETE,
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
_FILE_OPEN,
_FILE_OPEN_REPARSE_POINT)
FILE_OPEN,
FILE_OPEN_REPARSE_POINT)
if err == nil {
defer f.Close()
err = deleteOnClose(f)
@ -306,10 +310,10 @@ func removeRelative(path string, root *os.File) error {
return nil
}
// removeAllRelative removes a directory tree relative to a root, failing if any
// RemoveAllRelative removes a directory tree relative to a root, failing if any
// intermediate path components are reparse points.
func removeAllRelative(path string, root *os.File) error {
fi, err := lstatRelative(path, root)
func RemoveAllRelative(path string, root *os.File) error {
fi, err := LstatRelative(path, root)
if err != nil {
if os.IsNotExist(err) {
return nil
@ -319,7 +323,7 @@ func removeAllRelative(path string, root *os.File) error {
fileAttributes := fi.Sys().(*syscall.Win32FileAttributeData).FileAttributes
if fileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY == 0 || fileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT != 0 {
// If this is a reparse point, it can't have children. Simple remove will do.
err := removeRelative(path, root)
err := RemoveRelative(path, root)
if err == nil || os.IsNotExist(err) {
return nil
}
@ -327,7 +331,7 @@ func removeAllRelative(path string, root *os.File) error {
}
// It is necessary to use os.Open as Readdirnames does not work with
// openRelative. This is safe because the above lstatrelative fails
// OpenRelative. This is safe because the above lstatrelative fails
// if the target is outside the root, and we know this is not a
// symlink from the above FILE_ATTRIBUTE_REPARSE_POINT check.
fd, err := os.Open(filepath.Join(root.Name(), path))
@ -344,7 +348,7 @@ func removeAllRelative(path string, root *os.File) error {
for {
names, err1 := fd.Readdirnames(100)
for _, name := range names {
err1 := removeAllRelative(path+string(os.PathSeparator)+name, root)
err1 := RemoveAllRelative(path+string(os.PathSeparator)+name, root)
if err == nil {
err = err1
}
@ -363,7 +367,7 @@ func removeAllRelative(path string, root *os.File) error {
fd.Close()
// Remove directory.
err1 := removeRelative(path, root)
err1 := RemoveRelative(path, root)
if err1 == nil || os.IsNotExist(err1) {
return nil
}
@ -373,16 +377,16 @@ func removeAllRelative(path string, root *os.File) error {
return err
}
// mkdirRelative creates a directory relative to a root, failing if any
// MkdirRelative creates a directory relative to a root, failing if any
// intermediate path components are reparse points.
func mkdirRelative(path string, root *os.File) error {
func MkdirRelative(path string, root *os.File) error {
f, err := openRelativeInternal(
path,
root,
0,
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
_FILE_CREATE,
_FILE_DIRECTORY_FILE)
FILE_CREATE,
FILE_DIRECTORY_FILE)
if err == nil {
f.Close()
} else {
@ -391,16 +395,16 @@ func mkdirRelative(path string, root *os.File) error {
return err
}
// lstatRelative performs a stat operation on a file relative to a root, failing
// LstatRelative performs a stat operation on a file relative to a root, failing
// if any intermediate path components are reparse points.
func lstatRelative(path string, root *os.File) (os.FileInfo, error) {
func LstatRelative(path string, root *os.File) (os.FileInfo, error) {
f, err := openRelativeInternal(
path,
root,
_FILE_READ_ATTRIBUTES,
FILE_READ_ATTRIBUTES,
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
_FILE_OPEN,
_FILE_OPEN_REPARSE_POINT)
FILE_OPEN,
FILE_OPEN_REPARSE_POINT)
if err != nil {
return nil, &os.PathError{Op: "stat", Path: filepath.Join(root.Name(), path), Err: err}
}
@ -408,16 +412,16 @@ func lstatRelative(path string, root *os.File) (os.FileInfo, error) {
return f.Stat()
}
// ensureNotReparsePointRelative validates that a given file (relative to a
// EnsureNotReparsePointRelative validates that a given file (relative to a
// root) and all intermediate path components are not a reparse points.
func ensureNotReparsePointRelative(path string, root *os.File) error {
func EnsureNotReparsePointRelative(path string, root *os.File) error {
// Perform an open with OBJ_DONT_REPARSE but without specifying FILE_OPEN_REPARSE_POINT.
f, err := openRelative(
f, err := OpenRelative(
path,
root,
0,
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
_FILE_OPEN,
FILE_OPEN,
0)
if err != nil {
return err

View File

@ -0,0 +1,79 @@
// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT
package safefile
import (
"syscall"
"unsafe"
"golang.org/x/sys/windows"
)
var _ unsafe.Pointer
// Do the interface allocations only once for common
// Errno values.
const (
errnoERROR_IO_PENDING = 997
)
var (
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
)
// errnoErr returns common boxed Errno values, to prevent
// allocations at runtime.
func errnoErr(e syscall.Errno) error {
switch e {
case 0:
return nil
case errnoERROR_IO_PENDING:
return errERROR_IO_PENDING
}
// TODO: add more here, after collecting data on the common
// error values see on Windows. (perhaps when running
// all.bat?)
return e
}
var (
modntdll = windows.NewLazySystemDLL("ntdll.dll")
modkernel32 = windows.NewLazySystemDLL("kernel32.dll")
procNtCreateFile = modntdll.NewProc("NtCreateFile")
procNtSetInformationFile = modntdll.NewProc("NtSetInformationFile")
procRtlNtStatusToDosErrorNoTeb = modntdll.NewProc("RtlNtStatusToDosErrorNoTeb")
procLocalAlloc = modkernel32.NewProc("LocalAlloc")
procLocalFree = modkernel32.NewProc("LocalFree")
)
func ntCreateFile(handle *uintptr, accessMask uint32, oa *objectAttributes, iosb *ioStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) {
r0, _, _ := syscall.Syscall12(procNtCreateFile.Addr(), 11, uintptr(unsafe.Pointer(handle)), uintptr(accessMask), uintptr(unsafe.Pointer(oa)), uintptr(unsafe.Pointer(iosb)), uintptr(unsafe.Pointer(allocationSize)), uintptr(fileAttributes), uintptr(shareAccess), uintptr(createDisposition), uintptr(createOptions), uintptr(unsafe.Pointer(eaBuffer)), uintptr(eaLength), 0)
status = uint32(r0)
return
}
func ntSetInformationFile(handle uintptr, iosb *ioStatusBlock, information uintptr, length uint32, class uint32) (status uint32) {
r0, _, _ := syscall.Syscall6(procNtSetInformationFile.Addr(), 5, uintptr(handle), uintptr(unsafe.Pointer(iosb)), uintptr(information), uintptr(length), uintptr(class), 0)
status = uint32(r0)
return
}
func rtlNtStatusToDosError(status uint32) (winerr error) {
r0, _, _ := syscall.Syscall(procRtlNtStatusToDosErrorNoTeb.Addr(), 1, uintptr(status), 0, 0)
if r0 != 0 {
winerr = syscall.Errno(r0)
}
return
}
func localAlloc(flags uint32, size int) (ptr uintptr) {
r0, _, _ := syscall.Syscall(procLocalAlloc.Addr(), 2, uintptr(flags), uintptr(size), 0)
ptr = uintptr(r0)
return
}
func localFree(ptr uintptr) {
syscall.Syscall(procLocalFree.Addr(), 1, uintptr(ptr), 0, 0)
return
}

View File

@ -0,0 +1,228 @@
package schema1
import (
"encoding/json"
"time"
)
// ProcessConfig is used as both the input of Container.CreateProcess
// and to convert the parameters to JSON for passing onto the HCS
type ProcessConfig struct {
ApplicationName string `json:",omitempty"`
CommandLine string `json:",omitempty"`
CommandArgs []string `json:",omitempty"` // Used by Linux Containers on Windows
User string `json:",omitempty"`
WorkingDirectory string `json:",omitempty"`
Environment map[string]string `json:",omitempty"`
EmulateConsole bool `json:",omitempty"`
CreateStdInPipe bool `json:",omitempty"`
CreateStdOutPipe bool `json:",omitempty"`
CreateStdErrPipe bool `json:",omitempty"`
ConsoleSize [2]uint `json:",omitempty"`
CreateInUtilityVm bool `json:",omitempty"` // Used by Linux Containers on Windows
OCISpecification *json.RawMessage `json:",omitempty"` // Used by Linux Containers on Windows
}
type Layer struct {
ID string
Path string
}
type MappedDir struct {
HostPath string
ContainerPath string
ReadOnly bool
BandwidthMaximum uint64
IOPSMaximum uint64
CreateInUtilityVM bool
// LinuxMetadata - Support added in 1803/RS4+.
LinuxMetadata bool `json:",omitempty"`
}
type MappedPipe struct {
HostPath string
ContainerPipeName string
}
type HvRuntime struct {
ImagePath string `json:",omitempty"`
SkipTemplate bool `json:",omitempty"`
LinuxInitrdFile string `json:",omitempty"` // File under ImagePath on host containing an initrd image for starting a Linux utility VM
LinuxKernelFile string `json:",omitempty"` // File under ImagePath on host containing a kernel for starting a Linux utility VM
LinuxBootParameters string `json:",omitempty"` // Additional boot parameters for starting a Linux Utility VM in initrd mode
BootSource string `json:",omitempty"` // "Vhd" for Linux Utility VM booting from VHD
WritableBootSource bool `json:",omitempty"` // Linux Utility VM booting from VHD
}
type MappedVirtualDisk struct {
HostPath string `json:",omitempty"` // Path to VHD on the host
ContainerPath string // Platform-specific mount point path in the container
CreateInUtilityVM bool `json:",omitempty"`
ReadOnly bool `json:",omitempty"`
Cache string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing"
AttachOnly bool `json:",omitempty:`
}
// AssignedDevice represents a device that has been directly assigned to a container
//
// NOTE: Support added in RS5
type AssignedDevice struct {
// InterfaceClassGUID of the device to assign to container.
InterfaceClassGUID string `json:"InterfaceClassGuid,omitempty"`
}
// ContainerConfig is used as both the input of CreateContainer
// and to convert the parameters to JSON for passing onto the HCS
type ContainerConfig struct {
SystemType string // HCS requires this to be hard-coded to "Container"
Name string // Name of the container. We use the docker ID.
Owner string `json:",omitempty"` // The management platform that created this container
VolumePath string `json:",omitempty"` // Windows volume path for scratch space. Used by Windows Server Containers only. Format \\?\\Volume{GUID}
IgnoreFlushesDuringBoot bool `json:",omitempty"` // Optimization hint for container startup in Windows
LayerFolderPath string `json:",omitempty"` // Where the layer folders are located. Used by Windows Server Containers only. Format %root%\windowsfilter\containerID
Layers []Layer // List of storage layers. Required for Windows Server and Hyper-V Containers. Format ID=GUID;Path=%root%\windowsfilter\layerID
Credentials string `json:",omitempty"` // Credentials information
ProcessorCount uint32 `json:",omitempty"` // Number of processors to assign to the container.
ProcessorWeight uint64 `json:",omitempty"` // CPU shares (relative weight to other containers with cpu shares). Range is from 1 to 10000. A value of 0 results in default shares.
ProcessorMaximum int64 `json:",omitempty"` // Specifies the portion of processor cycles that this container can use as a percentage times 100. Range is from 1 to 10000. A value of 0 results in no limit.
StorageIOPSMaximum uint64 `json:",omitempty"` // Maximum Storage IOPS
StorageBandwidthMaximum uint64 `json:",omitempty"` // Maximum Storage Bandwidth in bytes per second
StorageSandboxSize uint64 `json:",omitempty"` // Size in bytes that the container system drive should be expanded to if smaller
MemoryMaximumInMB int64 `json:",omitempty"` // Maximum memory available to the container in Megabytes
HostName string `json:",omitempty"` // Hostname
MappedDirectories []MappedDir `json:",omitempty"` // List of mapped directories (volumes/mounts)
MappedPipes []MappedPipe `json:",omitempty"` // List of mapped Windows named pipes
HvPartition bool // True if it a Hyper-V Container
NetworkSharedContainerName string `json:",omitempty"` // Name (ID) of the container that we will share the network stack with.
EndpointList []string `json:",omitempty"` // List of networking endpoints to be attached to container
HvRuntime *HvRuntime `json:",omitempty"` // Hyper-V container settings. Used by Hyper-V containers only. Format ImagePath=%root%\BaseLayerID\UtilityVM
Servicing bool `json:",omitempty"` // True if this container is for servicing
AllowUnqualifiedDNSQuery bool `json:",omitempty"` // True to allow unqualified DNS name resolution
DNSSearchList string `json:",omitempty"` // Comma seperated list of DNS suffixes to use for name resolution
ContainerType string `json:",omitempty"` // "Linux" for Linux containers on Windows. Omitted otherwise.
TerminateOnLastHandleClosed bool `json:",omitempty"` // Should HCS terminate the container once all handles have been closed
MappedVirtualDisks []MappedVirtualDisk `json:",omitempty"` // Array of virtual disks to mount at start
AssignedDevices []AssignedDevice `json:",omitempty"` // Array of devices to assign. NOTE: Support added in RS5
}
type ComputeSystemQuery struct {
IDs []string `json:"Ids,omitempty"`
Types []string `json:",omitempty"`
Names []string `json:",omitempty"`
Owners []string `json:",omitempty"`
}
type PropertyType string
const (
PropertyTypeStatistics PropertyType = "Statistics"
PropertyTypeProcessList = "ProcessList"
PropertyTypeMappedVirtualDisk = "MappedVirtualDisk"
)
type PropertyQuery struct {
PropertyTypes []PropertyType `json:",omitempty"`
}
// ContainerProperties holds the properties for a container and the processes running in that container
type ContainerProperties struct {
ID string `json:"Id"`
State string
Name string
SystemType string
Owner string
SiloGUID string `json:"SiloGuid,omitempty"`
RuntimeID string `json:"RuntimeId,omitempty"`
IsRuntimeTemplate bool `json:",omitempty"`
RuntimeImagePath string `json:",omitempty"`
Stopped bool `json:",omitempty"`
ExitType string `json:",omitempty"`
AreUpdatesPending bool `json:",omitempty"`
ObRoot string `json:",omitempty"`
Statistics Statistics `json:",omitempty"`
ProcessList []ProcessListItem `json:",omitempty"`
MappedVirtualDiskControllers map[int]MappedVirtualDiskController `json:",omitempty"`
}
// MemoryStats holds the memory statistics for a container
type MemoryStats struct {
UsageCommitBytes uint64 `json:"MemoryUsageCommitBytes,omitempty"`
UsageCommitPeakBytes uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"`
UsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"`
}
// ProcessorStats holds the processor statistics for a container
type ProcessorStats struct {
TotalRuntime100ns uint64 `json:",omitempty"`
RuntimeUser100ns uint64 `json:",omitempty"`
RuntimeKernel100ns uint64 `json:",omitempty"`
}
// StorageStats holds the storage statistics for a container
type StorageStats struct {
ReadCountNormalized uint64 `json:",omitempty"`
ReadSizeBytes uint64 `json:",omitempty"`
WriteCountNormalized uint64 `json:",omitempty"`
WriteSizeBytes uint64 `json:",omitempty"`
}
// NetworkStats holds the network statistics for a container
type NetworkStats struct {
BytesReceived uint64 `json:",omitempty"`
BytesSent uint64 `json:",omitempty"`
PacketsReceived uint64 `json:",omitempty"`
PacketsSent uint64 `json:",omitempty"`
DroppedPacketsIncoming uint64 `json:",omitempty"`
DroppedPacketsOutgoing uint64 `json:",omitempty"`
EndpointId string `json:",omitempty"`
InstanceId string `json:",omitempty"`
}
// Statistics is the structure returned by a statistics call on a container
type Statistics struct {
Timestamp time.Time `json:",omitempty"`
ContainerStartTime time.Time `json:",omitempty"`
Uptime100ns uint64 `json:",omitempty"`
Memory MemoryStats `json:",omitempty"`
Processor ProcessorStats `json:",omitempty"`
Storage StorageStats `json:",omitempty"`
Network []NetworkStats `json:",omitempty"`
}
// ProcessList is the structure of an item returned by a ProcessList call on a container
type ProcessListItem struct {
CreateTimestamp time.Time `json:",omitempty"`
ImageName string `json:",omitempty"`
KernelTime100ns uint64 `json:",omitempty"`
MemoryCommitBytes uint64 `json:",omitempty"`
MemoryWorkingSetPrivateBytes uint64 `json:",omitempty"`
MemoryWorkingSetSharedBytes uint64 `json:",omitempty"`
ProcessId uint32 `json:",omitempty"`
UserTime100ns uint64 `json:",omitempty"`
}
// MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container
type MappedVirtualDiskController struct {
MappedVirtualDisks map[int]MappedVirtualDisk `json:",omitempty"`
}
// Type of Request Support in ModifySystem
type RequestType string
// Type of Resource Support in ModifySystem
type ResourceType string
// RequestType const
const (
Add RequestType = "Add"
Remove RequestType = "Remove"
Network ResourceType = "Network"
)
// ResourceModificationRequestResponse is the structure used to send request to the container to modify the system
// Supported resource types are Network and Request Types are Add/Remove
type ResourceModificationRequestResponse struct {
Resource ResourceType `json:"ResourceType"`
Data interface{} `json:"Settings"`
Request RequestType `json:"RequestType,omitempty"`
}

View File

@ -0,0 +1,26 @@
package timeout
import (
"os"
"strconv"
"time"
)
// Duration is the default time to wait for various operations.
// - Waiting for async notifications from HCS
// - Waiting for processes to launch through
// - Waiting to copy data to/from a launched processes stdio pipes.
//
// This can be overridden through environment variable `HCS_TIMEOUT_SECONDS`
var Duration = 4 * time.Minute
func init() {
envTimeout := os.Getenv("HCSSHIM_TIMEOUT_SECONDS")
if len(envTimeout) > 0 {
e, err := strconv.Atoi(envTimeout)
if err == nil && e > 0 {
Duration = time.Second * time.Duration(e)
}
}
}

View File

@ -0,0 +1,25 @@
package wclayer
import (
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
// ActivateLayer will find the layer with the given id and mount it's filesystem.
// For a read/write layer, the mounted filesystem will appear as a volume on the
// host, while a read-only layer is generally expected to be a no-op.
// An activated layer must later be deactivated via DeactivateLayer.
func ActivateLayer(path string) error {
title := "hcsshim::ActivateLayer "
logrus.Debugf(title+"path %s", path)
err := activateLayer(&stdDriverInfo, path)
if err != nil {
err = hcserror.Errorf(err, title, "path=%s", path)
logrus.Error(err)
return err
}
logrus.Debugf(title+" - succeeded path=%s", path)
return nil
}

View File

@ -1,4 +1,4 @@
package hcsshim
package wclayer
import (
"errors"
@ -7,6 +7,8 @@ import (
"syscall"
"github.com/Microsoft/go-winio"
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/Microsoft/hcsshim/internal/safefile"
)
type baseLayerWriter struct {
@ -29,7 +31,7 @@ type dirInfo struct {
func reapplyDirectoryTimes(root *os.File, dis []dirInfo) error {
for i := range dis {
di := &dis[len(dis)-i-1] // reverse order: process child directories first
f, err := openRelative(di.path, root, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, _FILE_OPEN, _FILE_DIRECTORY_FILE)
f, err := safefile.OpenRelative(di.path, root, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, safefile.FILE_OPEN, safefile.FILE_DIRECTORY_FILE)
if err != nil {
return err
}
@ -84,21 +86,21 @@ func (w *baseLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) (err e
extraFlags := uint32(0)
if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY != 0 {
extraFlags |= _FILE_DIRECTORY_FILE
extraFlags |= safefile.FILE_DIRECTORY_FILE
if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT == 0 {
w.dirInfo = append(w.dirInfo, dirInfo{name, *fileInfo})
}
}
mode := uint32(syscall.GENERIC_READ | syscall.GENERIC_WRITE | winio.WRITE_DAC | winio.WRITE_OWNER | winio.ACCESS_SYSTEM_SECURITY)
f, err = openRelative(name, w.root, mode, syscall.FILE_SHARE_READ, _FILE_CREATE, extraFlags)
f, err = safefile.OpenRelative(name, w.root, mode, syscall.FILE_SHARE_READ, safefile.FILE_CREATE, extraFlags)
if err != nil {
return makeError(err, "Failed to openRelative", name)
return hcserror.New(err, "Failed to safefile.OpenRelative", name)
}
err = winio.SetFileBasicInfo(f, fileInfo)
if err != nil {
return makeError(err, "Failed to SetFileBasicInfo", name)
return hcserror.New(err, "Failed to SetFileBasicInfo", name)
}
w.f = f
@ -119,7 +121,7 @@ func (w *baseLayerWriter) AddLink(name string, target string) (err error) {
return err
}
return linkRelative(target, w.root, name, w.root)
return safefile.LinkRelative(target, w.root, name, w.root)
}
func (w *baseLayerWriter) Remove(name string) error {
@ -157,7 +159,7 @@ func (w *baseLayerWriter) Close() error {
}
if w.hasUtilityVM {
err := ensureNotReparsePointRelative("UtilityVM", w.root)
err := safefile.EnsureNotReparsePointRelative("UtilityVM", w.root)
if err != nil {
return err
}

View File

@ -0,0 +1,23 @@
package wclayer
import (
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
// CreateLayer creates a new, empty, read-only layer on the filesystem based on
// the parent layer provided.
func CreateLayer(path, parent string) error {
title := "hcsshim::CreateLayer "
logrus.Debugf(title+"Flavour %d ID %s parent %s", path, parent)
err := createLayer(&stdDriverInfo, path, parent)
if err != nil {
err = hcserror.Errorf(err, title, "path=%s parent=%s flavour=%d", path, parent)
logrus.Error(err)
return err
}
logrus.Debugf(title+" - succeeded path=%s parent=%s flavour=%d", path, parent)
return nil
}

View File

@ -0,0 +1,31 @@
package wclayer
import (
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
// CreateScratchLayer creates and populates new read-write layer for use by a container.
// This requires both the id of the direct parent layer, as well as the full list
// of paths to all parent layers up to the base (and including the direct parent
// whose id was provided).
func CreateScratchLayer(path string, parentLayerPaths []string) error {
title := "hcsshim::CreateScratchLayer "
logrus.Debugf(title+"path %s", path)
// Generate layer descriptors
layers, err := layerPathsToDescriptors(parentLayerPaths)
if err != nil {
return err
}
err = createSandboxLayer(&stdDriverInfo, path, 0, layers)
if err != nil {
err = hcserror.Errorf(err, title, "path=%s", path)
logrus.Error(err)
return err
}
logrus.Debugf(title+"- succeeded path=%s", path)
return nil
}

View File

@ -0,0 +1,22 @@
package wclayer
import (
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
// DeactivateLayer will dismount a layer that was mounted via ActivateLayer.
func DeactivateLayer(path string) error {
title := "hcsshim::DeactivateLayer "
logrus.Debugf(title+"path %s", path)
err := deactivateLayer(&stdDriverInfo, path)
if err != nil {
err = hcserror.Errorf(err, title, "path=%s", path)
logrus.Error(err)
return err
}
logrus.Debugf(title+"succeeded path=%s", path)
return nil
}

View File

@ -0,0 +1,23 @@
package wclayer
import (
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
// DestroyLayer will remove the on-disk files representing the layer with the given
// path, including that layer's containing folder, if any.
func DestroyLayer(path string) error {
title := "hcsshim::DestroyLayer "
logrus.Debugf(title+"path %s", path)
err := destroyLayer(&stdDriverInfo, path)
if err != nil {
err = hcserror.Errorf(err, title, "path=%s", path)
logrus.Error(err)
return err
}
logrus.Debugf(title+"succeeded path=%s", path)
return nil
}

View File

@ -0,0 +1,22 @@
package wclayer
import (
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
// ExpandScratchSize expands the size of a layer to at least size bytes.
func ExpandScratchSize(path string, size uint64) error {
title := "hcsshim::ExpandScratchSize "
logrus.Debugf(title+"path=%s size=%d", path, size)
err := expandSandboxSize(&stdDriverInfo, path, size)
if err != nil {
err = hcserror.Errorf(err, title, "path=%s size=%d", path, size)
logrus.Error(err)
return err
}
logrus.Debugf(title+"- succeeded path=%s size=%d", path, size)
return nil
}

View File

@ -1,4 +1,4 @@
package hcsshim
package wclayer
import (
"io"
@ -7,6 +7,8 @@ import (
"syscall"
"github.com/Microsoft/go-winio"
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/Microsoft/hcsshim/internal/interop"
"github.com/sirupsen/logrus"
)
@ -15,9 +17,9 @@ import (
// format includes any metadata required for later importing the layer (using
// ImportLayer), and requires the full list of parent layer paths in order to
// perform the export.
func ExportLayer(info DriverInfo, layerId string, exportFolderPath string, parentLayerPaths []string) error {
func ExportLayer(path string, exportFolderPath string, parentLayerPaths []string) error {
title := "hcsshim::ExportLayer "
logrus.Debugf(title+"flavour %d layerId %s folder %s", info.Flavour, layerId, exportFolderPath)
logrus.Debugf(title+"path %s folder %s", path, exportFolderPath)
// Generate layer descriptors
layers, err := layerPathsToDescriptors(parentLayerPaths)
@ -25,21 +27,14 @@ func ExportLayer(info DriverInfo, layerId string, exportFolderPath string, paren
return err
}
// Convert info to API calling convention
infop, err := convertDriverInfo(info)
err = exportLayer(&stdDriverInfo, path, exportFolderPath, layers)
if err != nil {
err = hcserror.Errorf(err, title, "path=%s folder=%s", path, exportFolderPath)
logrus.Error(err)
return err
}
err = exportLayer(&infop, layerId, exportFolderPath, layers)
if err != nil {
err = makeErrorf(err, title, "layerId=%s flavour=%d folder=%s", layerId, info.Flavour, exportFolderPath)
logrus.Error(err)
return err
}
logrus.Debugf(title+"succeeded flavour=%d layerId=%s folder=%s", info.Flavour, layerId, exportFolderPath)
logrus.Debugf(title+"succeeded path=%s folder=%s", path, exportFolderPath)
return nil
}
@ -69,11 +64,11 @@ func (r *FilterLayerReader) Next() (string, int64, *winio.FileBasicInfo, error)
if err == syscall.ERROR_NO_MORE_FILES {
err = io.EOF
} else {
err = makeError(err, "ExportLayerNext", "")
err = hcserror.New(err, "ExportLayerNext", "")
}
return "", 0, nil, err
}
fileName := convertAndFreeCoTaskMemString(fileNamep)
fileName := interop.ConvertAndFreeCoTaskMemString(fileNamep)
if deleted != 0 {
fileInfo = nil
}
@ -88,7 +83,7 @@ func (r *FilterLayerReader) Read(b []byte) (int, error) {
var bytesRead uint32
err := exportLayerRead(r.context, b, &bytesRead)
if err != nil {
return 0, makeError(err, "ExportLayerRead", "")
return 0, hcserror.New(err, "ExportLayerRead", "")
}
if bytesRead == 0 {
return 0, io.EOF
@ -103,7 +98,7 @@ func (r *FilterLayerReader) Close() (err error) {
if r.context != 0 {
err = exportLayerEnd(r.context)
if err != nil {
err = makeError(err, "ExportLayerEnd", "")
err = hcserror.New(err, "ExportLayerEnd", "")
}
r.context = 0
}
@ -113,34 +108,30 @@ func (r *FilterLayerReader) Close() (err error) {
// NewLayerReader returns a new layer reader for reading the contents of an on-disk layer.
// The caller must have taken the SeBackupPrivilege privilege
// to call this and any methods on the resulting LayerReader.
func NewLayerReader(info DriverInfo, layerID string, parentLayerPaths []string) (LayerReader, error) {
func NewLayerReader(path string, parentLayerPaths []string) (LayerReader, error) {
if procExportLayerBegin.Find() != nil {
// The new layer reader is not available on this Windows build. Fall back to the
// legacy export code path.
path, err := ioutil.TempDir("", "hcs")
exportPath, err := ioutil.TempDir("", "hcs")
if err != nil {
return nil, err
}
err = ExportLayer(info, layerID, path, parentLayerPaths)
err = ExportLayer(path, exportPath, parentLayerPaths)
if err != nil {
os.RemoveAll(path)
os.RemoveAll(exportPath)
return nil, err
}
return &legacyLayerReaderWrapper{newLegacyLayerReader(path)}, nil
return &legacyLayerReaderWrapper{newLegacyLayerReader(exportPath)}, nil
}
layers, err := layerPathsToDescriptors(parentLayerPaths)
if err != nil {
return nil, err
}
infop, err := convertDriverInfo(info)
if err != nil {
return nil, err
}
r := &FilterLayerReader{}
err = exportLayerBegin(&infop, layerID, layers, &r.context)
err = exportLayerBegin(&stdDriverInfo, path, layers, &r.context)
if err != nil {
return nil, makeError(err, "ExportLayerBegin", "")
return nil, hcserror.New(err, "ExportLayerBegin", "")
}
return r, err
}

View File

@ -1,34 +1,28 @@
package hcsshim
package wclayer
import (
"syscall"
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
// GetLayerMountPath will look for a mounted layer with the given id and return
// GetLayerMountPath will look for a mounted layer with the given path and return
// the path at which that layer can be accessed. This path may be a volume path
// if the layer is a mounted read-write layer, otherwise it is expected to be the
// folder path at which the layer is stored.
func GetLayerMountPath(info DriverInfo, id string) (string, error) {
func GetLayerMountPath(path string) (string, error) {
title := "hcsshim::GetLayerMountPath "
logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id)
// Convert info to API calling convention
infop, err := convertDriverInfo(info)
if err != nil {
logrus.Error(err)
return "", err
}
logrus.Debugf(title+"path %s", path)
var mountPathLength uintptr
mountPathLength = 0
// Call the procedure itself.
logrus.Debugf("Calling proc (1)")
err = getLayerMountPath(&infop, id, &mountPathLength, nil)
err := getLayerMountPath(&stdDriverInfo, path, &mountPathLength, nil)
if err != nil {
err = makeErrorf(err, title, "(first call) id=%s flavour=%d", id, info.Flavour)
err = hcserror.Errorf(err, title, "(first call) path=%s", path)
logrus.Error(err)
return "", err
}
@ -42,14 +36,14 @@ func GetLayerMountPath(info DriverInfo, id string) (string, error) {
// Call the procedure again
logrus.Debugf("Calling proc (2)")
err = getLayerMountPath(&infop, id, &mountPathLength, &mountPathp[0])
err = getLayerMountPath(&stdDriverInfo, path, &mountPathLength, &mountPathp[0])
if err != nil {
err = makeErrorf(err, title, "(second call) id=%s flavour=%d", id, info.Flavour)
err = hcserror.Errorf(err, title, "(second call) path=%s", path)
logrus.Error(err)
return "", err
}
path := syscall.UTF16ToString(mountPathp[0:])
logrus.Debugf(title+"succeeded flavour=%d id=%s path=%s", info.Flavour, id, path)
return path, nil
mountPath := syscall.UTF16ToString(mountPathp[0:])
logrus.Debugf(title+"succeeded path=%s mountPath=%s", path, mountPath)
return mountPath, nil
}

View File

@ -1,6 +1,10 @@
package hcsshim
package wclayer
import "github.com/sirupsen/logrus"
import (
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/Microsoft/hcsshim/internal/interop"
"github.com/sirupsen/logrus"
)
// GetSharedBaseImages will enumerate the images stored in the common central
// image store and return descriptive info about those images for the purpose
@ -12,11 +16,11 @@ func GetSharedBaseImages() (imageData string, err error) {
var buffer *uint16
err = getBaseImages(&buffer)
if err != nil {
err = makeError(err, title, "")
err = hcserror.New(err, title, "")
logrus.Error(err)
return
}
imageData = convertAndFreeCoTaskMemString(buffer)
imageData = interop.ConvertAndFreeCoTaskMemString(buffer)
logrus.Debugf(title+" - succeeded output=%s", imageData)
return
}

View File

@ -0,0 +1,24 @@
package wclayer
import (
"fmt"
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
// GrantVmAccess adds access to a file for a given VM
func GrantVmAccess(vmid string, filepath string) error {
title := fmt.Sprintf("hcsshim::GrantVmAccess id:%s path:%s ", vmid, filepath)
logrus.Debugf(title)
err := grantVmAccess(vmid, filepath)
if err != nil {
err = hcserror.Errorf(err, title, "path=%s", filepath)
logrus.Error(err)
return err
}
logrus.Debugf(title + " - succeeded")
return nil
}

View File

@ -1,4 +1,4 @@
package hcsshim
package wclayer
import (
"errors"
@ -7,6 +7,8 @@ import (
"path/filepath"
"github.com/Microsoft/go-winio"
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/Microsoft/hcsshim/internal/safefile"
"github.com/sirupsen/logrus"
)
@ -14,9 +16,9 @@ import (
// that into a layer with the id layerId. Note that in order to correctly populate
// the layer and interperet the transport format, all parent layers must already
// be present on the system at the paths provided in parentLayerPaths.
func ImportLayer(info DriverInfo, layerID string, importFolderPath string, parentLayerPaths []string) error {
func ImportLayer(path string, importFolderPath string, parentLayerPaths []string) error {
title := "hcsshim::ImportLayer "
logrus.Debugf(title+"flavour %d layerId %s folder %s", info.Flavour, layerID, importFolderPath)
logrus.Debugf(title+"path %s folder %s", path, importFolderPath)
// Generate layer descriptors
layers, err := layerPathsToDescriptors(parentLayerPaths)
@ -24,21 +26,14 @@ func ImportLayer(info DriverInfo, layerID string, importFolderPath string, paren
return err
}
// Convert info to API calling convention
infop, err := convertDriverInfo(info)
err = importLayer(&stdDriverInfo, path, importFolderPath, layers)
if err != nil {
err = hcserror.Errorf(err, title, "path=%s folder=%s", path, importFolderPath)
logrus.Error(err)
return err
}
err = importLayer(&infop, layerID, importFolderPath, layers)
if err != nil {
err = makeErrorf(err, title, "layerId=%s flavour=%d folder=%s", layerID, info.Flavour, importFolderPath)
logrus.Error(err)
return err
}
logrus.Debugf(title+"succeeded flavour=%d layerId=%s folder=%s", info.Flavour, layerID, importFolderPath)
logrus.Debugf(title+"succeeded path=%s folder=%s", path, importFolderPath)
return nil
}
@ -73,7 +68,7 @@ func (w *FilterLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro
}
err := importLayerNext(w.context, name, fileInfo)
if err != nil {
return makeError(err, "ImportLayerNext", "")
return hcserror.New(err, "ImportLayerNext", "")
}
return nil
}
@ -92,7 +87,7 @@ func (w *FilterLayerWriter) Remove(name string) error {
}
err := importLayerNext(w.context, name, nil)
if err != nil {
return makeError(err, "ImportLayerNext", "")
return hcserror.New(err, "ImportLayerNext", "")
}
return nil
}
@ -101,7 +96,7 @@ func (w *FilterLayerWriter) Remove(name string) error {
func (w *FilterLayerWriter) Write(b []byte) (int, error) {
err := importLayerWrite(w.context, b)
if err != nil {
err = makeError(err, "ImportLayerWrite", "")
err = hcserror.New(err, "ImportLayerWrite", "")
return 0, err
}
return len(b), err
@ -113,7 +108,7 @@ func (w *FilterLayerWriter) Close() (err error) {
if w.context != 0 {
err = importLayerEnd(w.context)
if err != nil {
err = makeError(err, "ImportLayerEnd", "")
err = hcserror.New(err, "ImportLayerEnd", "")
}
w.context = 0
}
@ -122,8 +117,6 @@ func (w *FilterLayerWriter) Close() (err error) {
type legacyLayerWriterWrapper struct {
*legacyLayerWriter
info DriverInfo
layerID string
path string
parentLayerPaths []string
}
@ -136,28 +129,26 @@ func (r *legacyLayerWriterWrapper) Close() error {
return err
}
info := r.info
info.HomeDir = ""
if err = ImportLayer(info, r.destRoot.Name(), r.path, r.parentLayerPaths); err != nil {
if err = ImportLayer(r.destRoot.Name(), r.path, r.parentLayerPaths); err != nil {
return err
}
for _, name := range r.Tombstones {
if err = removeRelative(name, r.destRoot); err != nil && !os.IsNotExist(err) {
if err = safefile.RemoveRelative(name, r.destRoot); err != nil && !os.IsNotExist(err) {
return err
}
}
// Add any hard links that were collected.
for _, lnk := range r.PendingLinks {
if err = removeRelative(lnk.Path, r.destRoot); err != nil && !os.IsNotExist(err) {
if err = safefile.RemoveRelative(lnk.Path, r.destRoot); err != nil && !os.IsNotExist(err) {
return err
}
if err = linkRelative(lnk.Target, lnk.TargetRoot, lnk.Path, r.destRoot); err != nil {
if err = safefile.LinkRelative(lnk.Target, lnk.TargetRoot, lnk.Path, r.destRoot); err != nil {
return err
}
}
// Prepare the utility VM for use if one is present in the layer.
if r.HasUtilityVM {
err := ensureNotReparsePointRelative("UtilityVM", r.destRoot)
err := safefile.EnsureNotReparsePointRelative("UtilityVM", r.destRoot)
if err != nil {
return err
}
@ -172,10 +163,10 @@ func (r *legacyLayerWriterWrapper) Close() error {
// NewLayerWriter returns a new layer writer for creating a layer on disk.
// The caller must have taken the SeBackupPrivilege and SeRestorePrivilege privileges
// to call this and any methods on the resulting LayerWriter.
func NewLayerWriter(info DriverInfo, layerID string, parentLayerPaths []string) (LayerWriter, error) {
func NewLayerWriter(path string, parentLayerPaths []string) (LayerWriter, error) {
if len(parentLayerPaths) == 0 {
// This is a base layer. It gets imported differently.
f, err := openRoot(filepath.Join(info.HomeDir, layerID))
f, err := safefile.OpenRoot(path)
if err != nil {
return nil, err
}
@ -187,19 +178,17 @@ func NewLayerWriter(info DriverInfo, layerID string, parentLayerPaths []string)
if procImportLayerBegin.Find() != nil {
// The new layer reader is not available on this Windows build. Fall back to the
// legacy export code path.
path, err := ioutil.TempDir("", "hcs")
importPath, err := ioutil.TempDir("", "hcs")
if err != nil {
return nil, err
}
w, err := newLegacyLayerWriter(path, parentLayerPaths, filepath.Join(info.HomeDir, layerID))
w, err := newLegacyLayerWriter(importPath, parentLayerPaths, path)
if err != nil {
return nil, err
}
return &legacyLayerWriterWrapper{
legacyLayerWriter: w,
info: info,
layerID: layerID,
path: path,
path: importPath,
parentLayerPaths: parentLayerPaths,
}, nil
}
@ -208,15 +197,10 @@ func NewLayerWriter(info DriverInfo, layerID string, parentLayerPaths []string)
return nil, err
}
infop, err := convertDriverInfo(info)
if err != nil {
return nil, err
}
w := &FilterLayerWriter{}
err = importLayerBegin(&infop, layerID, layers, &w.context)
err = importLayerBegin(&stdDriverInfo, path, layers, &w.context)
if err != nil {
return nil, makeError(err, "ImportLayerStart", "")
return nil, hcserror.New(err, "ImportLayerStart", "")
}
return w, nil
}

View File

@ -0,0 +1,25 @@
package wclayer
import (
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
// LayerExists will return true if a layer with the given id exists and is known
// to the system.
func LayerExists(path string) (bool, error) {
title := "hcsshim::LayerExists "
logrus.Debugf(title+"path %s", path)
// Call the procedure itself.
var exists uint32
err := layerExists(&stdDriverInfo, path, &exists)
if err != nil {
err = hcserror.Errorf(err, title, "path=%s", path)
logrus.Error(err)
return false, err
}
logrus.Debugf(title+"succeeded path=%s exists=%d", path, exists)
return exists != 0, nil
}

View File

@ -0,0 +1,13 @@
package wclayer
import (
"path/filepath"
"github.com/Microsoft/hcsshim/internal/guid"
)
// LayerID returns the layer ID of a layer on disk.
func LayerID(path string) (guid.GUID, error) {
_, file := filepath.Split(path)
return NameToGuid(file)
}

View File

@ -1,12 +1,12 @@
package hcsshim
package wclayer
// This file contains utility functions to support storage (graph) related
// functionality.
import (
"path/filepath"
"syscall"
"github.com/Microsoft/hcsshim/internal/guid"
"github.com/sirupsen/logrus"
)
@ -22,28 +22,16 @@ struct DriverInfo {
LPCWSTR HomeDir;
};
*/
type DriverInfo struct {
Flavour int
HomeDir string
}
type driverInfo struct {
Flavour int
HomeDirp *uint16
}
func convertDriverInfo(info DriverInfo) (driverInfo, error) {
homedirp, err := syscall.UTF16PtrFromString(info.HomeDir)
if err != nil {
logrus.Debugf("Failed conversion of home to pointer for driver info: %s", err.Error())
return driverInfo{}, err
}
return driverInfo{
Flavour: info.Flavour,
HomeDirp: homedirp,
}, nil
}
var (
utf16EmptyString uint16
stdDriverInfo = driverInfo{1, &utf16EmptyString}
)
/* To pass into syscall, we need a struct matching the following:
typedef struct _WC_LAYER_DESCRIPTOR {
@ -75,7 +63,7 @@ typedef struct _WC_LAYER_DESCRIPTOR {
} WC_LAYER_DESCRIPTOR, *PWC_LAYER_DESCRIPTOR;
*/
type WC_LAYER_DESCRIPTOR struct {
LayerId GUID
LayerId guid.GUID
Flags uint32
Pathp *uint16
}
@ -85,10 +73,7 @@ func layerPathsToDescriptors(parentLayerPaths []string) ([]WC_LAYER_DESCRIPTOR,
var layers []WC_LAYER_DESCRIPTOR
for i := 0; i < len(parentLayerPaths); i++ {
// Create a layer descriptor, using the folder name
// as the source for a GUID LayerId
_, folderName := filepath.Split(parentLayerPaths[i])
g, err := NameToGuid(folderName)
g, err := LayerID(parentLayerPaths[i])
if err != nil {
logrus.Debugf("Failed to convert name to guid %s", err)
return nil, err

View File

@ -1,4 +1,4 @@
package hcsshim
package wclayer
import (
"bufio"
@ -6,12 +6,15 @@ import (
"errors"
"fmt"
"io"
"io/ioutil"
"os"
"path/filepath"
"strings"
"syscall"
"github.com/Microsoft/go-winio"
"github.com/Microsoft/hcsshim/internal/longpath"
"github.com/Microsoft/hcsshim/internal/safefile"
)
var errorIterationCanceled = errors.New("")
@ -34,23 +37,6 @@ func openFileOrDir(path string, mode uint32, createDisposition uint32) (file *os
return winio.OpenForBackup(path, mode, syscall.FILE_SHARE_READ, createDisposition)
}
func makeLongAbsPath(path string) (string, error) {
if strings.HasPrefix(path, `\\?\`) || strings.HasPrefix(path, `\\.\`) {
return path, nil
}
if !filepath.IsAbs(path) {
absPath, err := filepath.Abs(path)
if err != nil {
return "", err
}
path = absPath
}
if strings.HasPrefix(path, `\\`) {
return `\\?\UNC\` + path[2:], nil
}
return `\\?\` + path, nil
}
func hasPathPrefix(p, prefix string) bool {
return strings.HasPrefix(p, prefix) && len(p) > len(prefix) && p[len(prefix)] == '\\'
}
@ -106,7 +92,7 @@ func readTombstones(path string) (map[string]([]string), error) {
}
func (r *legacyLayerReader) walkUntilCancelled() error {
root, err := makeLongAbsPath(r.root)
root, err := longpath.LongAbs(r.root)
if err != nil {
return err
}
@ -283,7 +269,7 @@ func (r *legacyLayerReader) Next() (path string, size int64, fileInfo *winio.Fil
if err != nil {
return
}
fileInfo.FileAttributes = uintptr(attr)
fileInfo.FileAttributes = attr
beginning := int64(4)
// Find the accurate file size.
@ -349,6 +335,7 @@ type legacyLayerWriter struct {
destRoot *os.File
parentRoots []*os.File
currentFile *os.File
bufWriter *bufio.Writer
currentFileName string
currentFileRoot *os.File
backupWriter *winio.BackupFileWriter
@ -373,21 +360,22 @@ func newLegacyLayerWriter(root string, parentRoots []string, destRoot string) (w
w = nil
}
}()
w.root, err = openRoot(root)
w.root, err = safefile.OpenRoot(root)
if err != nil {
return
}
w.destRoot, err = openRoot(destRoot)
w.destRoot, err = safefile.OpenRoot(destRoot)
if err != nil {
return
}
for _, r := range parentRoots {
f, err := openRoot(r)
f, err := safefile.OpenRoot(r)
if err != nil {
return w, err
}
w.parentRoots = append(w.parentRoots, f)
}
w.bufWriter = bufio.NewWriterSize(ioutil.Discard, 65536)
return
}
@ -408,7 +396,7 @@ func (w *legacyLayerWriter) CloseRoots() {
func (w *legacyLayerWriter) initUtilityVM() error {
if !w.HasUtilityVM {
err := mkdirRelative(utilityVMPath, w.destRoot)
err := safefile.MkdirRelative(utilityVMPath, w.destRoot)
if err != nil {
return err
}
@ -426,6 +414,11 @@ func (w *legacyLayerWriter) initUtilityVM() error {
}
func (w *legacyLayerWriter) reset() error {
err := w.bufWriter.Flush()
if err != nil {
return err
}
w.bufWriter.Reset(ioutil.Discard)
if w.currentIsDir {
r := w.currentFile
br := winio.NewBackupStreamReader(r)
@ -449,7 +442,7 @@ func (w *legacyLayerWriter) reset() error {
// describes a directory reparse point. Delete the placeholder
// directory to prevent future files being added into the
// destination of the reparse point during the ImportLayer call
if err := removeRelative(w.currentFileName, w.currentFileRoot); err != nil {
if err := safefile.RemoveRelative(w.currentFileName, w.currentFileRoot); err != nil {
return err
}
w.pendingDirs = append(w.pendingDirs, pendingDir{Path: w.currentFileName, Root: w.currentFileRoot})
@ -474,13 +467,13 @@ func (w *legacyLayerWriter) reset() error {
// copyFileWithMetadata copies a file using the backup/restore APIs in order to preserve metadata
func copyFileWithMetadata(srcRoot, destRoot *os.File, subPath string, isDir bool) (fileInfo *winio.FileBasicInfo, err error) {
src, err := openRelative(
src, err := safefile.OpenRelative(
subPath,
srcRoot,
syscall.GENERIC_READ|winio.ACCESS_SYSTEM_SECURITY,
syscall.FILE_SHARE_READ,
_FILE_OPEN,
_FILE_OPEN_REPARSE_POINT)
safefile.FILE_OPEN,
safefile.FILE_OPEN_REPARSE_POINT)
if err != nil {
return nil, err
}
@ -495,14 +488,14 @@ func copyFileWithMetadata(srcRoot, destRoot *os.File, subPath string, isDir bool
extraFlags := uint32(0)
if isDir {
extraFlags |= _FILE_DIRECTORY_FILE
extraFlags |= safefile.FILE_DIRECTORY_FILE
}
dest, err := openRelative(
dest, err := safefile.OpenRelative(
subPath,
destRoot,
syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY,
syscall.FILE_SHARE_READ,
_FILE_CREATE,
safefile.FILE_CREATE,
extraFlags)
if err != nil {
return nil, err
@ -534,7 +527,7 @@ func copyFileWithMetadata(srcRoot, destRoot *os.File, subPath string, isDir bool
// the file names in the provided map and just copies those files.
func cloneTree(srcRoot *os.File, destRoot *os.File, subPath string, mutatedFiles map[string]bool) error {
var di []dirInfo
err := ensureNotReparsePointRelative(subPath, srcRoot)
err := safefile.EnsureNotReparsePointRelative(subPath, srcRoot)
if err != nil {
return err
}
@ -566,18 +559,12 @@ func cloneTree(srcRoot *os.File, destRoot *os.File, subPath string, mutatedFiles
di = append(di, dirInfo{path: relPath, fileInfo: *fi})
}
} else {
err = linkRelative(relPath, srcRoot, relPath, destRoot)
err = safefile.LinkRelative(relPath, srcRoot, relPath, destRoot)
if err != nil {
return err
}
}
// Don't recurse on reparse points in go1.8 and older. Filepath.Walk
// handles this in go1.9 and newer.
if isDir && isReparsePoint && shouldSkipDirectoryReparse {
return filepath.SkipDir
}
return nil
})
if err != nil {
@ -604,9 +591,9 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro
if !hasPathPrefix(name, utilityVMFilesPath) && name != utilityVMFilesPath {
return errors.New("invalid UtilityVM layer")
}
createDisposition := uint32(_FILE_OPEN)
createDisposition := uint32(safefile.FILE_OPEN)
if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 {
st, err := lstatRelative(name, w.destRoot)
st, err := safefile.LstatRelative(name, w.destRoot)
if err != nil && !os.IsNotExist(err) {
return err
}
@ -614,14 +601,14 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro
// Delete the existing file/directory if it is not the same type as this directory.
existingAttr := st.Sys().(*syscall.Win32FileAttributeData).FileAttributes
if (uint32(fileInfo.FileAttributes)^existingAttr)&(syscall.FILE_ATTRIBUTE_DIRECTORY|syscall.FILE_ATTRIBUTE_REPARSE_POINT) != 0 {
if err = removeAllRelative(name, w.destRoot); err != nil {
if err = safefile.RemoveAllRelative(name, w.destRoot); err != nil {
return err
}
st = nil
}
}
if st == nil {
if err = mkdirRelative(name, w.destRoot); err != nil {
if err = safefile.MkdirRelative(name, w.destRoot); err != nil {
return err
}
}
@ -630,20 +617,20 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro
}
} else {
// Overwrite any existing hard link.
err := removeRelative(name, w.destRoot)
err := safefile.RemoveRelative(name, w.destRoot)
if err != nil && !os.IsNotExist(err) {
return err
}
createDisposition = _FILE_CREATE
createDisposition = safefile.FILE_CREATE
}
f, err := openRelative(
f, err := safefile.OpenRelative(
name,
w.destRoot,
syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY,
syscall.FILE_SHARE_READ,
createDisposition,
_FILE_OPEN_REPARSE_POINT,
safefile.FILE_OPEN_REPARSE_POINT,
)
if err != nil {
return err
@ -651,7 +638,7 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro
defer func() {
if f != nil {
f.Close()
removeRelative(name, w.destRoot)
safefile.RemoveRelative(name, w.destRoot)
}
}()
@ -661,6 +648,7 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro
}
w.backupWriter = winio.NewBackupFileWriter(f, true)
w.bufWriter.Reset(w.backupWriter)
w.currentFile = f
w.currentFileName = name
w.currentFileRoot = w.destRoot
@ -671,7 +659,7 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro
fname := name
if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 {
err := mkdirRelative(name, w.root)
err := safefile.MkdirRelative(name, w.root)
if err != nil {
return err
}
@ -679,14 +667,14 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro
w.currentIsDir = true
}
f, err := openRelative(fname, w.root, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, _FILE_CREATE, 0)
f, err := safefile.OpenRelative(fname, w.root, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, safefile.FILE_CREATE, 0)
if err != nil {
return err
}
defer func() {
if f != nil {
f.Close()
removeRelative(fname, w.root)
safefile.RemoveRelative(fname, w.root)
}
}()
@ -699,10 +687,13 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro
if hasPathPrefix(name, hivesPath) {
w.backupWriter = winio.NewBackupFileWriter(f, false)
w.bufWriter.Reset(w.backupWriter)
} else {
w.bufWriter.Reset(f)
// The file attributes are written before the stream.
err = binary.Write(f, binary.LittleEndian, uint32(fileInfo.FileAttributes))
err = binary.Write(w.bufWriter, binary.LittleEndian, uint32(fileInfo.FileAttributes))
if err != nil {
w.bufWriter.Reset(ioutil.Discard)
return err
}
}
@ -744,7 +735,7 @@ func (w *legacyLayerWriter) AddLink(name string, target string) error {
selectedRoot = w.destRoot
} else {
for _, r := range roots {
if _, err := lstatRelative(target, r); err != nil {
if _, err := safefile.LstatRelative(target, r); err != nil {
if !os.IsNotExist(err) {
return err
}
@ -780,10 +771,10 @@ func (w *legacyLayerWriter) Remove(name string) error {
// Make sure the path exists; os.RemoveAll will not fail if the file is
// already gone, and this needs to be a fatal error for diagnostics
// purposes.
if _, err := lstatRelative(name, w.destRoot); err != nil {
if _, err := safefile.LstatRelative(name, w.destRoot); err != nil {
return err
}
err = removeAllRelative(name, w.destRoot)
err = safefile.RemoveAllRelative(name, w.destRoot)
if err != nil {
return err
}
@ -795,24 +786,21 @@ func (w *legacyLayerWriter) Remove(name string) error {
}
func (w *legacyLayerWriter) Write(b []byte) (int, error) {
if w.backupWriter == nil {
if w.currentFile == nil {
return 0, errors.New("closed")
}
return w.currentFile.Write(b)
if w.backupWriter == nil && w.currentFile == nil {
return 0, errors.New("closed")
}
return w.backupWriter.Write(b)
return w.bufWriter.Write(b)
}
func (w *legacyLayerWriter) Close() error {
if err := w.reset(); err != nil {
return err
}
if err := removeRelative("tombstones.txt", w.root); err != nil && !os.IsNotExist(err) {
if err := safefile.RemoveRelative("tombstones.txt", w.root); err != nil && !os.IsNotExist(err) {
return err
}
for _, pd := range w.pendingDirs {
err := mkdirRelative(pd.Path, pd.Root)
err := safefile.MkdirRelative(pd.Path, pd.Root)
if err != nil {
return err
}

View File

@ -0,0 +1,24 @@
package wclayer
import (
"github.com/Microsoft/hcsshim/internal/guid"
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
// NameToGuid converts the given string into a GUID using the algorithm in the
// Host Compute Service, ensuring GUIDs generated with the same string are common
// across all clients.
func NameToGuid(name string) (id guid.GUID, err error) {
title := "hcsshim::NameToGuid "
err = nameToGuid(name, &id)
if err != nil {
err = hcserror.Errorf(err, title, "name=%s", name)
logrus.Error(err)
return
}
logrus.Debugf(title+"name:%s guid:%s", name, id.String())
return
}

View File

@ -1,21 +1,22 @@
package hcsshim
package wclayer
import (
"sync"
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
var prepareLayerLock sync.Mutex
// PrepareLayer finds a mounted read-write layer matching layerId and enables the
// PrepareLayer finds a mounted read-write layer matching path and enables the
// the filesystem filter for use on that layer. This requires the paths to all
// parent layers, and is necessary in order to view or interact with the layer
// as an actual filesystem (reading and writing files, creating directories, etc).
// Disabling the filter must be done via UnprepareLayer.
func PrepareLayer(info DriverInfo, layerId string, parentLayerPaths []string) error {
func PrepareLayer(path string, parentLayerPaths []string) error {
title := "hcsshim::PrepareLayer "
logrus.Debugf(title+"flavour %d layerId %s", info.Flavour, layerId)
logrus.Debugf(title+"path %s", path)
// Generate layer descriptors
layers, err := layerPathsToDescriptors(parentLayerPaths)
@ -23,24 +24,17 @@ func PrepareLayer(info DriverInfo, layerId string, parentLayerPaths []string) er
return err
}
// Convert info to API calling convention
infop, err := convertDriverInfo(info)
if err != nil {
logrus.Error(err)
return err
}
// This lock is a temporary workaround for a Windows bug. Only allowing one
// call to prepareLayer at a time vastly reduces the chance of a timeout.
prepareLayerLock.Lock()
defer prepareLayerLock.Unlock()
err = prepareLayer(&infop, layerId, layers)
err = prepareLayer(&stdDriverInfo, path, layers)
if err != nil {
err = makeErrorf(err, title, "layerId=%s flavour=%d", layerId, info.Flavour)
err = hcserror.Errorf(err, title, "path=%s", path)
logrus.Error(err)
return err
}
logrus.Debugf(title+"succeeded flavour=%d layerId=%s", info.Flavour, layerId)
logrus.Debugf(title+"succeeded path=%s", path)
return nil
}

View File

@ -0,0 +1,23 @@
package wclayer
import (
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
// UnprepareLayer disables the filesystem filter for the read-write layer with
// the given id.
func UnprepareLayer(path string) error {
title := "hcsshim::UnprepareLayer "
logrus.Debugf(title+"path %s", path)
err := unprepareLayer(&stdDriverInfo, path)
if err != nil {
err = hcserror.Errorf(err, title, "path=%s", path)
logrus.Error(err)
return err
}
logrus.Debugf(title+"succeeded path=%s", path)
return nil
}

View File

@ -0,0 +1,37 @@
package wclayer
import "github.com/Microsoft/hcsshim/internal/guid"
//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go -winio wclayer.go
//sys activateLayer(info *driverInfo, id string) (hr error) = vmcompute.ActivateLayer?
//sys copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CopyLayer?
//sys createLayer(info *driverInfo, id string, parent string) (hr error) = vmcompute.CreateLayer?
//sys createSandboxLayer(info *driverInfo, id string, parent uintptr, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CreateSandboxLayer?
//sys expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) = vmcompute.ExpandSandboxSize?
//sys deactivateLayer(info *driverInfo, id string) (hr error) = vmcompute.DeactivateLayer?
//sys destroyLayer(info *driverInfo, id string) (hr error) = vmcompute.DestroyLayer?
//sys exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ExportLayer?
//sys getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) = vmcompute.GetLayerMountPath?
//sys getBaseImages(buffer **uint16) (hr error) = vmcompute.GetBaseImages?
//sys importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ImportLayer?
//sys layerExists(info *driverInfo, id string, exists *uint32) (hr error) = vmcompute.LayerExists?
//sys nameToGuid(name string, guid *_guid) (hr error) = vmcompute.NameToGuid?
//sys prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.PrepareLayer?
//sys unprepareLayer(info *driverInfo, id string) (hr error) = vmcompute.UnprepareLayer?
//sys processBaseImage(path string) (hr error) = vmcompute.ProcessBaseImage?
//sys processUtilityImage(path string) (hr error) = vmcompute.ProcessUtilityImage?
//sys importLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ImportLayerBegin?
//sys importLayerNext(context uintptr, fileName string, fileInfo *winio.FileBasicInfo) (hr error) = vmcompute.ImportLayerNext?
//sys importLayerWrite(context uintptr, buffer []byte) (hr error) = vmcompute.ImportLayerWrite?
//sys importLayerEnd(context uintptr) (hr error) = vmcompute.ImportLayerEnd?
//sys exportLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ExportLayerBegin?
//sys exportLayerNext(context uintptr, fileName **uint16, fileInfo *winio.FileBasicInfo, fileSize *int64, deleted *uint32) (hr error) = vmcompute.ExportLayerNext?
//sys exportLayerRead(context uintptr, buffer []byte, bytesRead *uint32) (hr error) = vmcompute.ExportLayerRead?
//sys exportLayerEnd(context uintptr) (hr error) = vmcompute.ExportLayerEnd?
//sys grantVmAccess(vmid string, filepath string) (hr error) = vmcompute.GrantVmAccess?
type _guid = guid.GUID

View File

@ -0,0 +1,597 @@
// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT
package wclayer
import (
"syscall"
"unsafe"
"github.com/Microsoft/go-winio"
"github.com/Microsoft/hcsshim/internal/interop"
"golang.org/x/sys/windows"
)
var _ unsafe.Pointer
// Do the interface allocations only once for common
// Errno values.
const (
errnoERROR_IO_PENDING = 997
)
var (
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
)
// errnoErr returns common boxed Errno values, to prevent
// allocations at runtime.
func errnoErr(e syscall.Errno) error {
switch e {
case 0:
return nil
case errnoERROR_IO_PENDING:
return errERROR_IO_PENDING
}
// TODO: add more here, after collecting data on the common
// error values see on Windows. (perhaps when running
// all.bat?)
return e
}
var (
modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
procActivateLayer = modvmcompute.NewProc("ActivateLayer")
procCopyLayer = modvmcompute.NewProc("CopyLayer")
procCreateLayer = modvmcompute.NewProc("CreateLayer")
procCreateSandboxLayer = modvmcompute.NewProc("CreateSandboxLayer")
procExpandSandboxSize = modvmcompute.NewProc("ExpandSandboxSize")
procDeactivateLayer = modvmcompute.NewProc("DeactivateLayer")
procDestroyLayer = modvmcompute.NewProc("DestroyLayer")
procExportLayer = modvmcompute.NewProc("ExportLayer")
procGetLayerMountPath = modvmcompute.NewProc("GetLayerMountPath")
procGetBaseImages = modvmcompute.NewProc("GetBaseImages")
procImportLayer = modvmcompute.NewProc("ImportLayer")
procLayerExists = modvmcompute.NewProc("LayerExists")
procNameToGuid = modvmcompute.NewProc("NameToGuid")
procPrepareLayer = modvmcompute.NewProc("PrepareLayer")
procUnprepareLayer = modvmcompute.NewProc("UnprepareLayer")
procProcessBaseImage = modvmcompute.NewProc("ProcessBaseImage")
procProcessUtilityImage = modvmcompute.NewProc("ProcessUtilityImage")
procImportLayerBegin = modvmcompute.NewProc("ImportLayerBegin")
procImportLayerNext = modvmcompute.NewProc("ImportLayerNext")
procImportLayerWrite = modvmcompute.NewProc("ImportLayerWrite")
procImportLayerEnd = modvmcompute.NewProc("ImportLayerEnd")
procExportLayerBegin = modvmcompute.NewProc("ExportLayerBegin")
procExportLayerNext = modvmcompute.NewProc("ExportLayerNext")
procExportLayerRead = modvmcompute.NewProc("ExportLayerRead")
procExportLayerEnd = modvmcompute.NewProc("ExportLayerEnd")
procGrantVmAccess = modvmcompute.NewProc("GrantVmAccess")
)
func activateLayer(info *driverInfo, id string) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _activateLayer(info, _p0)
}
func _activateLayer(info *driverInfo, id *uint16) (hr error) {
if hr = procActivateLayer.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procActivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(srcId)
if hr != nil {
return
}
var _p1 *uint16
_p1, hr = syscall.UTF16PtrFromString(dstId)
if hr != nil {
return
}
return _copyLayer(info, _p0, _p1, descriptors)
}
func _copyLayer(info *driverInfo, srcId *uint16, dstId *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
var _p2 *WC_LAYER_DESCRIPTOR
if len(descriptors) > 0 {
_p2 = &descriptors[0]
}
if hr = procCopyLayer.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procCopyLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(srcId)), uintptr(unsafe.Pointer(dstId)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func createLayer(info *driverInfo, id string, parent string) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
var _p1 *uint16
_p1, hr = syscall.UTF16PtrFromString(parent)
if hr != nil {
return
}
return _createLayer(info, _p0, _p1)
}
func _createLayer(info *driverInfo, id *uint16, parent *uint16) (hr error) {
if hr = procCreateLayer.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procCreateLayer.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(parent)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func createSandboxLayer(info *driverInfo, id string, parent uintptr, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _createSandboxLayer(info, _p0, parent, descriptors)
}
func _createSandboxLayer(info *driverInfo, id *uint16, parent uintptr, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
var _p1 *WC_LAYER_DESCRIPTOR
if len(descriptors) > 0 {
_p1 = &descriptors[0]
}
if hr = procCreateSandboxLayer.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procCreateSandboxLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(parent), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _expandSandboxSize(info, _p0, size)
}
func _expandSandboxSize(info *driverInfo, id *uint16, size uint64) (hr error) {
if hr = procExpandSandboxSize.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procExpandSandboxSize.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(size))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func deactivateLayer(info *driverInfo, id string) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _deactivateLayer(info, _p0)
}
func _deactivateLayer(info *driverInfo, id *uint16) (hr error) {
if hr = procDeactivateLayer.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procDeactivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func destroyLayer(info *driverInfo, id string) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _destroyLayer(info, _p0)
}
func _destroyLayer(info *driverInfo, id *uint16) (hr error) {
if hr = procDestroyLayer.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procDestroyLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
var _p1 *uint16
_p1, hr = syscall.UTF16PtrFromString(path)
if hr != nil {
return
}
return _exportLayer(info, _p0, _p1, descriptors)
}
func _exportLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
var _p2 *WC_LAYER_DESCRIPTOR
if len(descriptors) > 0 {
_p2 = &descriptors[0]
}
if hr = procExportLayer.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procExportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _getLayerMountPath(info, _p0, length, buffer)
}
func _getLayerMountPath(info *driverInfo, id *uint16, length *uintptr, buffer *uint16) (hr error) {
if hr = procGetLayerMountPath.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procGetLayerMountPath.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(length)), uintptr(unsafe.Pointer(buffer)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func getBaseImages(buffer **uint16) (hr error) {
if hr = procGetBaseImages.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procGetBaseImages.Addr(), 1, uintptr(unsafe.Pointer(buffer)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
var _p1 *uint16
_p1, hr = syscall.UTF16PtrFromString(path)
if hr != nil {
return
}
return _importLayer(info, _p0, _p1, descriptors)
}
func _importLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
var _p2 *WC_LAYER_DESCRIPTOR
if len(descriptors) > 0 {
_p2 = &descriptors[0]
}
if hr = procImportLayer.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procImportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func layerExists(info *driverInfo, id string, exists *uint32) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _layerExists(info, _p0, exists)
}
func _layerExists(info *driverInfo, id *uint16, exists *uint32) (hr error) {
if hr = procLayerExists.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procLayerExists.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(exists)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func nameToGuid(name string, guid *_guid) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(name)
if hr != nil {
return
}
return _nameToGuid(_p0, guid)
}
func _nameToGuid(name *uint16, guid *_guid) (hr error) {
if hr = procNameToGuid.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procNameToGuid.Addr(), 2, uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(guid)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _prepareLayer(info, _p0, descriptors)
}
func _prepareLayer(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
var _p1 *WC_LAYER_DESCRIPTOR
if len(descriptors) > 0 {
_p1 = &descriptors[0]
}
if hr = procPrepareLayer.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procPrepareLayer.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func unprepareLayer(info *driverInfo, id string) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _unprepareLayer(info, _p0)
}
func _unprepareLayer(info *driverInfo, id *uint16) (hr error) {
if hr = procUnprepareLayer.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procUnprepareLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func processBaseImage(path string) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(path)
if hr != nil {
return
}
return _processBaseImage(_p0)
}
func _processBaseImage(path *uint16) (hr error) {
if hr = procProcessBaseImage.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procProcessBaseImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func processUtilityImage(path string) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(path)
if hr != nil {
return
}
return _processUtilityImage(_p0)
}
func _processUtilityImage(path *uint16) (hr error) {
if hr = procProcessUtilityImage.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procProcessUtilityImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func importLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _importLayerBegin(info, _p0, descriptors, context)
}
func _importLayerBegin(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) {
var _p1 *WC_LAYER_DESCRIPTOR
if len(descriptors) > 0 {
_p1 = &descriptors[0]
}
if hr = procImportLayerBegin.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procImportLayerBegin.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), uintptr(unsafe.Pointer(context)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func importLayerNext(context uintptr, fileName string, fileInfo *winio.FileBasicInfo) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(fileName)
if hr != nil {
return
}
return _importLayerNext(context, _p0, fileInfo)
}
func _importLayerNext(context uintptr, fileName *uint16, fileInfo *winio.FileBasicInfo) (hr error) {
if hr = procImportLayerNext.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procImportLayerNext.Addr(), 3, uintptr(context), uintptr(unsafe.Pointer(fileName)), uintptr(unsafe.Pointer(fileInfo)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func importLayerWrite(context uintptr, buffer []byte) (hr error) {
var _p0 *byte
if len(buffer) > 0 {
_p0 = &buffer[0]
}
if hr = procImportLayerWrite.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procImportLayerWrite.Addr(), 3, uintptr(context), uintptr(unsafe.Pointer(_p0)), uintptr(len(buffer)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func importLayerEnd(context uintptr) (hr error) {
if hr = procImportLayerEnd.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procImportLayerEnd.Addr(), 1, uintptr(context), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func exportLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _exportLayerBegin(info, _p0, descriptors, context)
}
func _exportLayerBegin(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) {
var _p1 *WC_LAYER_DESCRIPTOR
if len(descriptors) > 0 {
_p1 = &descriptors[0]
}
if hr = procExportLayerBegin.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procExportLayerBegin.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), uintptr(unsafe.Pointer(context)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func exportLayerNext(context uintptr, fileName **uint16, fileInfo *winio.FileBasicInfo, fileSize *int64, deleted *uint32) (hr error) {
if hr = procExportLayerNext.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procExportLayerNext.Addr(), 5, uintptr(context), uintptr(unsafe.Pointer(fileName)), uintptr(unsafe.Pointer(fileInfo)), uintptr(unsafe.Pointer(fileSize)), uintptr(unsafe.Pointer(deleted)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func exportLayerRead(context uintptr, buffer []byte, bytesRead *uint32) (hr error) {
var _p0 *byte
if len(buffer) > 0 {
_p0 = &buffer[0]
}
if hr = procExportLayerRead.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procExportLayerRead.Addr(), 4, uintptr(context), uintptr(unsafe.Pointer(_p0)), uintptr(len(buffer)), uintptr(unsafe.Pointer(bytesRead)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func exportLayerEnd(context uintptr) (hr error) {
if hr = procExportLayerEnd.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procExportLayerEnd.Addr(), 1, uintptr(context), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func grantVmAccess(vmid string, filepath string) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(vmid)
if hr != nil {
return
}
var _p1 *uint16
_p1, hr = syscall.UTF16PtrFromString(filepath)
if hr != nil {
return
}
return _grantVmAccess(_p0, _p1)
}
func _grantVmAccess(vmid *uint16, filepath *uint16) (hr error) {
if hr = procGrantVmAccess.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procGrantVmAccess.Addr(), 2, uintptr(unsafe.Pointer(vmid)), uintptr(unsafe.Pointer(filepath)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}

View File

@ -0,0 +1,108 @@
package hcsshim
import (
"crypto/sha1"
"path/filepath"
"github.com/Microsoft/hcsshim/internal/guid"
"github.com/Microsoft/hcsshim/internal/wclayer"
)
func layerPath(info *DriverInfo, id string) string {
return filepath.Join(info.HomeDir, id)
}
func ActivateLayer(info DriverInfo, id string) error {
return wclayer.ActivateLayer(layerPath(&info, id))
}
func CreateLayer(info DriverInfo, id, parent string) error {
return wclayer.CreateLayer(layerPath(&info, id), parent)
}
// New clients should use CreateScratchLayer instead. Kept in to preserve API compatibility.
func CreateSandboxLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error {
return wclayer.CreateScratchLayer(layerPath(&info, layerId), parentLayerPaths)
}
func CreateScratchLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error {
return wclayer.CreateScratchLayer(layerPath(&info, layerId), parentLayerPaths)
}
func DeactivateLayer(info DriverInfo, id string) error {
return wclayer.DeactivateLayer(layerPath(&info, id))
}
func DestroyLayer(info DriverInfo, id string) error {
return wclayer.DestroyLayer(layerPath(&info, id))
}
// New clients should use ExpandScratchSize instead. Kept in to preserve API compatibility.
func ExpandSandboxSize(info DriverInfo, layerId string, size uint64) error {
return wclayer.ExpandScratchSize(layerPath(&info, layerId), size)
}
func ExpandScratchSize(info DriverInfo, layerId string, size uint64) error {
return wclayer.ExpandScratchSize(layerPath(&info, layerId), size)
}
func ExportLayer(info DriverInfo, layerId string, exportFolderPath string, parentLayerPaths []string) error {
return wclayer.ExportLayer(layerPath(&info, layerId), exportFolderPath, parentLayerPaths)
}
func GetLayerMountPath(info DriverInfo, id string) (string, error) {
return wclayer.GetLayerMountPath(layerPath(&info, id))
}
func GetSharedBaseImages() (imageData string, err error) {
return wclayer.GetSharedBaseImages()
}
func ImportLayer(info DriverInfo, layerID string, importFolderPath string, parentLayerPaths []string) error {
return wclayer.ImportLayer(layerPath(&info, layerID), importFolderPath, parentLayerPaths)
}
func LayerExists(info DriverInfo, id string) (bool, error) {
return wclayer.LayerExists(layerPath(&info, id))
}
func PrepareLayer(info DriverInfo, layerId string, parentLayerPaths []string) error {
return wclayer.PrepareLayer(layerPath(&info, layerId), parentLayerPaths)
}
func ProcessBaseLayer(path string) error {
return wclayer.ProcessBaseLayer(path)
}
func ProcessUtilityVMImage(path string) error {
return wclayer.ProcessUtilityVMImage(path)
}
func UnprepareLayer(info DriverInfo, layerId string) error {
return wclayer.UnprepareLayer(layerPath(&info, layerId))
}
type DriverInfo struct {
Flavour int
HomeDir string
}
type FilterLayerReader = wclayer.FilterLayerReader
type FilterLayerWriter = wclayer.FilterLayerWriter
type GUID [16]byte
func NameToGuid(name string) (id GUID, err error) {
g, err := wclayer.NameToGuid(name)
return GUID(g), err
}
func NewGUID(source string) *GUID {
h := sha1.Sum([]byte(source))
var g GUID
copy(g[0:], h[0:16])
return &g
}
func (g *GUID) ToString() string {
return (guid.GUID)(*g).String()
}
type LayerReader = wclayer.LayerReader
func NewLayerReader(info DriverInfo, layerID string, parentLayerPaths []string) (LayerReader, error) {
return wclayer.NewLayerReader(layerPath(&info, layerID), parentLayerPaths)
}
type LayerWriter = wclayer.LayerWriter
func NewLayerWriter(info DriverInfo, layerID string, parentLayerPaths []string) (LayerWriter, error) {
return wclayer.NewLayerWriter(layerPath(&info, layerID), parentLayerPaths)
}
type WC_LAYER_DESCRIPTOR = wclayer.WC_LAYER_DESCRIPTOR

View File

@ -1,30 +0,0 @@
package hcsshim
import "github.com/sirupsen/logrus"
// LayerExists will return true if a layer with the given id exists and is known
// to the system.
func LayerExists(info DriverInfo, id string) (bool, error) {
title := "hcsshim::LayerExists "
logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id)
// Convert info to API calling convention
infop, err := convertDriverInfo(info)
if err != nil {
logrus.Error(err)
return false, err
}
// Call the procedure itself.
var exists uint32
err = layerExists(&infop, id, &exists)
if err != nil {
err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour)
logrus.Error(err)
return false, err
}
logrus.Debugf(title+"succeeded flavour=%d id=%s exists=%d", info.Flavour, id, exists)
return exists != 0, nil
}

View File

@ -1,7 +0,0 @@
// +build !go1.9
package hcsshim
// Due to a bug in go1.8 and before, directory reparse points need to be skipped
// during filepath.Walk. This is fixed in go1.9
var shouldSkipDirectoryReparse = true

View File

@ -1,7 +0,0 @@
// +build go1.9
package hcsshim
// Due to a bug in go1.8 and before, directory reparse points need to be skipped
// during filepath.Walk. This is fixed in go1.9
var shouldSkipDirectoryReparse = false

View File

@ -1,20 +0,0 @@
package hcsshim
import "github.com/sirupsen/logrus"
// NameToGuid converts the given string into a GUID using the algorithm in the
// Host Compute Service, ensuring GUIDs generated with the same string are common
// across all clients.
func NameToGuid(name string) (id GUID, err error) {
title := "hcsshim::NameToGuid "
logrus.Debugf(title+"Name %s", name)
err = nameToGuid(name, &id)
if err != nil {
err = makeErrorf(err, title, "name=%s", name)
logrus.Error(err)
return
}
return
}

View File

@ -1,384 +1,72 @@
package hcsshim
import (
"encoding/json"
"io"
"sync"
"syscall"
"time"
"github.com/sirupsen/logrus"
"github.com/Microsoft/hcsshim/internal/hcs"
)
// ContainerError is an error encountered in HCS
type process struct {
handleLock sync.RWMutex
handle hcsProcess
processID int
container *container
cachedPipes *cachedPipes
callbackNumber uintptr
p *hcs.Process
}
type cachedPipes struct {
stdIn syscall.Handle
stdOut syscall.Handle
stdErr syscall.Handle
}
type processModifyRequest struct {
Operation string
ConsoleSize *consoleSize `json:",omitempty"`
CloseHandle *closeHandle `json:",omitempty"`
}
type consoleSize struct {
Height uint16
Width uint16
}
type closeHandle struct {
Handle string
}
type processStatus struct {
ProcessID uint32
Exited bool
ExitCode uint32
LastWaitResult int32
}
const (
stdIn string = "StdIn"
stdOut string = "StdOut"
stdErr string = "StdErr"
)
const (
modifyConsoleSize string = "ConsoleSize"
modifyCloseHandle string = "CloseHandle"
)
// Pid returns the process ID of the process within the container.
func (process *process) Pid() int {
return process.processID
return process.p.Pid()
}
// Kill signals the process to terminate but does not wait for it to finish terminating.
func (process *process) Kill() error {
process.handleLock.RLock()
defer process.handleLock.RUnlock()
operation := "Kill"
title := "HCSShim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
if process.handle == 0 {
return makeProcessError(process, operation, "", ErrAlreadyClosed)
}
var resultp *uint16
err := hcsTerminateProcess(process.handle, &resultp)
err = processHcsResult(err, resultp)
if err != nil {
return makeProcessError(process, operation, "", err)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return nil
return convertProcessError(process.p.Kill(), process)
}
// Wait waits for the process to exit.
func (process *process) Wait() error {
operation := "Wait"
title := "HCSShim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
err := waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil)
if err != nil {
return makeProcessError(process, operation, "", err)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return nil
return convertProcessError(process.p.Wait(), process)
}
// WaitTimeout waits for the process to exit or the duration to elapse. It returns
// false if timeout occurs.
func (process *process) WaitTimeout(timeout time.Duration) error {
operation := "WaitTimeout"
title := "HCSShim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
err := waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout)
if err != nil {
return makeProcessError(process, operation, "", err)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return nil
return convertProcessError(process.p.WaitTimeout(timeout), process)
}
// ExitCode returns the exit code of the process. The process must have
// already terminated.
func (process *process) ExitCode() (int, error) {
process.handleLock.RLock()
defer process.handleLock.RUnlock()
operation := "ExitCode"
title := "HCSShim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
if process.handle == 0 {
return 0, makeProcessError(process, operation, "", ErrAlreadyClosed)
}
properties, err := process.properties()
code, err := process.p.ExitCode()
if err != nil {
return 0, makeProcessError(process, operation, "", err)
err = convertProcessError(err, process)
}
if properties.Exited == false {
return 0, makeProcessError(process, operation, "", ErrInvalidProcessState)
}
if properties.LastWaitResult != 0 {
return 0, makeProcessError(process, operation, "", syscall.Errno(properties.LastWaitResult))
}
logrus.Debugf(title+" succeeded processid=%d exitCode=%d", process.processID, properties.ExitCode)
return int(properties.ExitCode), nil
return code, err
}
// ResizeConsole resizes the console of the process.
func (process *process) ResizeConsole(width, height uint16) error {
process.handleLock.RLock()
defer process.handleLock.RUnlock()
operation := "ResizeConsole"
title := "HCSShim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
if process.handle == 0 {
return makeProcessError(process, operation, "", ErrAlreadyClosed)
}
modifyRequest := processModifyRequest{
Operation: modifyConsoleSize,
ConsoleSize: &consoleSize{
Height: height,
Width: width,
},
}
modifyRequestb, err := json.Marshal(modifyRequest)
if err != nil {
return err
}
modifyRequestStr := string(modifyRequestb)
var resultp *uint16
err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
err = processHcsResult(err, resultp)
if err != nil {
return makeProcessError(process, operation, "", err)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return nil
}
func (process *process) properties() (*processStatus, error) {
operation := "properties"
title := "HCSShim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
var (
resultp *uint16
propertiesp *uint16
)
err := hcsGetProcessProperties(process.handle, &propertiesp, &resultp)
err = processHcsResult(err, resultp)
if err != nil {
return nil, err
}
if propertiesp == nil {
return nil, ErrUnexpectedValue
}
propertiesRaw := convertAndFreeCoTaskMemBytes(propertiesp)
properties := &processStatus{}
if err := json.Unmarshal(propertiesRaw, properties); err != nil {
return nil, err
}
logrus.Debugf(title+" succeeded processid=%d, properties=%s", process.processID, propertiesRaw)
return properties, nil
return convertProcessError(process.p.ResizeConsole(width, height), process)
}
// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing
// these pipes does not close the underlying pipes; it should be possible to
// call this multiple times to get multiple interfaces.
func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) {
process.handleLock.RLock()
defer process.handleLock.RUnlock()
operation := "Stdio"
title := "HCSShim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
if process.handle == 0 {
return nil, nil, nil, makeProcessError(process, operation, "", ErrAlreadyClosed)
}
var stdIn, stdOut, stdErr syscall.Handle
if process.cachedPipes == nil {
var (
processInfo hcsProcessInformation
resultp *uint16
)
err := hcsGetProcessInfo(process.handle, &processInfo, &resultp)
err = processHcsResult(err, resultp)
if err != nil {
return nil, nil, nil, makeProcessError(process, operation, "", err)
}
stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError
} else {
// Use cached pipes
stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr
// Invalidate the cache
process.cachedPipes = nil
}
pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr})
stdin, stdout, stderr, err := process.p.Stdio()
if err != nil {
return nil, nil, nil, makeProcessError(process, operation, "", err)
err = convertProcessError(err, process)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return pipes[0], pipes[1], pipes[2], nil
return stdin, stdout, stderr, err
}
// CloseStdin closes the write side of the stdin pipe so that the process is
// notified on the read side that there is no more data in stdin.
func (process *process) CloseStdin() error {
process.handleLock.RLock()
defer process.handleLock.RUnlock()
operation := "CloseStdin"
title := "HCSShim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
if process.handle == 0 {
return makeProcessError(process, operation, "", ErrAlreadyClosed)
}
modifyRequest := processModifyRequest{
Operation: modifyCloseHandle,
CloseHandle: &closeHandle{
Handle: stdIn,
},
}
modifyRequestb, err := json.Marshal(modifyRequest)
if err != nil {
return err
}
modifyRequestStr := string(modifyRequestb)
var resultp *uint16
err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
err = processHcsResult(err, resultp)
if err != nil {
return makeProcessError(process, operation, "", err)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return nil
return convertProcessError(process.p.CloseStdin(), process)
}
// Close cleans up any state associated with the process but does not kill
// or wait on it.
func (process *process) Close() error {
process.handleLock.Lock()
defer process.handleLock.Unlock()
operation := "Close"
title := "HCSShim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
// Don't double free this
if process.handle == 0 {
return nil
}
if err := process.unregisterCallback(); err != nil {
return makeProcessError(process, operation, "", err)
}
if err := hcsCloseProcess(process.handle); err != nil {
return makeProcessError(process, operation, "", err)
}
process.handle = 0
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return nil
}
func (process *process) registerCallback() error {
context := &notifcationWatcherContext{
channels: newChannels(),
}
callbackMapLock.Lock()
callbackNumber := nextCallback
nextCallback++
callbackMap[callbackNumber] = context
callbackMapLock.Unlock()
var callbackHandle hcsCallback
err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
if err != nil {
return err
}
context.handle = callbackHandle
process.callbackNumber = callbackNumber
return nil
}
func (process *process) unregisterCallback() error {
callbackNumber := process.callbackNumber
callbackMapLock.RLock()
context := callbackMap[callbackNumber]
callbackMapLock.RUnlock()
if context == nil {
return nil
}
handle := context.handle
if handle == 0 {
return nil
}
// hcsUnregisterProcessCallback has its own syncronization
// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
err := hcsUnregisterProcessCallback(handle)
if err != nil {
return err
}
closeChannels(context.channels)
callbackMapLock.Lock()
callbackMap[callbackNumber] = nil
callbackMapLock.Unlock()
handle = 0
return nil
return convertProcessError(process.p.Close(), process)
}

View File

@ -1,27 +0,0 @@
package hcsshim
import "github.com/sirupsen/logrus"
// UnprepareLayer disables the filesystem filter for the read-write layer with
// the given id.
func UnprepareLayer(info DriverInfo, layerId string) error {
title := "hcsshim::UnprepareLayer "
logrus.Debugf(title+"flavour %d layerId %s", info.Flavour, layerId)
// Convert info to API calling convention
infop, err := convertDriverInfo(info)
if err != nil {
logrus.Error(err)
return err
}
err = unprepareLayer(&infop, layerId)
if err != nil {
err = makeErrorf(err, title, "layerId=%s flavour=%d", layerId, info.Flavour)
logrus.Error(err)
return err
}
logrus.Debugf(title+"succeeded flavour %d layerId=%s", info.Flavour, layerId)
return nil
}

View File

@ -2,6 +2,5 @@ package hcsshim
// IsTP4 returns whether the currently running Windows build is at least TP4.
func IsTP4() bool {
// HNSCall was not present in TP4
return procHNSCall.Find() != nil
return false
}

File diff suppressed because it is too large Load Diff

View File

@ -0,0 +1,52 @@
// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT
package hcsshim
import (
"syscall"
"unsafe"
"github.com/Microsoft/hcsshim/internal/interop"
"golang.org/x/sys/windows"
)
var _ unsafe.Pointer
// Do the interface allocations only once for common
// Errno values.
const (
errnoERROR_IO_PENDING = 997
)
var (
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
)
// errnoErr returns common boxed Errno values, to prevent
// allocations at runtime.
func errnoErr(e syscall.Errno) error {
switch e {
case 0:
return nil
case errnoERROR_IO_PENDING:
return errERROR_IO_PENDING
}
// TODO: add more here, after collecting data on the common
// error values see on Windows. (perhaps when running
// all.bat?)
return e
}
var (
modiphlpapi = windows.NewLazySystemDLL("iphlpapi.dll")
procSetCurrentThreadCompartmentId = modiphlpapi.NewProc("SetCurrentThreadCompartmentId")
)
func SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) {
r0, _, _ := syscall.Syscall(procSetCurrentThreadCompartmentId.Addr(), 1, uintptr(compartmentId), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}

View File

@ -17,6 +17,7 @@
package console
import (
"fmt"
"os"
"github.com/pkg/errors"
@ -28,55 +29,90 @@ var (
ErrNotImplemented = errors.New("not implemented")
)
func (m *master) init() {
m.h = windows.Handle(m.f.Fd())
if err := windows.GetConsoleMode(m.h, &m.mode); err == nil {
if m.f == os.Stdin {
// Validate that windows.ENABLE_VIRTUAL_TERMINAL_INPUT is supported, but do not set it.
if err = windows.SetConsoleMode(m.h, m.mode|windows.ENABLE_VIRTUAL_TERMINAL_INPUT); err == nil {
vtInputSupported = true
}
// Unconditionally set the console mode back even on failure because SetConsoleMode
// remembers invalid bits on input handles.
windows.SetConsoleMode(m.h, m.mode)
} else if err := windows.SetConsoleMode(m.h, m.mode|windows.ENABLE_VIRTUAL_TERMINAL_PROCESSING); err == nil {
m.mode |= windows.ENABLE_VIRTUAL_TERMINAL_PROCESSING
} else {
windows.SetConsoleMode(m.h, m.mode)
func (m *master) initStdios() {
m.in = windows.Handle(os.Stdin.Fd())
if err := windows.GetConsoleMode(m.in, &m.inMode); err == nil {
// Validate that windows.ENABLE_VIRTUAL_TERMINAL_INPUT is supported, but do not set it.
if err = windows.SetConsoleMode(m.in, m.inMode|windows.ENABLE_VIRTUAL_TERMINAL_INPUT); err == nil {
vtInputSupported = true
}
// Unconditionally set the console mode back even on failure because SetConsoleMode
// remembers invalid bits on input handles.
windows.SetConsoleMode(m.in, m.inMode)
} else {
fmt.Printf("failed to get console mode for stdin: %v\n", err)
}
m.out = windows.Handle(os.Stdout.Fd())
if err := windows.GetConsoleMode(m.out, &m.outMode); err == nil {
if err := windows.SetConsoleMode(m.out, m.outMode|windows.ENABLE_VIRTUAL_TERMINAL_PROCESSING); err == nil {
m.outMode |= windows.ENABLE_VIRTUAL_TERMINAL_PROCESSING
} else {
windows.SetConsoleMode(m.out, m.outMode)
}
} else {
fmt.Printf("failed to get console mode for stdout: %v\n", err)
}
m.err = windows.Handle(os.Stderr.Fd())
if err := windows.GetConsoleMode(m.err, &m.errMode); err == nil {
if err := windows.SetConsoleMode(m.err, m.errMode|windows.ENABLE_VIRTUAL_TERMINAL_PROCESSING); err == nil {
m.errMode |= windows.ENABLE_VIRTUAL_TERMINAL_PROCESSING
} else {
windows.SetConsoleMode(m.err, m.errMode)
}
} else {
fmt.Printf("failed to get console mode for stderr: %v\n", err)
}
}
type master struct {
h windows.Handle
mode uint32
f *os.File
in windows.Handle
inMode uint32
out windows.Handle
outMode uint32
err windows.Handle
errMode uint32
}
func (m *master) SetRaw() error {
if m.f == os.Stdin {
if err := makeInputRaw(m.h, m.mode); err != nil {
return err
}
} else {
// Set StdOut and StdErr to raw mode, we ignore failures since
// windows.DISABLE_NEWLINE_AUTO_RETURN might not be supported on this version of
// Windows.
windows.SetConsoleMode(m.h, m.mode|windows.DISABLE_NEWLINE_AUTO_RETURN)
if err := makeInputRaw(m.in, m.inMode); err != nil {
return err
}
// Set StdOut and StdErr to raw mode, we ignore failures since
// windows.DISABLE_NEWLINE_AUTO_RETURN might not be supported on this version of
// Windows.
windows.SetConsoleMode(m.out, m.outMode|windows.DISABLE_NEWLINE_AUTO_RETURN)
windows.SetConsoleMode(m.err, m.errMode|windows.DISABLE_NEWLINE_AUTO_RETURN)
return nil
}
func (m *master) Reset() error {
if err := windows.SetConsoleMode(m.h, m.mode); err != nil {
return errors.Wrap(err, "unable to restore console mode")
for _, s := range []struct {
fd windows.Handle
mode uint32
}{
{m.in, m.inMode},
{m.out, m.outMode},
{m.err, m.errMode},
} {
if err := windows.SetConsoleMode(s.fd, s.mode); err != nil {
return errors.Wrap(err, "unable to restore console mode")
}
}
return nil
}
func (m *master) Size() (WinSize, error) {
var info windows.ConsoleScreenBufferInfo
err := windows.GetConsoleScreenBufferInfo(m.h, &info)
err := windows.GetConsoleScreenBufferInfo(m.out, &info)
if err != nil {
return WinSize{}, errors.Wrap(err, "unable to get console info")
}
@ -98,11 +134,11 @@ func (m *master) ResizeFrom(c Console) error {
}
func (m *master) DisableEcho() error {
mode := m.mode &^ windows.ENABLE_ECHO_INPUT
mode := m.inMode &^ windows.ENABLE_ECHO_INPUT
mode |= windows.ENABLE_PROCESSED_INPUT
mode |= windows.ENABLE_LINE_INPUT
if err := windows.SetConsoleMode(m.h, mode); err != nil {
if err := windows.SetConsoleMode(m.in, mode); err != nil {
return errors.Wrap(err, "unable to set console to disable echo")
}
@ -114,15 +150,15 @@ func (m *master) Close() error {
}
func (m *master) Read(b []byte) (int, error) {
return m.f.Read(b)
return os.Stdin.Read(b)
}
func (m *master) Write(b []byte) (int, error) {
return m.f.Write(b)
return os.Stdout.Write(b)
}
func (m *master) Fd() uintptr {
return uintptr(m.h)
return uintptr(m.in)
}
// on windows, console can only be made from os.Std{in,out,err}, hence there
@ -174,7 +210,7 @@ func newMaster(f *os.File) (Console, error) {
if f != os.Stdin && f != os.Stdout && f != os.Stderr {
return nil, errors.New("creating a console from a file is not supported on windows")
}
m := &master{f: f}
m.init()
m := &master{}
m.initStdios()
return m, nil
}

View File

@ -1,4 +1,4 @@
![banner](/docs/static/img/containerd-dark.png?raw=true)
![banner](https://github.com/containerd/containerd.io/blob/master/static/img/containerd-dark.png?raw=true)
[![GoDoc](https://godoc.org/github.com/containerd/containerd?status.svg)](https://godoc.org/github.com/containerd/containerd)
[![Build Status](https://travis-ci.org/containerd/containerd.svg?branch=master)](https://travis-ci.org/containerd/containerd)

View File

@ -259,7 +259,7 @@ func fileInfoFromHeader(hdr *tar.Header) (name string, size int64, fileInfo *win
if err != nil {
return "", 0, nil, err
}
fileInfo.FileAttributes = uintptr(attr)
fileInfo.FileAttributes = uint32(attr)
} else {
if hdr.Typeflag == tar.TypeDir {
fileInfo.FileAttributes |= syscall.FILE_ATTRIBUTE_DIRECTORY

View File

@ -74,7 +74,7 @@ func copyIO(fifos *FIFOSet, ioset *Streams) (*cio, error) {
if fifos.Stdout != "" {
l, err := winio.ListenPipe(fifos.Stdout, nil)
if err != nil {
return nil, errors.Wrapf(err, "failed to create stdin pipe %s", fifos.Stdout)
return nil, errors.Wrapf(err, "failed to create stdout pipe %s", fifos.Stdout)
}
defer func(l net.Listener) {
if err != nil {
@ -99,7 +99,7 @@ func copyIO(fifos *FIFOSet, ioset *Streams) (*cio, error) {
}()
}
if !fifos.Terminal && fifos.Stderr != "" {
if fifos.Stderr != "" {
l, err := winio.ListenPipe(fifos.Stderr, nil)
if err != nil {
return nil, errors.Wrapf(err, "failed to create stderr pipe %s", fifos.Stderr)

View File

@ -82,6 +82,9 @@ func New(address string, opts ...ClientOpt) (*Client, error) {
return nil, err
}
}
if copts.timeout == 0 {
copts.timeout = 10 * time.Second
}
rt := fmt.Sprintf("%s.%s", plugin.RuntimePlugin, runtime.GOOS)
if copts.defaultRuntime != "" {
rt = copts.defaultRuntime
@ -115,7 +118,7 @@ func New(address string, opts ...ClientOpt) (*Client, error) {
)
}
connector := func() (*grpc.ClientConn, error) {
ctx, cancel := context.WithTimeout(context.Background(), 60*time.Second)
ctx, cancel := context.WithTimeout(context.Background(), copts.timeout)
defer cancel()
conn, err := grpc.DialContext(ctx, dialer.DialAddress(address), gopts...)
if err != nil {
@ -256,9 +259,10 @@ type RemoteContext struct {
// If no resolver is provided, defaults to Docker registry resolver.
Resolver remotes.Resolver
// Platforms defines which platforms to handle when doing the image operation.
// If this field is empty, content for all platforms will be pulled.
Platforms []string
// PlatformMatcher is used to match the platforms for an image
// operation and define the preference when a single match is required
// from multiple platforms.
PlatformMatcher platforms.MatchComparer
// Unpack is done after an image is pulled to extract into a snapshotter.
// If an image is not unpacked on pull, it can be unpacked any time
@ -280,6 +284,12 @@ type RemoteContext struct {
// manifests. If this option is false then any image which resolves
// to schema 1 will return an error since schema 1 is not supported.
ConvertSchema1 bool
// Platforms defines which platforms to handle when doing the image operation.
// Platforms is ignored when a PlatformMatcher is set, otherwise the
// platforms will be used to create a PlatformMatcher with no ordering
// preference.
Platforms []string
}
func defaultRemoteContext() *RemoteContext {
@ -305,13 +315,30 @@ func (c *Client) Fetch(ctx context.Context, ref string, opts ...RemoteOpt) (imag
return images.Image{}, errors.New("unpack on fetch not supported, try pull")
}
if fetchCtx.PlatformMatcher == nil {
if len(fetchCtx.Platforms) == 0 {
fetchCtx.PlatformMatcher = platforms.All
} else {
var ps []ocispec.Platform
for _, s := range fetchCtx.Platforms {
p, err := platforms.Parse(s)
if err != nil {
return images.Image{}, errors.Wrapf(err, "invalid platform %s", s)
}
ps = append(ps, p)
}
fetchCtx.PlatformMatcher = platforms.Any(ps...)
}
}
ctx, done, err := c.WithLease(ctx)
if err != nil {
return images.Image{}, err
}
defer done(ctx)
return c.fetch(ctx, fetchCtx, ref)
return c.fetch(ctx, fetchCtx, ref, 0)
}
// Pull downloads the provided content into containerd's content store
@ -324,10 +351,19 @@ func (c *Client) Pull(ctx context.Context, ref string, opts ...RemoteOpt) (Image
}
}
if len(pullCtx.Platforms) > 1 {
return nil, errors.New("cannot pull multiplatform image locally, try Fetch")
} else if len(pullCtx.Platforms) == 0 {
pullCtx.Platforms = []string{platforms.Default()}
if pullCtx.PlatformMatcher == nil {
if len(pullCtx.Platforms) > 1 {
return nil, errors.New("cannot pull multiplatform image locally, try Fetch")
} else if len(pullCtx.Platforms) == 0 {
pullCtx.PlatformMatcher = platforms.Default()
} else {
p, err := platforms.Parse(pullCtx.Platforms[0])
if err != nil {
return nil, errors.Wrapf(err, "invalid platform %s", pullCtx.Platforms[0])
}
pullCtx.PlatformMatcher = platforms.Only(p)
}
}
ctx, done, err := c.WithLease(ctx)
@ -336,12 +372,12 @@ func (c *Client) Pull(ctx context.Context, ref string, opts ...RemoteOpt) (Image
}
defer done(ctx)
img, err := c.fetch(ctx, pullCtx, ref)
img, err := c.fetch(ctx, pullCtx, ref, 1)
if err != nil {
return nil, err
}
i := NewImageWithPlatform(c, img, pullCtx.Platforms[0])
i := NewImageWithPlatform(c, img, pullCtx.PlatformMatcher)
if pullCtx.Unpack {
if err := i.Unpack(ctx, pullCtx.Snapshotter); err != nil {
@ -352,7 +388,7 @@ func (c *Client) Pull(ctx context.Context, ref string, opts ...RemoteOpt) (Image
return i, nil
}
func (c *Client) fetch(ctx context.Context, rCtx *RemoteContext, ref string) (images.Image, error) {
func (c *Client) fetch(ctx context.Context, rCtx *RemoteContext, ref string, limit int) (images.Image, error) {
store := c.ContentStore()
name, desc, err := rCtx.Resolver.Resolve(ctx, ref)
if err != nil {
@ -377,7 +413,11 @@ func (c *Client) fetch(ctx context.Context, rCtx *RemoteContext, ref string) (im
// Set any children labels for that content
childrenHandler = images.SetChildrenLabels(store, childrenHandler)
// Filter children by platforms
childrenHandler = images.FilterPlatforms(childrenHandler, rCtx.Platforms...)
childrenHandler = images.FilterPlatforms(childrenHandler, rCtx.PlatformMatcher)
// Sort and limit manifests if a finite number is needed
if limit > 0 {
childrenHandler = images.LimitManifests(childrenHandler, rCtx.PlatformMatcher, limit)
}
handler = images.Handlers(append(rCtx.BaseHandlers,
remotes.FetchHandler(store, fetcher),
@ -434,13 +474,28 @@ func (c *Client) Push(ctx context.Context, ref string, desc ocispec.Descriptor,
return err
}
}
if pushCtx.PlatformMatcher == nil {
if len(pushCtx.Platforms) > 0 {
var ps []ocispec.Platform
for _, platform := range pushCtx.Platforms {
p, err := platforms.Parse(platform)
if err != nil {
return errors.Wrapf(err, "invalid platform %s", platform)
}
ps = append(ps, p)
}
pushCtx.PlatformMatcher = platforms.Any(ps...)
} else {
pushCtx.PlatformMatcher = platforms.All
}
}
pusher, err := pushCtx.Resolver.Pusher(ctx, ref)
if err != nil {
return err
}
return remotes.PushContent(ctx, pusher, desc, c.ContentStore(), pushCtx.Platforms, pushCtx.BaseHandlers...)
return remotes.PushContent(ctx, pusher, desc, c.ContentStore(), pushCtx.PlatformMatcher, pushCtx.BaseHandlers...)
}
// GetImage returns an existing image

View File

@ -17,6 +17,8 @@
package containerd
import (
"time"
"github.com/containerd/containerd/images"
"github.com/containerd/containerd/platforms"
"github.com/containerd/containerd/remotes"
@ -28,6 +30,7 @@ type clientOpts struct {
defaultRuntime string
services *services
dialOptions []grpc.DialOption
timeout time.Duration
}
// ClientOpt allows callers to set options on the containerd client
@ -71,6 +74,14 @@ func WithServices(opts ...ServicesOpt) ClientOpt {
}
}
// WithTimeout sets the connection timeout for the client
func WithTimeout(d time.Duration) ClientOpt {
return func(c *clientOpts) error {
c.timeout = d
return nil
}
}
// RemoteOpt allows the caller to set distribution options for a remote
type RemoteOpt func(*Client, *RemoteContext) error
@ -78,7 +89,7 @@ type RemoteOpt func(*Client, *RemoteContext) error
// content for
func WithPlatform(platform string) RemoteOpt {
if platform == "" {
platform = platforms.Default()
platform = platforms.DefaultString()
}
return func(_ *Client, c *RemoteContext) error {
for _, p := range c.Platforms {
@ -92,6 +103,16 @@ func WithPlatform(platform string) RemoteOpt {
}
}
// WithPlatformMatcher specifies the matcher to use for
// determining which platforms to pull content for.
// This value supersedes anything set with `WithPlatform`.
func WithPlatformMatcher(m platforms.MatchComparer) RemoteOpt {
return func(_ *Client, c *RemoteContext) error {
c.PlatformMatcher = m
return nil
}
}
// WithPullUnpack is used to unpack an image after pull. This
// uses the snapshotter, content store, and diff service
// configured for the client.

View File

@ -63,7 +63,7 @@ func NewImage(client *Client, i images.Image) Image {
}
// NewImageWithPlatform returns a client image object from the metadata image
func NewImageWithPlatform(client *Client, i images.Image, platform string) Image {
func NewImageWithPlatform(client *Client, i images.Image, platform platforms.MatchComparer) Image {
return &image{
client: client,
i: i,
@ -75,7 +75,7 @@ type image struct {
client *Client
i images.Image
platform string
platform platforms.MatchComparer
}
func (i *image) Name() string {
@ -186,7 +186,7 @@ func (i *image) Unpack(ctx context.Context, snapshotterName string) error {
return nil
}
func (i *image) getLayers(ctx context.Context, platform string) ([]rootfs.Layer, error) {
func (i *image) getLayers(ctx context.Context, platform platforms.MatchComparer) ([]rootfs.Layer, error) {
cs := i.client.ContentStore()
manifest, err := images.Manifest(ctx, cs, i.i.Target, platform)

View File

@ -19,6 +19,7 @@ package images
import (
"context"
"fmt"
"sort"
"github.com/containerd/containerd/content"
"github.com/containerd/containerd/platforms"
@ -183,8 +184,8 @@ func SetChildrenLabels(manager content.Manager, f HandlerFunc) HandlerFunc {
}
// FilterPlatforms is a handler wrapper which limits the descriptors returned
// by a handler to the specified platforms.
func FilterPlatforms(f HandlerFunc, platformList ...string) HandlerFunc {
// based on matching the specified platform matcher.
func FilterPlatforms(f HandlerFunc, m platforms.Matcher) HandlerFunc {
return func(ctx context.Context, desc ocispec.Descriptor) ([]ocispec.Descriptor, error) {
children, err := f(ctx, desc)
if err != nil {
@ -193,20 +194,12 @@ func FilterPlatforms(f HandlerFunc, platformList ...string) HandlerFunc {
var descs []ocispec.Descriptor
if len(platformList) == 0 {
if m == nil {
descs = children
} else {
for _, platform := range platformList {
p, err := platforms.Parse(platform)
if err != nil {
return nil, err
}
matcher := platforms.NewMatcher(p)
for _, d := range children {
if d.Platform == nil || matcher.Match(*d.Platform) {
descs = append(descs, d)
}
for _, d := range children {
if d.Platform == nil || m.Match(*d.Platform) {
descs = append(descs, d)
}
}
}
@ -214,3 +207,37 @@ func FilterPlatforms(f HandlerFunc, platformList ...string) HandlerFunc {
return descs, nil
}
}
// LimitManifests is a handler wrapper which filters the manifest descriptors
// returned using the provided platform.
// The results will be ordered according to the comparison operator and
// use the ordering in the manifests for equal matches.
// A limit of 0 or less is considered no limit.
func LimitManifests(f HandlerFunc, m platforms.MatchComparer, n int) HandlerFunc {
return func(ctx context.Context, desc ocispec.Descriptor) ([]ocispec.Descriptor, error) {
children, err := f(ctx, desc)
if err != nil {
return children, err
}
switch desc.MediaType {
case ocispec.MediaTypeImageIndex, MediaTypeDockerSchema2ManifestList:
sort.SliceStable(children, func(i, j int) bool {
if children[i].Platform == nil {
return false
}
if children[j].Platform == nil {
return true
}
return m.Less(*children[i].Platform, *children[j].Platform)
})
if n > 0 && len(children) > n {
children = children[:n]
}
default:
// only limit manifests from an index
}
return children, nil
}
}

View File

@ -19,6 +19,7 @@ package images
import (
"context"
"encoding/json"
"sort"
"strings"
"time"
@ -93,7 +94,7 @@ type Store interface {
//
// The caller can then use the descriptor to resolve and process the
// configuration of the image.
func (image *Image) Config(ctx context.Context, provider content.Provider, platform string) (ocispec.Descriptor, error) {
func (image *Image) Config(ctx context.Context, provider content.Provider, platform platforms.MatchComparer) (ocispec.Descriptor, error) {
return Config(ctx, provider, image.Target, platform)
}
@ -101,7 +102,7 @@ func (image *Image) Config(ctx context.Context, provider content.Provider, platf
//
// These are used to verify that a set of layers unpacked to the expected
// values.
func (image *Image) RootFS(ctx context.Context, provider content.Provider, platform string) ([]digest.Digest, error) {
func (image *Image) RootFS(ctx context.Context, provider content.Provider, platform platforms.MatchComparer) ([]digest.Digest, error) {
desc, err := image.Config(ctx, provider, platform)
if err != nil {
return nil, err
@ -110,7 +111,7 @@ func (image *Image) RootFS(ctx context.Context, provider content.Provider, platf
}
// Size returns the total size of an image's packed resources.
func (image *Image) Size(ctx context.Context, provider content.Provider, platform string) (int64, error) {
func (image *Image) Size(ctx context.Context, provider content.Provider, platform platforms.MatchComparer) (int64, error) {
var size int64
return size, Walk(ctx, Handlers(HandlerFunc(func(ctx context.Context, desc ocispec.Descriptor) ([]ocispec.Descriptor, error) {
if desc.Size < 0 {
@ -121,27 +122,22 @@ func (image *Image) Size(ctx context.Context, provider content.Provider, platfor
}), FilterPlatforms(ChildrenHandler(provider), platform)), image.Target)
}
type platformManifest struct {
p *ocispec.Platform
m *ocispec.Manifest
}
// Manifest resolves a manifest from the image for the given platform.
//
// TODO(stevvooe): This violates the current platform agnostic approach to this
// package by returning a specific manifest type. We'll need to refactor this
// to return a manifest descriptor or decide that we want to bring the API in
// this direction because this abstraction is not needed.`
func Manifest(ctx context.Context, provider content.Provider, image ocispec.Descriptor, platform string) (ocispec.Manifest, error) {
func Manifest(ctx context.Context, provider content.Provider, image ocispec.Descriptor, platform platforms.MatchComparer) (ocispec.Manifest, error) {
var (
matcher platforms.Matcher
m *ocispec.Manifest
p ocispec.Platform
m []platformManifest
wasIndex bool
)
if platform != "" {
var err error
p, err = platforms.Parse(platform)
if err != nil {
return ocispec.Manifest{}, err
}
matcher = platforms.NewMatcher(p)
}
if err := Walk(ctx, HandlerFunc(func(ctx context.Context, desc ocispec.Descriptor) ([]ocispec.Descriptor, error) {
switch desc.MediaType {
@ -156,8 +152,8 @@ func Manifest(ctx context.Context, provider content.Provider, image ocispec.Desc
return nil, err
}
if platform != "" {
if desc.Platform != nil && !matcher.Match(*desc.Platform) {
if platform != nil {
if desc.Platform != nil && !platform.Match(*desc.Platform) {
return nil, nil
}
@ -172,14 +168,17 @@ func Manifest(ctx context.Context, provider content.Provider, image ocispec.Desc
return nil, err
}
if !matcher.Match(platforms.Normalize(ocispec.Platform{OS: image.OS, Architecture: image.Architecture})) {
if !platform.Match(platforms.Normalize(ocispec.Platform{OS: image.OS, Architecture: image.Architecture})) {
return nil, nil
}
}
}
m = &manifest
m = append(m, platformManifest{
p: desc.Platform,
m: &manifest,
})
return nil, nil
case MediaTypeDockerSchema2ManifestList, ocispec.MediaTypeImageIndex:
@ -193,13 +192,13 @@ func Manifest(ctx context.Context, provider content.Provider, image ocispec.Desc
return nil, err
}
if platform == "" {
if platform == nil {
return idx.Manifests, nil
}
var descs []ocispec.Descriptor
for _, d := range idx.Manifests {
if d.Platform == nil || matcher.Match(*d.Platform) {
if d.Platform == nil || platform.Match(*d.Platform) {
descs = append(descs, d)
}
}
@ -214,15 +213,25 @@ func Manifest(ctx context.Context, provider content.Provider, image ocispec.Desc
return ocispec.Manifest{}, err
}
if m == nil {
if len(m) == 0 {
err := errors.Wrapf(errdefs.ErrNotFound, "manifest %v", image.Digest)
if wasIndex {
err = errors.Wrapf(errdefs.ErrNotFound, "no match for current platform %s in manifest %v", platforms.Format(p), image.Digest)
err = errors.Wrapf(errdefs.ErrNotFound, "no match for platform in manifest %v", image.Digest)
}
return ocispec.Manifest{}, err
}
return *m, nil
sort.SliceStable(m, func(i, j int) bool {
if m[i].p == nil {
return false
}
if m[j].p == nil {
return true
}
return platform.Less(*m[i].p, *m[j].p)
})
return *m[0].m, nil
}
// Config resolves the image configuration descriptor using a content provided
@ -230,7 +239,7 @@ func Manifest(ctx context.Context, provider content.Provider, image ocispec.Desc
//
// The caller can then use the descriptor to resolve and process the
// configuration of the image.
func Config(ctx context.Context, provider content.Provider, image ocispec.Descriptor, platform string) (ocispec.Descriptor, error) {
func Config(ctx context.Context, provider content.Provider, image ocispec.Descriptor, platform platforms.MatchComparer) (ocispec.Descriptor, error) {
manifest, err := Manifest(ctx, provider, image, platform)
if err != nil {
return ocispec.Descriptor{}, err
@ -276,7 +285,7 @@ func Platforms(ctx context.Context, provider content.Provider, image ocispec.Des
// in the provider.
//
// If there is a problem resolving content, an error will be returned.
func Check(ctx context.Context, provider content.Provider, image ocispec.Descriptor, platform string) (available bool, required, present, missing []ocispec.Descriptor, err error) {
func Check(ctx context.Context, provider content.Provider, image ocispec.Descriptor, platform platforms.MatchComparer) (available bool, required, present, missing []ocispec.Descriptor, err error) {
mfst, err := Manifest(ctx, provider, image, platform)
if err != nil {
if errdefs.IsNotFound(err) {

View File

@ -143,6 +143,7 @@ func WithImageConfigArgs(image Image, args []string) SpecOpts {
cmd = args
}
s.Process.Args = append(config.Entrypoint, cmd...)
cwd := config.WorkingDir
if cwd == "" {
cwd = "/"
@ -485,6 +486,18 @@ func getAllCapabilities() []string {
return caps
}
// WithAmbientCapabilities set the Linux ambient capabilities for the process
// Ambient capabilities should only be set for non-root users or the caller should
// understand how these capabilities are used and set
func WithAmbientCapabilities(caps []string) SpecOpts {
return func(_ context.Context, _ Client, _ *containers.Container, s *Spec) error {
setCapabilities(s)
s.Process.Capabilities.Ambient = caps
return nil
}
}
var errNoUsersFound = errors.New("no users found")
func getUIDGIDFromPath(root string, filter func(user.User) bool) (uid, gid uint32, err error) {

View File

@ -0,0 +1,192 @@
/*
Copyright The containerd Authors.
Licensed under the Apache License, Version 2.0 (the "License");
you may not use this file except in compliance with the License.
You may obtain a copy of the License at
http://www.apache.org/licenses/LICENSE-2.0
Unless required by applicable law or agreed to in writing, software
distributed under the License is distributed on an "AS IS" BASIS,
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
See the License for the specific language governing permissions and
limitations under the License.
*/
package platforms
import specs "github.com/opencontainers/image-spec/specs-go/v1"
// MatchComparer is able to match and compare platforms to
// filter and sort platforms.
type MatchComparer interface {
Matcher
Less(specs.Platform, specs.Platform) bool
}
// Only returns a match comparer for a single platform
// using default resolution logic for the platform.
//
// For ARMv7, will also match ARMv6 and ARMv5
// For ARMv6, will also match ARMv5
func Only(platform specs.Platform) MatchComparer {
platform = Normalize(platform)
if platform.Architecture == "arm" {
if platform.Variant == "v7" {
return orderedPlatformComparer{
matchers: []Matcher{
&matcher{
Platform: platform,
},
&matcher{
Platform: specs.Platform{
Architecture: platform.Architecture,
OS: platform.OS,
OSVersion: platform.OSVersion,
OSFeatures: platform.OSFeatures,
Variant: "v6",
},
},
&matcher{
Platform: specs.Platform{
Architecture: platform.Architecture,
OS: platform.OS,
OSVersion: platform.OSVersion,
OSFeatures: platform.OSFeatures,
Variant: "v5",
},
},
},
}
}
if platform.Variant == "v6" {
return orderedPlatformComparer{
matchers: []Matcher{
&matcher{
Platform: platform,
},
&matcher{
Platform: specs.Platform{
Architecture: platform.Architecture,
OS: platform.OS,
OSVersion: platform.OSVersion,
OSFeatures: platform.OSFeatures,
Variant: "v5",
},
},
},
}
}
}
return singlePlatformComparer{
Matcher: &matcher{
Platform: platform,
},
}
}
// Ordered returns a platform MatchComparer which matches any of the platforms
// but orders them in order they are provided.
func Ordered(platforms ...specs.Platform) MatchComparer {
matchers := make([]Matcher, len(platforms))
for i := range platforms {
matchers[i] = NewMatcher(platforms[i])
}
return orderedPlatformComparer{
matchers: matchers,
}
}
// Any returns a platform MatchComparer which matches any of the platforms
// with no preference for ordering.
func Any(platforms ...specs.Platform) MatchComparer {
matchers := make([]Matcher, len(platforms))
for i := range platforms {
matchers[i] = NewMatcher(platforms[i])
}
return anyPlatformComparer{
matchers: matchers,
}
}
// All is a platform MatchComparer which matches all platforms
// with preference for ordering.
var All MatchComparer = allPlatformComparer{}
type singlePlatformComparer struct {
Matcher
}
func (c singlePlatformComparer) Less(p1, p2 specs.Platform) bool {
return c.Match(p1) && !c.Match(p2)
}
type orderedPlatformComparer struct {
matchers []Matcher
}
func (c orderedPlatformComparer) Match(platform specs.Platform) bool {
for _, m := range c.matchers {
if m.Match(platform) {
return true
}
}
return false
}
func (c orderedPlatformComparer) Less(p1 specs.Platform, p2 specs.Platform) bool {
for _, m := range c.matchers {
p1m := m.Match(p1)
p2m := m.Match(p2)
if p1m && !p2m {
return true
}
if p1m || p2m {
return false
}
}
return false
}
type anyPlatformComparer struct {
matchers []Matcher
}
func (c anyPlatformComparer) Match(platform specs.Platform) bool {
for _, m := range c.matchers {
if m.Match(platform) {
return true
}
}
return false
}
func (c anyPlatformComparer) Less(p1, p2 specs.Platform) bool {
var p1m, p2m bool
for _, m := range c.matchers {
if !p1m && m.Match(p1) {
p1m = true
}
if !p2m && m.Match(p2) {
p2m = true
}
if p1m && p2m {
return false
}
}
// If one matches, and the other does, sort match first
return p1m && !p2m
}
type allPlatformComparer struct{}
func (allPlatformComparer) Match(specs.Platform) bool {
return true
}
func (allPlatformComparer) Less(specs.Platform, specs.Platform) bool {
return false
}

View File

@ -22,8 +22,13 @@ import (
specs "github.com/opencontainers/image-spec/specs-go/v1"
)
// Default returns the default specifier for the platform.
func Default() string {
// Default returns the default matcher for the platform.
func Default() MatchComparer {
return Only(DefaultSpec())
}
// DefaultString returns the default string specifier for the platform.
func DefaultString() string {
return Format(DefaultSpec())
}

View File

@ -27,6 +27,7 @@ import (
"github.com/containerd/containerd/errdefs"
"github.com/containerd/containerd/images"
"github.com/containerd/containerd/log"
"github.com/containerd/containerd/platforms"
ocispec "github.com/opencontainers/image-spec/specs-go/v1"
"github.com/pkg/errors"
"github.com/sirupsen/logrus"
@ -155,7 +156,7 @@ func push(ctx context.Context, provider content.Provider, pusher Pusher, desc oc
//
// Base handlers can be provided which will be called before any push specific
// handlers.
func PushContent(ctx context.Context, pusher Pusher, desc ocispec.Descriptor, provider content.Provider, platforms []string, baseHandlers ...images.Handler) error {
func PushContent(ctx context.Context, pusher Pusher, desc ocispec.Descriptor, provider content.Provider, platform platforms.MatchComparer, baseHandlers ...images.Handler) error {
var m sync.Mutex
manifestStack := []ocispec.Descriptor{}
@ -175,7 +176,7 @@ func PushContent(ctx context.Context, pusher Pusher, desc ocispec.Descriptor, pr
pushHandler := PushHandler(pusher, provider)
handlers := append(baseHandlers,
images.FilterPlatforms(images.ChildrenHandler(provider), platforms...),
images.FilterPlatforms(images.ChildrenHandler(provider), platform),
filterHandler,
pushHandler,
)

View File

@ -164,10 +164,7 @@ func (e *execProcess) start(ctx context.Context) (err error) {
return e.parent.runtimeError(err, "OCI runtime exec failed")
}
if e.stdio.Stdin != "" {
fifoCtx, cancel := context.WithTimeout(ctx, 15*time.Second)
defer cancel()
sc, err := fifo.OpenFifo(fifoCtx, e.stdio.Stdin, syscall.O_WRONLY|syscall.O_NONBLOCK, 0)
sc, err := fifo.OpenFifo(ctx, e.stdio.Stdin, syscall.O_WRONLY|syscall.O_NONBLOCK, 0)
if err != nil {
return errors.Wrapf(err, "failed to open stdin fifo %s", e.stdio.Stdin)
}
@ -184,10 +181,7 @@ func (e *execProcess) start(ctx context.Context) (err error) {
return errors.Wrap(err, "failed to start console copy")
}
} else if !e.stdio.IsNull() {
fifoCtx, cancel := context.WithTimeout(ctx, 15*time.Second)
defer cancel()
if err := copyPipes(fifoCtx, e.io, e.stdio.Stdin, e.stdio.Stdout, e.stdio.Stderr, &e.wg, &copyWaitGroup); err != nil {
if err := copyPipes(ctx, e.io, e.stdio.Stdin, e.stdio.Stdout, e.stdio.Stderr, &e.wg, &copyWaitGroup); err != nil {
return errors.Wrap(err, "failed to start io pipe copy")
}
}

View File

@ -112,7 +112,7 @@ func copyPipes(ctx context.Context, rio runc.IO, stdin, stdout, stderr string, w
rio.Stdin().Close()
return nil
}
f, err := fifo.OpenFifo(ctx, stdin, syscall.O_RDONLY, 0)
f, err := fifo.OpenFifo(ctx, stdin, syscall.O_RDONLY|syscall.O_NONBLOCK, 0)
if err != nil {
return fmt.Errorf("containerd-shim: opening %s failed: %s", stdin, err)
}

View File

@ -1,5 +1,5 @@
github.com/containerd/go-runc edcf3de1f4971445c42d61f20d506b30612aa031
github.com/containerd/console 4d8a41f4ce5b9bae77c41786ea2458330f43f081
github.com/containerd/go-runc acb7c88cac264acca9b5eae187a117f4d77a1292
github.com/containerd/console c12b1e7919c14469339a5d38f2f8ed9b64a9de23
github.com/containerd/cgroups 5e610833b72089b37d0e615de9a92dfc043757c2
github.com/containerd/typeurl a93fcdb778cd272c6e9b3028b2f42d813e785d40
github.com/containerd/fifo 3d5202aec260678c48179c56f40e6f38a095738c
@ -20,7 +20,7 @@ github.com/gogo/protobuf v1.0.0
github.com/gogo/googleapis 08a7655d27152912db7aaf4f983275eaf8d128ef
github.com/golang/protobuf v1.1.0
github.com/opencontainers/runtime-spec d810dbc60d8c5aeeb3d054bd1132fab2121968ce # v1.0.1-43-gd810dbc
github.com/opencontainers/runc 69663f0bd4b60df09991c08812a60108003fa340
github.com/opencontainers/runc 20aff4f0488c6d4b8df4d85b4f63f1f704c11abd
github.com/sirupsen/logrus v1.0.0
github.com/urfave/cli 7bc6a0acffa589f415f88aca16cc1de5ffd66f9c
golang.org/x/net b3756b4b77d7b13260a0a2ec658753cf48922eac
@ -32,8 +32,8 @@ github.com/opencontainers/image-spec v1.0.1
golang.org/x/sync 450f422ab23cf9881c94e2db30cac0eb1b7cf80c
github.com/BurntSushi/toml a368813c5e648fee92e5f6c30e3944ff9d5e8895
github.com/grpc-ecosystem/go-grpc-prometheus 6b7015e65d366bf3f19b2b2a000a831940f0f7e0
github.com/Microsoft/go-winio v0.4.7
github.com/Microsoft/hcsshim v0.6.11
github.com/Microsoft/go-winio v0.4.10
github.com/Microsoft/hcsshim 44c060121b68e8bdc40b411beba551f3b4ee9e55
github.com/boltdb/bolt e9cf4fae01b5a8ff89d0ec6b32f0d9c9f79aefdd
google.golang.org/genproto d80a6e20e776b0b17a324d0ba1ab50a39c8e8944
golang.org/x/text 19e51611da83d6be54ddafce4a4af510cb3e9ea4

View File

@ -232,7 +232,7 @@ export JAEGER_TRACE=0.0.0.0:6831
### Supported runc version
During development, BuildKit is tested with the version of runc that is being used by the containerd repository. Please refer to [runc.md](https://github.com/containerd/containerd/blob/v1.1.0/RUNC.md) for more information.
During development, BuildKit is tested with the version of runc that is being used by the containerd repository. Please refer to [runc.md](https://github.com/containerd/containerd/blob/v1.1.3/RUNC.md) for more information.
### Running BuildKit without root privileges

View File

@ -360,10 +360,10 @@ func (cm *cacheManager) prune(ctx context.Context, ch chan client.UsageInfo, opt
gcMode := opt.keepBytes != 0
cutOff := time.Now().Add(-opt.keepDuration)
locked := map[*cacheRecord]struct{}{}
locked := map[*sync.Mutex]struct{}{}
for _, cr := range cm.records {
if _, ok := locked[cr]; ok {
if _, ok := locked[cr.mu]; ok {
continue
}
cr.mu.Lock()
@ -431,7 +431,7 @@ func (cm *cacheManager) prune(ctx context.Context, ch chan client.UsageInfo, opt
return err
}
} else {
locked[cr] = struct{}{}
locked[cr.mu] = struct{}{}
continue // leave the record locked
}
}
@ -454,7 +454,6 @@ func (cm *cacheManager) prune(ctx context.Context, ch chan client.UsageInfo, opt
return err
}
toDelete = toDelete[:1]
opt.totalSize -= getSize(toDelete[0].md)
}
cm.mu.Unlock()
@ -483,7 +482,9 @@ func (cm *cacheManager) prune(ctx context.Context, ch chan client.UsageInfo, opt
if cr.parent != nil {
c.Parent = cr.parent.ID()
}
if c.Size == sizeUnknown && cr.equalImmutable != nil {
c.Size = getSize(cr.equalImmutable.md) // benefit from DiskUsage calc
}
if c.Size == sizeUnknown {
cr.mu.Unlock() // all the non-prune modifications already protected by cr.dead
s, err := cr.Size(ctx)
@ -494,6 +495,8 @@ func (cm *cacheManager) prune(ctx context.Context, ch chan client.UsageInfo, opt
cr.mu.Lock()
}
opt.totalSize -= c.Size
if cr.equalImmutable != nil {
if err1 := cr.equalImmutable.remove(ctx, false); err == nil {
err = err1

Some files were not shown because too many files have changed in this diff Show More